15 - ����_�� (original) (raw)

����� ����� ������� -����� -�� - ������ �������� ���? -���-�����? ����������--�--W ����� ��� ����� . �240 ��. ��. � ������� �����
����� �������+- �� -- �-��������� ����� - клуб ����� ���� - 361 ����� �� ����� - 2024 ������� | ���������� ����������: 2024. 07. 21

15 - ���� (��)_ �-� - �-� - ��������������� ��������� � ����������

�� ������ ����� ����: 1234567 891011121314151617181920212223242526272829303132 - 33 ----------------------- -----------------------------------------------------------------------------��

����������� \ ���������� �-�� \ ������� \ ������� ������ \ ������ \ ���������� \ ������ \ ������� \ �������� \ ���� \ ������ \ �������� ������ \ ����\ ����� \ ������

������https://www.mindat.org �������� - 363 ����� �������� - 13 ���� ��������� - 490 �� 2019.07.11
�������� \ Jordan - https://www.mindat.org �������� - 176 ����� �������� - 10 ���� ��������� - 23 �� 2020.12.06
����https://www.mindat.org �������� - 370 ����� �������� - 10 ���� ��������� - 943 �� 2019.08.14

���� (��) . ��������������� ���������_����� �������

���� (��)_����� � ���������������� �������

��������������� ��������� ������� � ����������. ��������: � �.�. ������. ��������: �������� � �������� (��������� �� �����) ��������� ��������������� ������� ��������� (�������� �� ����� �������� � ����������� ��������). ����� ������������� ������ ��� ��������������� �����. ���������: ������ �.�. ����� ���� ��� ����������. �., 2004. - 284 �.

��������������� ��������� � ���-�������� ����� ���� � ��������� �������. ��������: � �.�. ������. ��������: �������� � �������� (��������� �� �����) ��������� ��������������� ������� ��������� (�������� �� ����� �������� � ����������� ��������). ����� ������������� ������ ��� ��������������� �����. ���������: ������ �.�. ����� ���� ��� ����������. �., 2004. - 284 �.

������_������ �.�. ������: �������� � ��������������� (������� �����) \ ������ � ��������� "����� ���������"-- http://geo.web.ru/druza/L-Kavkz-SM.htm \\ ���������� - http://geo.web.ru/druza/L-Kavkz-lit.htm

1. �����. �������� (= ��������) �.. ������������ ��., �����������. �������� 4 ��. �������: ��. ����: �. ������. ��������: www.fmm.ru. 2. �������. ������� ���������� ����������. 2,5�2 ��. ������. �������: ��

���� (�) ��������� ������� �� �������� - https://geo.web.ru/druza/33_15.htm \ �� ����� ����� (2023.09.15) \\ ����!!-13�; ����-���������-2�; ������; ���������; ������-2�; ������; �������; ��������; �������--6�; ��������--3�; ���������; ������; ���������-2�; ��������; �����������!!--5�; �����������; �����!!--2�; ��������;--3�; ������!!-6�; ���������; ��������!!; �����!!--3�; ���������; �������--3�; ������������; �������������; ��������� - ���. ��-��; ����--2�; ��������--�����; ���������--3�; �������!!!--3�; �������-2�; �������*-2�; ������; ������*; �������--3�; �����!!--8�; ����������-2�; ��������-�+���.; ���������; ���������!!; ���������!; ����������; ����������-2�; ������!!; ��������--2�; ��������!!--2�; �������������; ������������; ���������--2�; ��������; ��������; ����������; ��������--2�; ����; ����--3�+���; ���������-2�; ����������; ���������; ����������; ��������; �����!!; �������; ����������-2�; �������; ���������; �������--4�; ��������; ��������; ����������; �����������; ����-���������;; ��������* -2�; ������; ������-2� ; �������!1-3�; �������; ������

***

������ ��������� ������� �� ���� �������� -�https://geo.web.ru/druza/33_15.htm��(2023.09)

| | | | | ---------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------- | ------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------- | | �����!!����"�����-���������". [������������� �-���], �����������.������������������������������������������� ��������������������������������� �������������� ��������� \ Apophyllite \ ���������������������������������������������������* \ Baghdadite (TL) Ca6Zr2(Si2O7)2O4 ���������������*�����������* �������������������!���������������������������������������������������������������������������-(Y) \ Gagarinite-(Y) �������� *����������������������� ��������� \������������������������������������������������������������* \ Hydroxyplumbopyrochlore (Pb1.5?0.5)Nb2O6(OH)����������������������������������� ������ �������� ��������� \ Daliranite�����������������������������* \ Dzierzanowskite (TL) CaCu2S2 ������� \ Diaspore���������������* \ Dymkovite Ni(UO2)2(As3+O3)2�7H2O ����������������� �������� (zadovite, IMA2013-031), BaCa6[(SiO4)(PO4)](PO4)2F, ����������� \ Zuktamrurite, FeP2 ������������� \ Ye'elimite - https://www.mindat.org/min-4356.html \��������� \ Indigirite Mg2Al2(CO3)4(OH)2 � 15H2O��������������������� ���� \��������������������* \ Calcurmolite (Ca,Na)2(UO2)3Mo2(O,OH)11 � nH2O���������������* \ Qandilite (Mg,Fe3+)2(Ti,Fe3+,Al)O4���������� \ Cannizzarite Pb48Bi56S132�������������������* \ Qatranaite CaZn2(OH)6(H2O)2��������������� \ ��������� �������������� (����. ����������)����������������������������������������� \ Konyaite Na2Mg(SO4)2 � 5H2O���������������������������������� \ Crocobelonite \ CaFe3+2O(PO4)2 �������������������������������������� \ Lakargiite Ca(Zr,Sn,Ti)O3�������� \ Loughlinite Na2Mg3Si6O16 � 8H2O������ �������� \ Laumontite | ���������������� \ Magnesiocopiapite MgFe3+4(SO4)6(OH)2 � 20H2O �������� �������� �������� ��������� ���������!@ ���� �����������*(1883)--- �������, �������� � ����� ������������ ���������! �������� \ Modderite (Co,Fe)As �������� �������� ��������� \ Murashkoite, FeP \ ������ ���������� \ Nabimusaite https://www.mindat.org/min-43580.html �������������� *\ Nataliakulikite IMA No. 2018-061. Ca4Ti2(Fe3+,Fe2+)(Si,Fe3+,Al)O11. �������* ���������� �������� ������� ���� �������� �������� ������� @ ��������� ������� ����� ��������� ����������� ���������� �������� \ Priceite Ca2B5O7(OH)5 � H2O ��������� \ Probertite NaCaB5O7(OH)4 � 3H2O ���������� ���������� ������* \ Rauchite \ Ni(UO2)2(AsO4)2 � 10H2O \\ ������������� �-���, �������� �������*(1888)--����� ������� --�. �������, ����� ������� ���������� ����� ���������* � ��������* �������� \ Siwaqaite (TL) Ca6Al2(CrO4)3(OH)12 � 26H2O \ ������� C�������� \ Sinjarite CaCl2 � 2H2O ������� Bi2TeO5 ������� �������� ���������� ���������*(1960) \ Talmessite Ca2Mg(AsO4)2 � 2H2O- �������������� * Hg3(Sb,As)S3. ��������������� \ �������- �������� ��������� --����� ������� �� ������ ������������� �������� ������� ���������� \ Walstromite, BaCa2(Si3O9) ����������* \ Ferdowsiite Ag8(Sb5As3)S16 - ����� ������� \\ ������ �-��� (Au) , �������, ���� \ Barika ore deposit, Sardasht ������� ������� \ [Faujasite-Ca] ����������� - ����� ������� �� ������ �������� ������� \ Khademite Al(SO4)F � 5H2O �������� ����������. ����������� ������� \ Hashemite -BaCr6+O4 ��������*(1963) \ Chromatite CaCr6+O4 � ������ ����-��������� \ Cr-��������� (����. ����������) ������� ����� �������� ������� �������* \ Chegemite Ca7(SiO4)3(OH)2 ��������� * ������� �������� \ Chantalite \\ CaAl2(SiO4)(OH)4 ������� \ Edgrewite Ca9(SiO4)4F2 ��������� \ Eltyubyuite Ca12Fe3+10Si4O32Cl6 - ����� ������� � ���. ������� ������ ����������� \ Epistilbite \\ �������!! ������� ��������� ������ \ Ephesite NaLiAl2(Al2Si2O10)(OH)2 ������ \ Yukonite Ca3Fe3+(AsO4)2(OH)3 � 5H2O \\ Kerman Prov, Iran �������* \ Yazganite - ������ |

**�����!!**--���� �����, ����������� ��������, �� ������� ��������--��-�� �� 1,5 �� --�������� �.�, 1977.10.06, �����

����

--����� 100 �-��� � ���������� � ����������--���������� �.�., 1968 \\ ��

���� . ������ �. \ ������� �., ����������� �-�, �������. �������: �.�. ��������. ����: � �. ������.

����. ����������� �-�, �������. ����� 25 ��. �� �������� �.�. ���������. �������� "�������� � �����". ��� ��. �.�. �����������, ������. 2020.09.04. ����: �. ������

����. ��������, ������. ����� 10 ��. �������: �����. ����� ��. �.�. �������� ��� (���-4897). ����: � �.�. ������

���� � ������� (�����). ����������� �-�, �������. ���������������� ����� ����� ( �15). 20�12 ��. ����: � �.�. ������

���� � ������� (�����). ����������� �-�, �������. �������: �����. ����� �����. 20�12 ��. ����: � �.�. ������

�.�. ���������� ������ ������ �� ������. ����� � �������������� ������� (����������� �-�). ���� �� ������� �.�. �����������. ���. ����� ����-�����.2014.05.13. \\ ���

������� (�����), �������. ����� � ��������������. ����� �� ������ �.�. �����������, 2016.02.17

���� �� ������� �.�. �����������. ���. ����� ����-�����.2014.05.13.

�.�. ���������� ������ ������ �� ������. ����� � �������������� ������� (����������� �-�). ���. ���� �� ������� �.�. �����������. ���. ����� ����-�����.2014.05.13. \\ ���-118

���� �� ������� �.�. �����������. ���. ����� ����-�����.2014.05.13.

�.�. ���������� ������ ������ �� ������. ����� � ������������� ������-�����, ���. ������. ���. 284�106 ��. ���� �� ������� �.�. �����������. ���. ����� ����-�����.2014.05.13.

������� ����. Seghale �-���, ����� ����� ����. ������� \ Khorasan, ����. �������: ������-���. 2018. ����: � ����� West. ��������: http://webmineral.ru/

"�����-���������". [������������� �-���, ���� �������], � �� �� ����������, �����������.

"�����-���������". [������������� �-���, ���� �������], � �� �� ����������, �����������. ����: � �.�. ������.

������

������. ����� �������� ���������������-�������, �������� �� �����. ������, �������. �������: ���. ����� ��.�.�. �������� ��� (����. �.�. ���������. ST2033. ��. 1978. �.�. �������� (���)(����)). ����: � �.�. ������. \\ ���-155

1. ��������� (���������� ��������� �� 4-5 ��). ��������, �����������. �������: ����. ����� ��. �.�. ������ ����. 2. ��������� �� ������������ (�������������). ��������, �����������.~8 ��. �������: ���. ����� ��.�.�. �������� ��� (��-1296). ���� 1-2: � �.�. ������.

���������

- ��������� �.�. ��������� � ���������� ����� ��������� // ������� ���. 1971. ����� 100. ���. 1, ���. 95-96

- �������, ������--�-� ��. �������--�������� �.�., 1939 \\ �������� �.�. � ��., 1986�; \\ ��-3

�����

�������� �. �. � ��. � ������� � ������������ ���������� ������ � �������. \\ ��� ������, 1975, 61, �3, �. 160-163.

������

������. ����������-�������� �������� �������������� ������� ������� �������� ��������� ��������...6,5�4,5 ��. �����, ������� (��). "����� ������� ��������� ����� ��������� 19 �.". �������: ���. ����� ��. �.�. �������� ���. (����.: �.�. ��������. �198. ��� - �.�. ��������, �����, 1975). ����: � �.�. ������.\\ ��13

������

������ �.�., �������� �.�., 1991. ������������� �������������� ����������. �-��� �����. ��� � �����. �� "��������"- 8�68-1992 �.

������. ������, �����������. �������: �� (������� �.�., 1921). ����: � �.�. ������.

�������� ����������. ����� �., ����������� �-��, ���������� ����; �����������. �������: ���������������� ����� "������� �������", �������������. 2017.04.17. ����: � �. ������. \\ ���-154

�������.

�������. ��������, �����������. ������ ��������� ����� 35 ��. �������: �.�. ��������. XLIII �������� "������������ � �����". ����: � �.�. ������

��������. ��������, ������. �������: �����-������������� ����� ��� "������" (�������). ����: � �.�. ������

�������* - �������� ���*, ������, [�� ������] , ������

�������. �������� ���*, ������, [�� ������] , ������. 6�7 ��. �������: �����. ����� ����-����� (�-1127. ������ �.�.. ���� "��������-�����" , 2011) . ����: � �. ������.

������� (���������). �������� ���, ������, ������. 9�7 ��. �������: �����. ����� ����-����� (�-1128. ������ �.�..���� "��������-�����" , 2011) . ����: � �. ������.

�������. ��� �������� ���, ��������� �-��, �� ������. �������: �� (�90799. ���: ������� �., 1988). ����: � �.�. ������.

�������� �������� � ����������� ���������. ��� �������� ���, ������, ������. ������ ��������� - 1 ��. �� ���� ���������� ������ ��������� - ���������� ��������� ���������� ��������� � ��������. �� ����� ������� ��� �� ���� �� ����������� ��������� ������������� ������� � ��������. ������� � ����: � �. ��������. ��������: http://medwar.livejournal.com/

������� (���������� �-���, ����). �������� (��������, �����������). �������: ���. ���. ����-����� (�� ����. �.�. ������). ����: � �.�. ������.

��������� \\ �������� �.�. ���������� � ����. �. ������ (���. ������). - ����, 1933, �. 62, �1, 51-56 \\ �������� �.�. � ����������� ��������������� ������� ������������ ������� � �� ��������.- ����, 1958, �. 87, �6, 633-646

��������

��������. ��������, �����������. ������� 8 ��. ������� � ����: � �.�. ������

��������. ��������, �����������. �������: ���. ����� ��.�.�. �������� ��� (�92310. ������������ �����, 2006 �.). ����: � �.�. ������.\\ ���-134 \\ 33_15

1. ��������. ��������, �����������. 2. �������� (��-�� �� 3-4 ��), ��������, ������. ��������, �����������. ������� 1-2: ��. ���� 1-2: � �.�. ������.

���������. ��������, ������, �������. ����� 8 ��. �������: �����. ����� ��. �.�. �������� (�� ����. �.�. ����������. �2188). ����: �. ������, 2020.08.

��������� (�������). Turhal, ������. �������: ����� �����-������. ��-��, �����. ����: � �. ������, 2017

������

**--**�����-������ (�����������) �., �������������� �����, ������ \\ ��������. ���� \\ ������!!--�� 10�8�8 �� , � ��������� --1) ���. ���. ������. ��-�(�), 1977.10 2) �� (�)\\ ��������� ������� ����. ���, 1959, 2, 321 \\ ��

������ (����������) � ����������. ��������, �����������. ��������� �� 4-5 �� � �����. �������: �� (�89817). ����: � �.�. ������.

��������� \ Apophyllite

--������� ������� � ���������� ������ - - �������� �.�., 1952

������������� (Mn-����������), ������������ �������������� ������� � ������� ����������� ��������. �����, � �� �� ��������, ������. �������: ���. ����� ��.�.�. �������� ��� (�89205, �������� �.�., ���� 1977 �.). ����: � �.�. ������.\\ ��

1. ������������� (������������ �������������� ������� � ������� ����������� ��������). �����, � �� �� ��������, ������. �������: �� (�45535, ������������ �.�., 1947). 2. "�����-���������". [������������� �-���, ���� �������], � �� �� ����������, �����������. ����: � �.�. ������.

--������������ �. �. ����� ������� �� ������� ������������ ������ �� ����������. \\ ��������� �� ����. � ���. ������, 1914, �. XVI, ���. 5-6.

--������������ �. �. ������������� ������ � ���������� � ������������ ����������. \\ ����. ����������� ��-��, 1922, �2.

--������� �. �. ��������� �� ������������ �-��. - ���. ���, 1948, �. LXXVII, �4, �. 253-257

�������� \ Aragonite \ CaCO3

- �������: Styrian Erzberg, Eisenerz, Leoben District, Styria, Austria --"�������� �����" �������� ����� --���� (������� � ���. �� ����������, ��������)

--� ���������� � ���������: 1) ��������� 2) �����-- �������� �.�., 1952

--��� �������� - ���� - - �������� �.�., 1952

��������. ����� �� ����� ���� (����������� �������������������; ������ ����������� 10 ����). �������, ����������, �����������. �������: �� (�1235). ����: � �.�. ������.

�����������

33_15 - ��������, �����������--�-1-1, 314

�����������

�����������. ������-����, �. ������, ������. �������: �����. ���. ��. �.�. �������� ���. ����: � �.�. ������. \\ ���-123

�����������. �������� ����� ������� �������.-���������������� ����������, � �������� ���������, ����� �� ��������� ��������� � ������. 10�6,5 ��. �-��� ������, ����. �. �������-�����, �-� �. ���, ����. ����, ������. �������: �� (��������� �.�. ���������. ST 928. ����� � �.�. ��������. ���� ������� 1977 �.). "���������� ������� (���� ��� 3). ���������� ������ ��� ���� ���������� ������������. ����� ������ �������." (�.�. ��������). ����: � �.�. ������

�����������. �������� ����� ������� �������.-���������������� ����������, � �������� ���������, ����� �� ��������� ��������� � ������. 10�6,5 ��. �-��� ������, ����. �. �������-�����, �-� �. ���, ����. ����, ������. �������: �� (��������� �.�. ���������. ST 928. ����� � �.�. ��������. ���� ������� 1977 �.). "���������� ������� (���� ��� 3). ���������� ������ ��� ���� ���������� ������������. ����� ������ �������." (�.�. ��������). ����: � �.�. ������

����������� (�����������!). �������� ����. �-�, ��. �. �����, ����. �����������, ����. ~5 ��. �������: �����. ����� �����(�-516. ������ �., 2009). ����: � �.�. ������

�����������. �������� ����. �-�, ��. �. �����, ����. �����������, ����. �������: ����. ����� ��. �.�. ������. ����: �. ������.

�������� \ Baghdadite (TL) Ca6Zr2(Si2O7)2O4 - ����� ������� \\ Dupezeh Mountain, Hero, Qala-Diz (Qala-Dizeh; Qala-Diza), Sulaymaniyah Governorate, Iraq - �������������� ��������������� \ type locality

- Al-Hermezi, H. M., McKie, D., & Hall, A. J. (1986). Baghdadite, a new calcium zirconium silicate mineral from Iraq. Mineralogical Magazine, 50, 119-123.

�������*(1928) - ����� ������� - �������� ��������, �������

�������� \ Baksanite Bi6Te2S3 \\ ������ �� ���� ������, � ������ ������� ����������� ������������� �������� - type locality ���������.

- ������: ��������, ���. ������, ������ \ Anomaly No. 3, Tyrnyauz Mo-W deposit, Baksan valley, Kabardino-Balkaria, Russia - �������������� ��������������� \ Type Locality \\ �������� ������ � 1989 ���� � ������ ����������� ������� �14, ����������� ��������� ���� �������� �3 �� �������� ������� W-Mo-������������� ��������, ����� ���� ������ �. ������, ���������-��������, �������� ������. �������� ����������� ����������� ��������� �� 13 ��, ������ � ��������� � ��������-A, ���������, �����������������, � ������-����������� ������� ����� ��������-������������� ������. \\ ��� https://webmineral.ru/minerals/item.php?id=21996

- ����� �.�., �������� �.�., ��������� �.�., �������� �.�., �������� �.�., �������� �.�. �������� Bi6(Te2S3) - ����� ������� �� ��������� (�������� ������) // ����. ���, 1996, 347, 6, 787-791.

�����������* \\ ������� �. �., ������� �. �., �������� �. �., ������ �., ������� �. �., ���������� �. �., ����������� �. �., ������ �.�. ����������� BaFe3+12O19 - ����� ������� ������ ��������������� �� �������� �������� (�������). - ����, 2010, �. 139, ���. 3, �. 22-30.

�����������. ��������, �������. �������: ���. ����� ��. �.�. �������� ��� (���: ����� �.�.). ����: � �. ������.

�����

1. �����. ����, ����� �����, �-� ��������, �. ������. (�85322. ���: ������� �.�., 1987). 2. �����. ����������� �-�, ����. �. ������, ���. ������, ������. �-4806). ������� 1-2: �� . ���� 1-2: � �.�. ������.

��������

1. ��������. ��������� ������� � ����� �����������. ���� ��������� �����, �������. �������: �����. ����� ��. �.�. �������� ��� (���� �����. �95338. ����������� �.�., 2016). 2. �������� (���������� ��������) � ������. �������� ��������, �������. 5�4�3 ��. �������: �����. ����� ����-����� (�-1043. ���: ��������� �., 2011.09. �������: ������� �.). ���� 1-2: � �. ������.

�������� (������. �����) �� ��������������� ������. �������� ��������, �������. �������: ����������� ��������� ������������� ����� (������� �.�., ������ �.�.). ����: � �.�. ������ \

**������!**--����������� ������--�������� �� 15�8�6 �� --�������� �.�, 1977.10.06, �����

������

--� ���������� ������ ���� �������� � ������. � ������ ������, 1885, �. 4, ���. 169-

--�������� �. �., ������� �. �. ����� ������� ������ � �������. \\ ���. ����. , 1990, �2, �. 58-60.

������ � ���������� ������. ��������� �-���, �������. �������� ������� ~12�10 ��. ���������������� ����� ����� (�640). ����: � �.�. ������.

������. ��������� �-���, �������. \ Teghout Cu-Mo deposit, Lo?i Province, Armenia. 43 � 42 � 26 ��. ������� � ����: � �. ��������. ��������: http://www.pegmatite.ru/

.

1. ������. ������������ �-���, ������. 6,5x4x3,5 ��. ����: � �. �������. ��������: http://www.mineralogist.ru/. 2. ������. ����. �������: �� (���-3722; ����. �. �������). ~8�8 ��. ����: � �.�. ������.

������. ����. �������: �� (�13503. ������ 1923 �.). ������� ~10 ��. ���� 1-2: � �.�. ������

--���������� �.�. ������� �� ��������� ���� ������� ����������� �. �. ������� �� ��������� ���� ������� ����� �������� � ������.� ������ ������, 1888, � 4, �. 330-355

������

� �������������� ���������� ���� � ���������� ������� � �������� � �������. \\ ���. ���, 1895\96, �. 34, II, 55.

���������

������ ��������� �� ����������� ���������� ������������. ��������, �����������. �������: "������� ��������". ����: � http://www.rusmineral.ru/

������� -- ���������������. �������. ������������� ��������� �� ������ (Mount Uludag, Bursa Province, Marmara Region, Turkey�) --��. https://www.mindat.org/min-807.html

������������

- ������, ������

��������

��������. ��������������� ��������� � �����������. ����� 10 ��. �������, �����������. �������: ���. ����� ��.�.�. �������� ��� (�88402. ����.: �������� �.�., 1976). ����: � �.�. ������

**�������!**--�����--����� �� 8 �� �� ����������� ������ (1948)--�������� �.�, 1977.10.06, �����

�����������!

--Daba area, ��������--Dana, 1997 \\ ��

--Khan ez Zabid,�Amman,�Jordan --31� 39' 54'' North , 36� 20' 22'' East- https://www.mindat.org/loc-271701.html \\ Chorlton, L.B. Generalized geology of the world: bedrock domains and major faults in GIS format: a small-scale world geology map with an extended geological attribute database. doi: 10.4095/223767. Geological Survey of Canada, Open File 5529. [154

���������-(Y) \ Gagarinite-(Y) \\ Jabal Tawlah, Midyan, Tabuk Region, Saudi Arabia - Kuster, D. (2009): Ore Geology Reviews 35, 68-86.

�������� \\ Galuskin, E.V., Gfeller, F., Galuskina, I.O., Armbruster, T., Krzatala, A., Vapnik, Y., Kusz, J., Dulski, M., Gardocki, M., Gurbanov, A.G., Dzierzanowski, P. (2017): New minerals with a modular structure derived from hatrurite from the pyrometamorphic rocks. Part III. Gazeevite, BaCa6(SiO4)2(SO4)2O, from Israel and the Palestine Autonomy, South Levant, and from South Ossetia, Greater Caucasus. Mineralogical Magazine: 81: 499-513.

�����

����� (������������ �� �������� - ����������� �������������������). ������, [12 �� � �� �� �. ���������� (=��������)], �����������. �������: ����� "���������" (�������� �.�. , ������� �� 1978-79 ��.) . ����: � �. ������. \\ " ��������� ������������� ������ ������� ������������ ( CNRS , �������) ��������, ��� ������ ���� � ������� (� ������ ���� ����� �� ���������� ������������) ��������������� �� ������ �������� V ����������� �� �.�. ������ ����� ��������, ��� �������� ���������� ������� ���� �������� �������� � 3500 ���� �� �.�." \\ ��������: http://infox.ru/science/ \\ ���������... \\ � �-��� - http://elibrary.bsu.az/kitablar/980.pdf

�����. [���������� �-��� ��� ������?], ���������� (���-��), �����������. �������: �����. ����� ��. �.�. �������� ��� (�79146. ����� "������� �����"). ����: � �.�. ������.

�����. ̸����� ����, ��������. �������: ����� �����-������. ��-��, �����. ����: � �. ������.�

���������-Ca. �����, � �� �� ��������, ������. ����� 10�6 ��. �������: ���. ����� ��.�.�. �������� ��� (�90383. ���� �����. ���������� �.�., 1979). ����: � �.�. ������.

��������� \\ �������� �. �. ��������� � ��� ����� ������� � �������. \\ ��� �����, 1997, �12, 38-39.

�������

- ������������� �-���, ����������� --�-2-2, 84�)--�������� �.�., 1957, �. 223

������ � ����������� (?) ��������. ����� �. \ Hormuz Island ( Hormoz; Ormuz Island), � �� �� �.������-�����, ��������� ������, ����. �������: �. �������. ("�����-2009"). 2009.12.06. ����: � �.�. ������.

������� �� �������. ����� �., Hormoz Island, ����. �� ��������� �.�. ���������. ����: � �. ������. 2017.07.27.

����������

--����: �����-����, ����--�-3-1, 624--Bariand P., 1963

���������

--����: Zareh Shuran Mine (Zarshuran Mine; Zarshouran Mine; Zarehehuran), Takab, West Azarbaijan Province (West Azerbaijan Province), Iran; 36�43'4'' N, 47� 8' 2''E -17 ���� - www.mindat.org/gallery

������������

������������, �������. ��������, ������. �������: ����� ���������� ��-�� (�6575). 2019. 10. ����: �. ������.

����������������������* \ Hydroxyplumbopyrochlore (Pb1.5?0.5)Nb2O6(OH) \\ Jabal Sayid mine (Jabal Sayid Cu-Zn deposit), Medina Region, Saudi Arabia \\ pseudomorphoses after unknown tabular PbNb-mineral-II in complex pseudomorphoses after tetragonal PbNb-silicate-I

- Li, T., Li, Z., Fan, G., Fan, H., Zhong, J., Jahdali, N. S., Qin, M., Jehani, A. M., Wang, F., Nahdi, M. M. (2020): Hydroxyplumbopyrochlore, IMA 2018-145; in: CNMNC Newsletter 54. Eur. J. Mineral.: 32, https://doi.org/10.5194/ejm-32-275-2020; http://forum.amiminerals.it/viewtopic.php?f=5&t=16176

�������������

�������������. Soghan, ����. �������: ���������� ����� ���. �������. ����: �. ���������, 2018.

��������� \ Hypersthene (Mg,Fe)SiO3

��������� ����������. 3 - ��������, ������ (�� ����), 4 - ���-���, ������� (�� �������), 5 - ���� (�� �����). ��������: ���������� "��������"

����

���� (����. "���� �������"). Dhahran, ��������� ������, ���������� ������. �������: �������. ����� ������������ ��-��, ���. ����: � �. ���������, 2018 \\ Dhahran,�Mintaqah Ash Sharqiyah,�Saudi Arabia ; 26� 14' 10'' North , 50� 2' 21'' East \\ ���-169

����. ��������� ����� �� ����� ������. �������, ����� ̸������ ����. �������: ����������� ��������� ������������� ����� (������ �.�.). ����: � �.�. ������

��������� \\ �������� ����, ����������� (���������� �.�., ������� �.�., 1964�)

������ �������� \\ ���������� --�� ������ ������� ���. ������� \ ���������� �.�. , 1968

��������� \ Daliranite \\ �. - ����� ������� �� �-��� ��������, ���� - W. H. Paar, A. Pring, Y. Moelo, C. J. Stanley, H. Putz, D. Topa, A. C. Roberts, R. S. W. Braithwaite (2009): Daliranite, PbHgAs2S6, a new sulphosalt from the Zarshouran Au-As deposit, Takab region, Iran. Mineralogical Magazine, 73, 871-881.;�http://www.mindat.org/mesg-14-151189.html

�������!

- ������ \\

_- ������������ �����_--�������� �. �. ������� �� ������������ ����� � ������������ �������. - ��� ����, 1939, �. 24, 2, �. 161-164.

- ��������� �. �. ������������� �������� �� �. ��� � ������ ���������� ����������� ���. \\ ���. ��. ����.-������. ���. , 1931, �. 50, ���. 60, �. 939-942

- ������, ���-��� (Hg) , ��������������� ������, �� ������[xls<3 ��] � ��������� ���������� � ��������� (�������� �. �. � ��. , 1966);

- ����� �., ���� ����������, ���. ������, ������ \\ ���������� �.�.�������� � ���� ����� ���� ���������� // ��������� �� ����. � �������.� ������. 1911. �. 13. � 5/6. �. 166-174 : ��.

--�������� �.�. � ��. � ����� �������-���������� ����������� ����������. - ��� ����, 1966, �.168, �.3, 658-660 \\ ����� ���� �������� ���������� �������� �������. ���������� ���������� � ���������������� ������� (���, ����, �������, ������, ������, ����-����������� ������)

���������

��������� (����� ������� ��������). Soghan, Baft District, Kerman Province, Iran. 3�3�3 ��. ����: ���. ��������. ��������:�http://www.pegmatite.ru/ \\ ���-161

1. �.�. ���������: " 2003 �. �������� "�������� ���" \ Main Show (����� - 2003) - ���������� �������� ���������� �� �����". ���� ����������� �.�. ���������. 2. "�������� �������� ���������� �������� ����� 6,5 ��. Soghan, Kerman Prov., Iran " (�. ��������). �������: �����-���-2010. ��������: http://www.rusmineral.ru/info/news.php

�������������* \ Dzierzanowskite (TL) CaCu2S2 \\ ���� �����, �������� ����., �����. ����� , ��������� \ Nabi Musa, Jericho Governorate, West Bank, Palestine \\ https://www.mindat.org/loc-105748.html� \ 31� 46' 59'' North , 35� 25' 59'' East

������� \ Diaspore
- ������--68 ���� (2019.12), �� ��� 52 ���� - �������, ����. ����� \ Selcuk, Izmir Province, Aegean Region, Turkey

- ����� ����.\ Mugla Province, Turkey \\ �������!!--����

�������. ������. ���������� �� �������� ���� ����������. ����� 15 ��. �������: ���. ����� "����� � ����"(�����). ����: � �. ������

�������. ������ \ Millet. ������. ����� 15 ��. �������: ���� (�12535). ����: � �. ������.

�������. ������. �������: �����. ����� �����-�������������� ��-��. 2017.10.11. ����: �. ������.

�������

������� (��������� �� 1,5 ��). ����� �., ����. �������: �����. ����� ����� (�-517. ������ �.�., 2009). ����: � �.�. ������.

������� (��������� �� 2 ��). ����� �., ����. �������: �����. ����� ��. �.�. �������� ���. (�92859. ����������� �.�., 2009). ����: � �.�. ������. \\ ���-127

��������* \ Dymkovite Ni(UO2)2(As3+O3)2�7H2O \\ Pekov, I.V., Levitskiy, V. V., Krivovichev, S. V., Zolotarev, A. A., Chukanov, N.V., Bryzgalov, I. A., Zadov, A. E. (2012): New nickel-uranium-arsenic mineral species from the oxidation zone of the Belorechenskoye deposit, Northern Caucasus, Russia: II. Dymkovite, Ni(UO2)2(As3+O3)2�7H2O, a seelite-related arsenite. European Journal of Mineralogy 24, 923-930.

����������� \\ �������� � �. ���������� �����������. \\ ����. �� ������, 1962, �. 34, �1, �. 31-35.

������ -- ���. ������--1-� �������--�������� �.�. � ��., 1978� \\ ��

������� (zadovite, IMA2013-031), BaCa6[(SiO4)(PO4)](PO4)2F, ������� �����, �������.

�.�. ����� � ����� ������� �������, �������� � ������� �������� ��������. ���� ������� ����������� �.�. ��������

����������� \ Zuktamrurite, FeP2 - ����� ������� Britvin, S.N., Murasko, M.N., Vapnik, Y., Polekhovsky, Y.S., Krivovichev, S.V., Vereshchagin, O.S., Vlasenko, N.S., Shilovskikh, V.V., Zaitsev, A.N. (2019) Zuktamrurite, FeP2, a new mineral, the phosphide analogue of lollingite, FeAs2. Physics and Chemistry of Minerals: 46: 361�369. \\ ������� ������ �� ���� ���������, �������������� ����������� �������� ����, ���� ����� ��� ������ ������� \ Named for Zuk-Tamrur cliff (Dead Sea) located nearby the type locality \ �Halamish wadi (?uq Tamrur), Hatrurim Basin, Tamar Regional Council, Southern District (HaDarom District), Israel - �������������� ��������������� \ Type Locality

������\\ Zunyite Al13Si5O20(OH,F)18Cl

- �����������:

--- �������� �., ���� �. ������, ����������� \\ ������ �.�. � ��., 1967. �. 135 \\ �-3-1, 267

--- Goshian deposit, G?d?b?y District (Gadabey), Azerbaijan \\ Mansurov, M. I., Galandarov, B. H., Safari, M. H., Tahmazova, T. H., & Huseynov, A. I. (2018) Geological-genetic peculiarities of Goshian gold-sulfide deposit formation (Azerbaijan area of the Lesser Caucasus). International Journal of Engineering Research and General Science Volume 6, Issue 5 pp 69-80

-- ���� \ Qalat Payeen,�Bandar Abbas County,�Hormozgan Province,�Iran; 27� 17' 49'' North , 56� 3' 55'' East \\ ������!! --���� - 84 ���� !! (�� 204 ��� ������� ����� ����) \ ����������� ��������� �� 28 �� �� ����� !!! \\

--Vachik Hairapetian, Herwig Pelckmans & Hossein Basirat�(2020)�Zunyite Crystals in Salt Diapirs from Southern Iran,�Rocks & Minerals,�95:2,�118-127,�DOI:�10.1080/00357529.2020.1689333

������ (�������� ��. 1,5 ��), �������. ��������� ����., ����. ��������: �. �������. "�����" 2019.12.15. ����: � �.������.

������� \ Ye'elimite - https://www.mindat.org/min-4356.html \\ Har Ye'elim*, Dead Sea, Southern District (HaDarom District), Israel; 31� 14' 48'' North , 35� 16' 59'' East; Hill to the west of the Dead Sea, with outcrop of Hatrurim Formation (qv). - https://www.mindat.org/loc-32377.html \\ Gross S (1984) Occurrence of ye'elimite and ellestadite in an unusual cobble from the "pseudo-conglomerate" of the Hatrurim basin, Israel. Geological Survey of Israel Current Research, 1-4

��������� \ Indigirite Mg2Al2(CO3)4(OH)2 � 15H2O

- ����: Two shoes, Al Batinah North Governorate, Oman \\ Chavagnac, V., Ceuleneer, G., Monnin, C., Lansac, B., Hoareau, G., & Boulart, C. (2013). Mineralogical assemblages forming at hyperalkaline warm springs hosted on ultramafic rocks: a case study of Oman and Ligurian ophiolites. Geochemistry, Geophysics, Geosystems, 14(7), 2474-2495.

�����

--��������� ���. ����, ���. �������--�� ����. ��������� ��������� �. �.�. -- ������� �.�., 1965� \\ ��

������*(1963) - �������, �������� � �����

������. ���-����� \ Chah Khuni , ����. �������: �� (�79159, ������ �.). ����: � �.�. ������.

���������� ���� \\

--�����-���� ���� � ��-� �-��� ������. ����� (�� ������� ����), �� ����.���. �. �����, � ���.-����. ������� �. ����������, ������������ �-� [�����. �������] \\ ������� \ ���������

--������� �. �. � ��. ������������ �������������� ���������� ����������� ����� �� ����� ��������� ��������. \\ ���. �� �����, ���. ����.-������. , 1960, �5.

�������� \ Ilyukhinite (H3O,Na)14Ca6Mn2Zr3Si26O72(OH)2 � 3H2O

- ������: Kizilcaoren REE deposits (Kyzylkaoren) , ��������� ����., �������� (��) --���� - https://webmineral.ru/minerals/item.php?id=214160 \\ Nikiforov, A. V., Ozturk, H., Altuncu, S., & Lebedev, V. A. (2014). Kizilcaoren ore-bearing complex with carbonatites (northwestern Anatolia, Turkey): Formation time and mineralogy of rocks. Geology of Ore Deposits, 56(1), 35-60.

������-(La) \ \ Iraqite-(La) - ����� ������� �� ����� \ ������ ������� \\ Shakhi-Rash Mountain, Hero, Qaladiza, Pshdar District, Sulaymaniyah Governorate, Iraq

- Livingstone, A., Atkin, D., Hutchison, D., Al-Hermezi, H.M. (1976) Iraqite, a new rare-earth mineral of the ekanite group. Mineralogical Magazine: 40: 441-445. \\

������* \ Iranite \ Pb10Cu(CrO4)6(SiO4)2(OH)2 \\ �Sebarz Mine (Sebraz Mine; Sebarg Mine), Anarak District, Nain County, Isfahan Province, Iran - �������������� ��������������� \ Type Locality

�������� \\ �������������� ���-��� (Hg), ��������� �-�, ����������� \\ ��������--������� �.�. � ��, 1976� \\ ��!

������������* \ Calcurmolite (Ca,Na)2(UO2)3Mo2(O,OH)11�� nH2O

- �������: ���-������ ��-�, �������� �-� � �-���, ��������� �-�, ������� \�Sokh-Karasu area, Kajaran Mine (Kadzharan Mine; Kadzharan molybdenum deposit), Kajaran, Upper Okhca River, Kafan District (Kapan), Syunik Province, Armenia (Pekov , 1998, 52-53) - �������������� ��������������� \ Type Locality

������� \\ ����� �. �. ������������ ��������� ���������� �������� �� ���������. - ������� ����������� ��������� � ���������. �. , 1966, �. 181-200.

�������, ���������� �� 4 �� �������. ��������� �� ��������.. ������� � ����: � ������ �.�.

������� (������� ��������������������� ���������). �������� �������� ���������, ���. ������, ������. ������� ��������� ~5-8 ��. �������: �� (�35370, �������, 1934). ����: � �.�. ������.

������� (���������). ����������� ����������� ��������, ����������, �����������. �������: �� (� 25598, ���������� �.�., ������������ �.�., 1927). ����: � �.�. ������.

��������* \ Qandilite (Mg,Fe3+)2(Ti,Fe3+,Al)O4 \\ Dupezeh Mountain, Hero, Qala-Diz, Sulaymaniyah Governorate, Iraq \\ Al-Hermezi, H.M. (1985) Qandilite, a new spinel end-member, Mg2TiO4, from the Qala-Dizeh region, NE Iraq. Mineralogical Magazine: 49: 739-744.

���������� \ Cannizzarite Pb48Bi56S132

- ����������� �.�. � ��. ������� ����������� � ������������� �������� // ���. ���, 1989, 118 , ���. 6, ���. 84-88. \\ ���. ������, ������

����������

- �������� �.�. ������������������������� ��������������������������. ������� // ��. �������. ����� �� ����.�� 1971.�� ���. 20.�� �. 14-24.

���������* \ �Qatranaite CaZn2(OH)6(H2O)2

--������������� ���������������, ������, ����� ������, �����, �������� \ �Qatranaite locality, Siwaga, Lisdan-Siwaga Fault, Hashem region, Amman Governorate, Jordan \\

����� \\ �������� �. �. ������������������ ��������������� ����� �� ������������� ����� ���������� ���������� �-��. \\ ���. �����. ���. ���, 1959, �. 1, �. 127-129.

1. �����. ������ �., ������. �������: �� (� � 1900. ��������, 1937). 2 ����� (������������������� ����-�����). ��������������� ���������. �����, ������������ ��., �������. �������: �� (�50830. ���� ���������, 1950). ���� 1-2: � �.�. ������.

������������ �. �. ����� ������� �� ������� ������������ ������ �� ����������. \\ ��������� �� ����. � ���. ������, 1914, �. XVI, ���. 5-6.

������������ �. �. ������������� ������ � ���������� � ������������ ����������. \\ ����. ����������� ��-��, 1922, �2.

����� (������). ������, ���. ��������� �., ������. ~30 ��. �������: �� (�28591. �� ��������� ������. ����������. ����������� 1925 �.). ����: � �.�. ������.

����� (�������� �������!). ��������, �����������. ����: �. �������

�����, ����� 12 ��, ����������� �����������. ��������, �����������. ������� � ����: � ������ �.�., 2005

����� (�����) � �������. ������ �., �����. �������: �����. ����� ����-�����. ����: � �.�. ������ \\ 33_15

����� (�����). �����. �������: �����. 2013.10. ����: � �. ������. \\ ���-111

����������

��������� �������������� (����. ����������)--��. ���� "�������. ���������". Guleman mines, Elazig Prov., ����. ��������, ������. 21�18 ��. ����: ����� ������� \ Carlos Menezes. ���������: Fernando Brederodes. This image has been released to the public domain and may be used freely.����� ����������� ���� �������� � ������������ ��������� � ����� �������� ��������������.� ��������: www.mindat.org \

����������. �������� �� �������. Kop Krom mine, Kop Daglari, Erzurum Province, Eastern Anatolia Region, Turkey. ������� � ����: � �. ��������. ��������: http://www.pegmatite.ru/

��������

�������� ��������. 1. ���������, �������. 2. ����. ����, ������. 3. �������� �-���, ������. �������. ��������: ���������� "��������" \\ ���-198

��������. ������� 2 ��. ������� (Hg) �������������, �������� ������, �������� ������, ������. ����: � �.�. ������. ��������: webmineral.ru

--����� �. �. ����������� ���� ���������� �������� � ������� ����������� ������-��������� �������. \\ ����������� ��������� � ��� ������������ ��������. �. , 1972.

----�������� �.�. � ��. � ����� �������-���������� ����������� ����������. - ��� ����, 1966, �.168, �.3, 658-660 \\ ����� ���� �������� ���������� �������� �������. ���������� ���������� � ���������������� ������� (���, ����, �������, ������, ������, ����-����������� ������)

���������

��������� � �������������� ������. ��������, �����������. �������: ���. ����� ��. �.�. �������� ��� (�65774. ����������� 1963 �.). ����: � �.�. ������.

--������ �. �. , ��������� �. �. � ��. ���������� ���������� ���������� �� ������������ �������������. \\ ��. ���. �����. ��-��, 1958, �1, �. 47-55.

��������� \ Colemanite

-���� \ Gharah Gol Boron Mine, Dandi, Mahneshan County, Zanjan Province, Iran --����

- ������ \ Emet Eti Bor Mine, Emet Borate deposit, Emet District, Kutahya Province, Turkey

���������. Gulemin, ������. �������: �� (�87913. �����, 1993). ����: � �. ������.

����������

���������� �.�., �������� �.�., ��������� �.�., �������� �.�., ������� �.�., ���������� �.�. ������������ ���������� � �������� ������ ������������� ������������� ����� ������� � ������-��������� ����� \\ ������� �������� ����, "������������ "�����" (������), ���393, ��2, �.�252-255 \\ https://istina.ipmnet.ru/publications/article/1912098/

��������

--������������ (������������ ) �-���, ���. �����. ������������ �������, 11 �� � �� �� ���������, �� ������ ��� ������� � ��������, ����� ���. ��������� � ���������, ������ \\ �������� - � ��������� �����, ��������� � ����������� (1959�) \\ ��

������� \ Konyaite Na2Mg(SO4)2 � 5H2O -����� ������� \\ ������ �� ����. �����, ��� �� ��� ������After the locality near Cakmak, Great Konya Basin, Konya Province, Central Anatolia Region, Turkey.

��������

- ���������� ( ������-����� - �� 1943 �..\ ������� �� 1957), ���. ������, ������ \\ https://ru.wikipedia.org/wiki ) \\ �������� �.�., 1940

������

- ���������, �-���(Cu-Mo), ������������ ��. , ����������

�������� \\ ������� �. �. � ��. � ��������� ����������� �-��� �����. \\ ���. �� �����. - ���. ���� � �����, 1974, �2.

������ \ Coesite

- ����� ������. ������, ����. ����. \\ ������ --�-2-3, 237

������������ \ Crocobelonite \ CaFe3+2O(PO4)2 , ����. ����. - ����� ������� \ �Unnamed phosphorite quarry, Daba-Siwaqa complex, Transjordan Plateau, Amman Governorate, Jordan - �������������� ��������������� \ Type Locality

--Britvin, S.N., Murashko, M.N., Krzhizhanovskaya, M.G., Vlasenko, N.S., Vereshchagin, O.S., Vapnik, Y. and Pankin, D.V. (2020) Crocobelonite, IMA 2020-005. CNMNC Newsletter No. 55; Mineralogical Magazine, 84, https://doi.org/10.1180/mgm.2020.39 \\ **���. ����� ��. �.�.��������- �97118. �������� ������������. ������� �.�. 2020 �. ����� ������������� �������� ����� 0.1 ��. �������. Transjordan Plateau, �������� \ Jordan 31��21' 52'' N, 36��10' 55'' E).

���������

--���������� �. �., ��������� �.� . ���������� � ��������� ���������� � ������ �������������.� ���. ����. ��� . ��-��, 1958, � . 87, ���.1

--����-���� �. �. � ���������� ���������� � ��������� �-�� (���.������). \\ ��.���. �����.���. ��-��. ���. ����.-�����. , 1975, �3, �. 8-12.

���������. ��������� �-�, �. ������, ������. �������: �� ([�15108. �������� �.�.] 1929). ����: � �.�. ������. \\ ������ ������� ���������� � ���. ���� (�������� �.�., 1937) || ���-157

-- �. �. ���������. ��������� �� ��������������� ������ ��������������� ��� ��������� � ������� ������������ ������ � ������ ������ ����� ������� ��� ����� ������������ ������������ �������. �� ���������� ������� � ��������� ����� ���� �������� ������ �����, � ������� ���� ����� ���������, � ��� ����� ��� ����� �� �������� �������. � 1962 �. ��� ������� ��������� �� ��������������� ������ (���- ����� ��������������� ���), ����������� � ���������������� ����� �. �. ����������, ��� ��������� ����������� �������, ��� ��������� ��� �������� ����������������� ��� ���������. \\ �������� � ������ ������: https://www.fmm.ru/images/1/1c/TMM_1964_15_Annenkova.pdf

����������. ����� �., ��. �. �. ������, ��������� �-�, ������. �������: �����. ����� ��. �.�. �������� ��� (�20991. ������������ �.�.). ����: � �.�. ������. \\ ���-129

����������

����������. ��������, ����. �������: �� (�67861. Bureau de Recherches Geologiques et Minieres, 1965). ~10 ��. ����: � �.�. ������.

����������. ����-������� ������� ���������� ����������� �� ����������� ������. �������� \ Talmessi, ����. 9,5�6 ��. �������: ��. . (��������� �.�. ��������� ST 7138. �����: Guillemin C., 1980. ����� ������ ������ �����, �����) ����: � �.�. ������ \\ ���-144

��������� \ Lakargiite Ca(Zr,Sn,Ti)O3

33_6 \ 33_15 - �������, ���. ������, ������ \\ ��������������� ���������, �92595.���. ������������ ����� ��������� ��������-�������� ����� � �������-����������� ������ � ��������������. � ������ ������� ������ ������ ����� ���������.������ ��������� 6.0 ��.������ �������� 0.10 ��. ������� �. , ��������������� �������, ���������-��������, �������� ������, ������. ��������-��������:��������,�������������,��������. �������� � ����� � 2007 ����.� ���������� �� �������exp34��exp75-1�� \\ ���� - https://fmm.ru/FMM_1_92595

-- ��������� �� ����������� ����������� ��������. �������� 1 , �������, ��������������� ������������� ���������, ���. ������, ������. ����: � �.�. ��������. \\ ��--���-114

�������� \ Loughlinite Na2Mg3Si6O16�� 8H2O

- ������: Killik,�Mihaliccik District,�Eskisehir Province,�Turkey ; 39� 54' 51'' North , 31� 29' 43'' East

������ \\

- �������, �. �.�(1978)�� ������� ���������� ��������� � ��������� ���_._�������� ���������� ��������� ����������� ����������������� ��������, 1978, � 9, 40-43.

- ������ �. �. �������� ���������� ����� � ����������.// ��������� ��������, 1939, � 4-5, ��� IX.
- ������ �. �. ���������� ������ ����������. - ���. �� ����, ���. ����. , 1947, � 2. \\ ���������� ��������--�������--������� �.�., 1978

������ (������������� �� �������). ���������� ��., �������. �������: ���. ����� ��.�.�. �������� ���. ���� 1-2: � �.�. ������.

�������� \\ ����� �. �. � ��������� �� ���������. \\ ��. �������. ����� �� ����. 1955, ���. 7, �. 127-131

�������� \ Laumontite

- ���� : Darhand Cu occurrence, Natanz, Natanz County, Isfahan Province, Iran

15 - ���� (��) **- �-� - �-� - ��������������� ��������� � ����������

���. ������� (�) ���������� ��������� - ����������� - �������� �-� ���� ��. ������ ������ �� ������
���. ������� (� - ���. ������� (����������) ���. ������� (�) ������. �-��, ����������� �-� - ���. ������ - ����. ������ ���������, ��. ���� �� ������ ����������, ���� . ������ �������� - ������� ������ (������, ������
������� ������, �� ���� ����������, �������� ����� ��������. ����� �� ���� - ����� �����
�. ������� (��) - ���������� �������� ������ - ���. � ���.���. � �������. ���������� ��������� ����� ����� - ���� ���