| dbo:abstract |
SCH-202,596 is a natural product which is a metabolite derived from an Aspergillus fungus. It acts as a selective non-peptide antagonist for the receptor GAL-1, which is usually activated by the neuropeptide galanin. SCH-202,596 is used for scientific research into this still little characterised receptor subtype. (en) |
| dbo:casNumber |
196615-89-1 |
| dbo:pubchem |
11758032 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/SCH-202596_structure.png?width=300 |
| dbo:wikiPageID |
44768571 (xsd:integer) |
| dbo:wikiPageLength |
2483 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1073190185 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbc:Receptor_antagonists dbr:Neuropeptide dbc:Aspergillus dbc:Cyclohexenes dbc:Spiro_compounds dbr:Natural_product dbr:Galanin dbr:Receptor_antagonist dbr:Galanin_receptor_1 dbc:Halogen-containing_natural_products dbr:Aspergillus |
| dbp:atcPrefix |
none (en) |
| dbp:c |
25 (xsd:integer) |
| dbp:casNumber |
196615 (xsd:integer) |
| dbp:chemspiderid |
9932733 (xsd:integer) |
| dbp:cl |
2 (xsd:integer) |
| dbp:h |
22 (xsd:integer) |
| dbp:iupacName |
methyl -5,7-dichloro-5'-methoxy-6-methyl-3,3'-dioxo-4-spiro[1-benzofuran-2,6'-cyclohexa-1,4-diene]-1'-carboxylate (en) |
| dbp:iupharLigand |
6128 (xsd:integer) |
| dbp:o |
12 (xsd:integer) |
| dbp:pubchem |
11758032 (xsd:integer) |
| dbp:smiles |
O=C\C4=C\[C@@H][C@@H][C@H][C@@H]4Oc2ccC (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
LNGFWDFUPRZMJI-VEHFIHCQSA-N (en) |
| dbp:wikiPageUsesTemplate |
dbt:Drugbox dbt:Pharm-stub dbt:Reflist |
| dcterms:subject |
dbc:Receptor_antagonists dbc:Aspergillus dbc:Cyclohexenes dbc:Spiro_compounds dbc:Halogen-containing_natural_products |
| gold:hypernym |
dbr:Product |
| rdf:type |
owl:Thing dbo:Software dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 dbo:Drug |
| rdfs:comment |
SCH-202,596 is a natural product which is a metabolite derived from an Aspergillus fungus. It acts as a selective non-peptide antagonist for the receptor GAL-1, which is usually activated by the neuropeptide galanin. SCH-202,596 is used for scientific research into this still little characterised receptor subtype. (en) |
| rdfs:label |
SCH-202,596 (en) |
| owl:sameAs |
freebase:SCH-202,596 yago-res:SCH-202,596 wikidata:SCH-202,596 https://global.dbpedia.org/id/zFEC |
| prov:wasDerivedFrom |
wikipedia-en:SCH-202,596?oldid=1073190185&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/SCH-202596_structure.png |
| foaf:isPrimaryTopicOf |
wikipedia-en:SCH-202,596 |
| is dbo:wikiPageWikiLink of |
dbr:Galanin_receptor |
| is foaf:primaryTopic of |
wikipedia-en:SCH-202,596 |
