| dbo:abstract |
Umirolimus (INN/USAN, also called Biolimus) is an immunosuppressant, a macrocyclic lactone, a highly lipophilic derivative of sirolimus. This drug is proprietary to Biosensors International, which uses it in its own drug-eluting stents, and licenses it to partners such as Terumo. Umirolimus inhibits T cell and smooth muscle cell proliferation, and was designed for use in drug eluting stents. This analog has a chemical modification at position 40 of the rapamycin ring. It has potent immunosuppressive properties that are similar to those of sirolimus, but the drug is more rapidly absorbed by the vessel wall, readily attaches and enters smooth muscle cell membranes causing cell cycle arrest at G0, and is comparable to sirolimus in terms of potency. (en) |
| dbo:alternativeName |
Biolimus, Biolimus A9, BA9 (en) |
| dbo:casNumber |
851536-75-9 |
| dbo:fdaUniiCode |
U36PGF65JH |
| dbo:kegg |
D09983 |
| dbo:pubchem |
11158972 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/Umirolimus.svg?width=300 |
| dbo:wikiPageID |
24824432 (xsd:integer) |
| dbo:wikiPageLength |
4037 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
998686243 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbr:Biosensors_International dbr:Sirolimus dbc:Immunosuppressants dbc:Polyenes dbr:International_Nonproprietary_Name dbc:Macrolides dbr:Terumo dbr:Immunosuppressant dbr:Rapamycin dbr:Smooth_muscle_cell dbr:United_States_Adopted_Name dbr:Restenosis dbr:T_cell dbr:Drug_eluting_stent |
| dbp:c |
55 (xsd:integer) |
| dbp:casNumber |
851536 (xsd:integer) |
| dbp:chemspiderid |
24582455 (xsd:integer) |
| dbp:h |
87 (xsd:integer) |
| dbp:kegg |
D09983 (en) |
| dbp:molecularWeight |
986.290000 (xsd:double) |
| dbp:n |
1 (xsd:integer) |
| dbp:o |
14 (xsd:integer) |
| dbp:pubchem |
11158972 (xsd:integer) |
| dbp:smiles |
CCOCCO[C@@H]1CC[C@H]C[C@@H][C@@H]2CC[C@@H]C (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
YYSFXUWWPNHNAZ-PKJQJFMNSA-N (en) |
| dbp:tradename |
Biolimus, Biolimus A9, BA9 (en) |
| dbp:unii |
U36PGF65JH (en) |
| dbp:verifiedrevid |
399692611 (xsd:integer) |
| dbp:wikiPageUsesTemplate |
dbt:Cn dbt:Drugbox dbt:Reflist dbt:Chemspidercite dbt:Fdacite dbt:Stdinchicite dbt:Immunosuppressants |
| dcterms:subject |
dbc:Immunosuppressants dbc:Polyenes dbc:Macrolides |
| gold:hypernym |
dbr:Lactone |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 yago:Agent114778436 yago:CausalAgent100007347 yago:Drug103247620 yago:Immunosuppressant103562958 yago:Matter100020827 yago:Medicine103740161 yago:PhysicalEntity100001930 yago:WikicatImmunosuppressants dbo:ChemicalCompound dbo:Drug yago:Substance100020090 umbel-rc:DrugProduct |
| rdfs:comment |
Umirolimus (INN/USAN, also called Biolimus) is an immunosuppressant, a macrocyclic lactone, a highly lipophilic derivative of sirolimus. This drug is proprietary to Biosensors International, which uses it in its own drug-eluting stents, and licenses it to partners such as Terumo. (en) |
| rdfs:label |
Umirolimus (en) |
| owl:sameAs |
freebase:Umirolimus yago-res:Umirolimus wikidata:Umirolimus dbpedia-sh:Umirolimus dbpedia-sr:Umirolimus dbpedia-vi:Umirolimus https://global.dbpedia.org/id/4wX2r |
| prov:wasDerivedFrom |
wikipedia-en:Umirolimus?oldid=998686243&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/Umirolimus.svg |
| foaf:isPrimaryTopicOf |
wikipedia-en:Umirolimus |
| is dbo:wikiPageRedirects of |
dbr:Biolimus_A9 |
| is dbo:wikiPageWikiLink of |
dbr:List_of_compounds_with_carbon_numbers_50+ dbr:MTOR_inhibitors dbr:List_of_signaling_peptide/protein_receptor_modulators dbr:List_of_drugs:_U dbr:Biolimus_A9 |
| is foaf:primaryTopic of |
wikipedia-en:Umirolimus |
