30-��������_� (original) (raw)
����� | ���? - �� - ���?-1 - ���?- �� | ����� | ���? - �����? | ����������--�--W | ����� ��� ����� . �217 | ****��. ��. � ������� �����** |
---|---|---|---|---|---|---|
���� | **������� - �-��������� | �������� | ����� ���� - 339 | ����� �� �����- 2022 | ����� | ���������� | ����������: 2022. 08. 28 |
28 - 30--������� ���.\ **28**--��������� ���� --������� \\-- ��������� \\ ������ ---������� -- �������� \\ **29**--���� --�������--�������--����� --��-��� \\ ����---����������� -- ���������� \\ ���������---���������---����-����� \\ 30--��������--����--������� \\ ����-����� \\ �����-������--������---�����������-��������-- �����������-����---��������, �-�--������--�������-��-�����--���-�����---�����-��-������ \\ ���� \\ ������� \\ ���-������-��-��� --���� -\\ _���-�����_ --����������� -- ��������-�����- \\ �������� \\ ������� \\ ���. ������� (���� ���������)
30 - �������� (2) \������� \ ��������
� - � \ �-� \ �-� \ �-� \ ��������������� ��������� \ ���������� \ <33%5F30L.htm>
�������� \ Brazil \\ ������� \ Uruguay (33_30)
�� ������ ����� ����: 1 � 2 � 3 � 4 � 5 � 6 � 7 � 8 �9 � 10 �11 �12 � 13 � 14 � 15 � 16 � 17 � 18 �19 �20 � 21 � 22 � 23 � 24 � 25 � 26 � 27 � 28 � 29 � 30 � 31 � 32 - 33
�������� \ ������� \ �������� \ ��������������� ���������
�������� \ ����� � ���������������� �������
�������� \ ��������� �������
��������
������� ������� ��������������� ��������� �������� 5-6��. Brumado Mine, Bahia, Brazil. �������: �����-���-2009. ����: � "������� ��������" ||
���������������!! (���-������-��-�����--xl 6x5x8 ��)--Gui-72
���������������. ���-����-��-������\ San Jose de Safira, �����-������, ��������. �������������� {010}+{100}+{001} ��������-��������������. 15�4.5�4.5��. �������: ���. ����� ��. �.�. �������� ��� (�87401, ������������ 1991 �.). ����: � �.�. ������.
�������������� - ����� ������� �� �����-����� (�����-��-������, �����-������, ��������) \ manganeudialyte from Pedra Balao, Pocos de Caldas, Minas Gerais, Brazil \\ �����-2010 (����� ��. ������ \ ���� ) \\ ������ �. �., ������� �., ������� �. �., ����������� �. �., �������� �. �. �., ��������� �. �. ���������������-����� ������� �� ������� ����� �� ������� [=�����-��-������--�.�.], ����� ������, ��������. - ����, 2010, �. 139, ���. 4, �. 35-47
��������� - ����� ������� �� �������� \\ Atencio, D., Coutinho, J.M.V., Mascarenhas, Y.P., Ellena, J. (2006): Matioliite, the Mg-analog of burangaite, from Gentil mine, Mendes Pimentel, Minas Gerais, Brazil, and other occurrences. American Mineralogist, 91, 1932-1936.
�������
�������. �����-������, ��������. �������: ������������ ����� ������������ ������� (���������). 148113. L.K. Land.����: � �. �. �������.
�������� - ����� ������� \\ Andrade, M. B., Atencio, D., Menezes Filho, L.A.D., Spratt, J. (2018) Melcherite, trigonal Ba2Na2Mg[Nb6O19].6H2O, the second natural hexaniobate, from Cajati, Sao Paulo, Brazil: Description and crystal structure. Mineralogical Magazine: 82: 111-120. \\
��������� \ Merrillite Ca9NaMg(PO4)7 \\ Sorriso river,�Juina,�Mato Grosso,�Brazil \\
- Kaminsky and Zedgenizov (2022) found merrillite as inclusions in lower-mantle diamonds from the Juina area in Brazil. Previously this rare mineral was known only in meteorites and Lunar rocks. This finding may be of importance because merrillite and tuite are considered members of the deep Earth minerals and potential hosts for rare earth elements and large ion lithophile elements.
---Kaminsky, F.V. and Zedgenizov, D.A., (2022) First find of merrillite in a terrestrial environment as an inclusion in lower-mantle diamond. American Mineralogist, 107(8), 1652-1655.
��������� * - ������ ��������� ���������������� �� ������, ���-�����, �������� \\ Atencio D., Coutinho J. M.V., Doriguetto A.C., Mascarenhas Y.P., Ellena J., and Ferrari V.C. Menezesite, the first natural heteropolyniobate, from Cajati, Sao Paulo, Brazil: Description and crystal structure. - American Mineralogist, 2008, Vol. 93, No. 1, p.81-87
����������. ���-����� �-�, �����-������, ��������. �������: ������-���-2008. ����: � �. �������. ��������: "������� ��������"
������������� -(Y)* \ Minasgeraisite-(Y \\\ ���������, �����-������, �������� \ �Jaguaracu pegmatite, Jaguaracu, Ipatinga, Minas Gerais, Brazil \\ Foord, E. E., Gaines, R. V., Crock, J. G., Simmons, W. B., Jr., Barbosa, C. P. (1986) Minasgeraisite, a new member of the gadolinite group from Minas Gerais, Brazil. American Mineralogist: 71: 603-607. \\ �Jaguaracu pegmatite, Jaguaracu, Ipatinga, Minas Gerais, Brazil��������
1. �����. ��������. 2. ������. ��������. �������: �����-���-2008. ����: � �. ��������.
�������� ��������� �� �-���������. �������: ���. ����� ����-�����. ����: �. ������.
�������. Hiassu farm, Itaju do Colonia, Bahia, Brazil -- ���� http://www.mindat.org/gallery.php?loc=251156&min=3701
�������
������� (�������). [�����-�`����] \ Olhos d'Agua Distr., Piaui valley , Taquaral , Itinga , �����-������, ��������. ����� 6 ��. �������: "�����". 2011.12.11. ����: � �. ������.
��������
1. �������� (����. �������). ������ �-�, �����-������, ��������. �������: �����-���-2008. ����: � �. ��������. 2. ������ ����-������� (����. ��������) � ��������� ����������. ��������. ��������� ��������� �.�. (�2899). ����� "�������", ������������. ����: � �.�. ������. 2022.06
������
������ (�������� ����� 103 ��). ��������. �������: ������������ ����� "����� � ����" (�����, ��������). ����: � �.�. ������.
������ ���������� ������. ������������� ������ (4050 ��). Victoria da Conquista, ����, ��������. ������������ ����� ������������ �������_�����. �������.����: � �. ���������. \\ ��. �� �����
��������
�������� ("���������" ������� ��������������� ����������). �����-������, ��������. ����: �. ��������. ��������: http://www.pegmatite.ru/small.htm
��������. ������� �-�, �����������-����, �����-������, �������� \ Itatiaia mine, Conselheiro Pena, Minas Gerais, Brazil. 11�11 ��. ����: �. ��������. ����: ���. ��������. ��������:�http://www.pegmatite.ru/ \\
�������������-(Ce) \ Nacareniobsite-(Ce) \\ Papanduva pluton, Morro Redondo complex, Tijucas do Sul, Parana, Brazil \\ Vilalva, F.C.J., and Vlach, S.R.F. (2010): Mineralogical Magazine 74(4), 645-658 �������������� \ Natrobistantite Alto dos Quintos Mine (Quintos pegmatite; Quintos de Baixo), Parelhas, Rio Grande do Norte, Brazil���������������� --Guillemin C. , 1972 ����� �������� �� ������ ����� ���������, �������� � ��������� ������ �������� (�������) \\ �������*(1978) - Agua Quente, ����; ������*(1853)--���-����; ��������*(1803)--�����-��-����� - ����� (������), �����-������ (�� Fleischer, 2004); �����������������*(1986)--����, ���-������-��-�����; ������������-(Y) (1974)--Raposa, �������; ��������*(1895)--�����������, ���-�����; ��������*\ yanomamite(1994)--����������, ����
��������
--Secco, L. and Lavina, L. (1999) Crystal chemistry of two natural magmatic norsethites, BaMg(CO3)2, from an Mg-carbonatite of the alkaline carbonatitic complex of Tapira (SE Brazil). Neues Jahrbuch fur Mineralogie, Monatshefte, 2, 87�96.����������� \ Olekminskite \\ ������ \ Tapira ��������, �����������, �����-������, �������� \ Tapira Complex,�Tapira,�Minas Gerais,�Brazil ; 19� 51' 51'' South , 46� 50' 8'' West ; https://www.mindat.org/loc-25003.html������ \ Olenite Na(Al3)Al6(Si6O18)(BO3)3O3(OH)- �����-������, ��������: Jenipapo district, Itinga, Minas Gerais, Brazil --��������� � ���������� ������ - https://www.mindat.org/locentry-953232.html������� \ Padmaite \\ ������-��-��� �-�, �����������, ����, �������� \ Buraco do Ouro mine, Cavalcante, Goias, Brazil��������*(1803)--�����-��-����� - ����� (������), �����-������ (�� Fleischer, 2004);
���������� \ Palladseite Pd17Se15 - ��������: �Itabira, Minas Gerais, Brazil - �������������� ��������������� \ Type Locality
�����������������*(1986)--����, ���-������-��-������������ \\ �-��� ������ � ����� ���� �������, �����-������, ��������� ������� �������� ��������� �������� �� 100 ���� ������� �� �������� ����������� ���������, ����� �����. ��-�� , �� ������� �������� ���������� ����� ����� �� 100 ���. (������� �.�., 2008, �. 232). �����
�������� ��. �����-������, ��������. 1. �����. ���� �-� \ Sapo mine, Conselheiro Pena. 2. ������������ "����" �� �������. ����� �-� \ Xanda Mine, Virgem da Lapa. 3. ������� �� �������. ���������� �-� \ Navegadora mine, Conselheiro Pena. �������: Luiz Menezes (������-���-2010). ����: � �. �����������.
��������
�������� �� �������� � ���������. �����-�����, �����-������, ��������. �������: ������-���. 2018.09. ����: � geo.web.ru/druza
�������. ��������. �������: �����. ����� ��. �.�. �������� ���(�203). ����: �. ������. \\ ���-171
�������� \\ �������� \ Timbauba, ���-������-��-�����, �������� \\ �-��� ��������� \\ �� "��������" 11�275-1973 �������� - ����. ���� www.mindat.org ��� �������� (�����!)-- Aracuai, Minas Gerais, Brazil �������������
����� �� ��������� (�������������). ����, ���-������-��-���, ��������. ����: �. ������. �� ��������� ������� "�����-���-2015". ���. ����� ��. �.�. �������� ���. 2015.02.27
������� (������ ���������) �� ������. 52�29 ��. ������� ������, ������� �-�, ��������, �������� \ Madeira pluton, Pitinga mine, Presidente Figueiredo, Amazonas, Brazil. Photo and collection Fernando Brederodes. This image has been released to the public domain and may be used freely. ��� ����������� ���� �������� � ������������ ��������� � ����� �������� ��������������.� ��������: http://www.mindat.org/photo-626097.html
����������
������� (����� 5 ��) �������� ������� ����������� �������� �����������. Frei Martinho, �������, ��������.(�. ��������). �������: ������-���-1010. ����: � "������� ��������"
�������. �����-��-���� �-� , �����������-�������� \ Morro da Mina Mine, Conselheiro Lafaiete (old Queluz de Minas), �����-������, ��������. �������: ������-���-2017. ����: � geo.web.ru/druza.
�������. �����-������, ��������. ����� ���������� ���������� "���� �����" (�����). ����: �. ������.
1. "�������� ������ �� �����-���� ����������������� �������� ������������ ��������. [�����������-��������, �����-������, ��������] \ Conselheiro Lafaiete, MG, Brazil". (�. ��������). �������: ����-����-�-���-2009. ����: � http://www.rusmineral.ru/ 2. �������. �����-��-���� �-� , �����������-��������, �����-������, �������� \ Morro da Mina Mine, Conselheiro Lafaiete (old Queluz de Minas), Minas Gerais, Southeast Region, Brazil. ����� 8 ��. �������: ������-���, 2013.09. ����: � �. ������. \\ ���-111--���-- ��-33_30
�����
����� �� ��������. ����-��������, ����, ��������. �������: ������-���-2023. ����: � �. ���������. 2023. 10.27 \ Novo Horizonte, Bahia, Brazil
�����, �����. ��������, ���� \ Ibitiara, Bahia , ��������. �������: ��. �������� �95274. ��� � 300-����� �����. ����� ��. �.�. �������� ���. ����������� �.�., 2016. ����: � �.�. ������. \\ ���-192
����� � ������� �� �������� ������. ��������, ����, ��������. �������: ������-���-2017. ����: � geo.web.ru/druza
�����. ��������. �������: ���. ����� ���� (���: ��������� �.�., 2013.07). ���� 1-3: � �.�. ������
����� � ������� � ��������. ��������. ������ ������� - 18�17�12 ��.. ������� � ����: � �. ��������. �������� � ���������: http://medwar.livejournal.com/ \\ " ��������� ������ � ������ ����������� �� ������������ ���� � ������. ���� �� ���� ��� �������, ����������, �� ���� ������ ���������� ������������� � ���� ��� ����� ������� ������. � � �������� ��������� - �����, ������������ ���������� ��������. �������� ���������� "�������� � ���������", ������� ����������, ����� �� ����� ������ ������ ����� �� ����� ��������� ������� �������, � ����� ��������� ������, ����������� ������. ������� ����� � ������ ������������". (�. ��������)
�����. Diamantina, Jequitinhonha valley, Minas Gerais, Brazil. 33 � 24 � 18 ��. ������� � ����: � �. ��������. ��������: http://www.pegmatite.ru/
����� � ���������. ����-��������, ����, ��������. �������: ����� Terra mineralia, ��������. ����: � �. ���������
����� (��������� ����������) �� ��������. ����-��������\ Novo Horizonte, ���� [�� �������� �������� ������� "�����-������"], �������� . ��. ������ John Rakovan (Rocks&Minerals, 2006, �4). ������-���-2006. ����: � �.�. �������.
1. ����� (��������� ����������) �� ��������. [����-��������\ Novo Horizonte, ����], �������� . ��. ������ J. Rakovan (Rocks&Minerals, 2006, �4). ������-���-2007. ����: � �. �������. 2. ����� (�������). ����������, �����-������, ��������. ����: � "������� ��������"
����� �� ������� (�������������). 2�1�1,2��. Cuiaba distr., Gouveia, �����-������, ��������l. ������� � ����: � "������� ��������"
����� � ������ ("���������"). "��������-���-���������", ��������. �������: �.�. ���������. ����: � �.�. ������. \\ ��. ����� ����� �����, �. 151 ||
����� � ������ ("���������"). ��������. �������: �.�. ���������. ����: � �.�. ������. ||
���������������\\ Scholz R, Chukanov N V, Menezes L A D, Atencio D, Lagoeiro L, Belotti F M, Chaves M L S C, Romano A W, Brandao P R, Belakovskiy D I, Pekov I (2014) Cesarferreiraite, Fe2+Fe3+2(AsO4)2(OH)28�H2O, from Eduardo mine, Conselheiro Pena, Minas Gerais, Brazil: Second arsenate in the laueite mineral group. American Mineralogist 99, 607-611 (���������������)������� - ������� �-� \\ Cassedanne, J.P & Resende, J. P. (1983): Sellaite from the Brumado mine. Mineralogical Record 14 (3): 179-181
������ \ Senaite Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 \\ Datas, Minas Gerais, Brazil - �������������� ��������������� \ Type Locality
������. [Datas = Dattas*, �����-������] ��������. �������: �� (�224, ������ �.�., ������ 1916 �.). ����: � �.�. ������. \\ ���������: http://www.mindat.org/min-3617.html \\ http://www.mindat.org/loc-397.html
���������
-Maicuru alkaline complex, Maicuru range, Monte Alegre, Para, Brazil
--����� ���� � [�������], ����. �������� - "��������� ������� ������ �������� ��������� �� 6 �" --�� �� "��������" (���. 8�258-1986 �.) \\ �� ������������� \ Serrabrancaite (TL) MnPO4�H2O- ����-�����-������ \ Witzke, T., Wegner, R., Doering, T., Pollmann, H., Schuckmann, W. (2000) Serrabrancaite, MnPO4�H2O, a new mineral from the Alto Serra Branca pegmatite, Pedra Lavrada, Paraiba, Brazil. American Mineralogist: 85: 847-849. \\ �������������* - ����� �������
������������� \ Serrabrancaite MnPO4�� H2O \\ �Serra Branca pegmatite, Pedra Lavrada, Paraiba, Brazil \\ Witzke, T., Wegner, R., Doering, T., Pollmann, H., Schuckmann, W. (2000) Serrabrancaite, MnPO4�H2O, a new mineral from the Alto Serra Branca pegmatite, Pedra Lavrada, Paraiba, Brazil. American Mineralogist: 85: 847-849.
�������
�������, �������. �����-�����, ����-����, �����-������, ��������. �������: ����� Terra mineralia, ��������. ����: � �. ���������
��������� . ��������
��������. �����-����, ���� ���-�����, �����-������, ��������. �������: �� (�52512). ����: � �.�. ������.
��������. �����-����, ���� ���-�����, �����-������, ��������. �������: ���. ����� ��. �.�. �������� ��� (�52512). ����: � �.�. ������
��������� \ Scorzalite Fe2+Al2(PO4)2(OH)2�������
1. ���������. ���� �-� \ Onca mine, ���-������-��-�����, ��������. �������: �� (�60262. [������������ ����� ������������ �������, ���-����]). ����: � �.�. ������.|| 2. �������. "����", ��������. �������: �� (�81736, �������� �.�., 1982). ����: � �.�. ������. \\ �����. ��������! ��������, Pocos de Caldas, �����-������ - ��. http://www.mindat.org/loc-12032.html � ���� - http://www.mindat.org/gallery
�������. [�����-��-������, �����-������], ��������. �������: �����. ����� ����� (�-940). ����: � �.�. ������
������� �� ��������. �������: ������������� �����"���� �����"(������). \ Hiassu farm,�Itaju do Colonia,�Bahia,�Brazil .2023.10.20. ����: � �.������
�� ����������� ������. �������� (Itaju do Colonia, ����). ��������� ������������ ����, ��������� ��������� ���������� ������ ����� � ������ ������� ����������.... "Outcrop of pegmatitic vein composed of sodalite of intense blue color and white veins of cancrinite, in Itaju do Colonia, Bahia, in 1973". Photograph taken by Andrea Bartorelli. ���� �� ����� Cornejo, C. and Bartorelli, A. (2010): Minerals & precious stones of Brazil. Solaris Cultural Publications, Sao Paulo, Brazil, 704 pp.--��. ���.609.\\ ���-152, 169 \\ ���������: Hiassu farm,�Itaju do Colonia,�Bahia,�Brazil - Source of "Blue Bahia" dimension stone from an about 1 km2�sodalite syenite intrusion.--�� www.mindat.org \\
����������
���������� [����� �����������]. ���������� �-�, �����-������, �������� \ Etched spessartine garnet crystal from Navegadora Mine, Penha do Norte, Conselheiro Pena, Doce valley, Minas Gerais. 8�5�4,5 ��. ������� � ����: � �. ��������
��������. ����� �-� \ Neves mine, �����-������, ��������. ����: � �. �������. \\ ���-118
���������!! --15 ���� - https://www.mindat.org/gallery.php?loc=366&min=3753
- Eduardo claim, Conselheiro Pena, Minas Gerais, Brazil --����
- Gramiais farm, Rubelita, Minas Gerais, Brazil !! - 4 ����
- Ipira, Bahia, Brazi --����
- Rubelita, Minas Gerais, Brazil - 6 ����
- Serra da Mangabeira, Paramirim, Bahia, Brazi� --3 ����!
- ������ �� ������ \ Tapera do Rochedo, ���� \ Bahia, �������� \\ ���������!!--� ; xls<10 �� --MR, 1977, v.8, 383-385
����������������* - ����� ������� �� ������������ �-�� �. ������, �������� \\ - Haggerty, S. E., & Mariano, A. N. (1983). Strontian-loparite and strontio-chevkinite: Two new minerals in rheomorphic fenites from the Parana Basin carbonatites, South America. Contributions to Mineralogy and Petrology, 84(4), 365-381\\ ��. ����� �������* \ Cerro Sarambi,�Amambay Department, �������� ������� \ Souzalite (Mg,Fe2+)3(Al,Fe3+)4(PO4)4(OH)6�� 2H2O - ��������: Corrego Frio mine, Linopolis, Divino das Laranjeiras, Minas Gerais, Brazil - �������������� ��������������� \ Type Locality
� - � \ �-� \ �-� \ �-� \ ��������������� ��������� \ ����������
��������: ���� \ BAHIA \\ ���� \\ �����-������ \\ �������\\ ���-������-��-��� \\ ��������-�����
28 - 30--������� ���.\ **28**--��������� ���� --������� \\-- ��������� \\ ������ ---������� -- �������� \\ **29**--���� --�������--�������--����� --��-��� \\ ����---����������� -- ���������� \\ ���������---���������---����-����� \\ 30--��������--����--������� \\ ����-����� \\ �����-������--��������, �-�---�������-��-�����--���-����� \\ ���� \\ _�������_ \\ ���-������-��-���