| dbo:abstract |
Mefway is a serotonin 5-HT1A receptor antagonist used in medical research, usually in the form of mefway (18F) as a positron emission tomography (PET) radiotracer. (en) Мефвэй — это антагонист серотониновых рецепторов подтипа 5-HT1A, используемый в медицинских исследованиях, обычно в форме меченого радиоактивным фтором 18F радиолиганда для ПЭТ. (ru) |
| dbo:casNumber |
943962-60-5 |
| dbo:fdaUniiCode |
0NM517978A |
| dbo:pubchem |
11963740 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/Mefway_18F_skeletal.svg?width=300 |
| dbo:wikiPageID |
32648867 (xsd:integer) |
| dbo:wikiPageLength |
9030 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1120553909 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbr:Animal_models_of_Parkinson's_disease dbc:PET_radiotracers dbc:Phenol_ethers dbc:Phenylpiperazines dbr:Receptor_antagonist dbc:Radiopharmaceuticals dbc:Carboxamides dbr:Fluorine-18 dbc:2-Pyridyl_compounds dbr:Isomers dbr:Positron_emission_tomography dbr:Cis–trans_isomerism dbr:WAY-100,635 dbr:Radiotracer dbr:Raphe_nucleus dbr:5-HT1A dbr:File:Mefway_cis-trans_comparison.svg |
| dbp:atcPrefix |
none (en) |
| dbp:c |
26 (xsd:integer) |
| dbp:casNumber |
943962 (xsd:integer) |
| dbp:chemspiderid |
10137857 (xsd:integer) |
| dbp:drugName |
Mefway (en) |
| dbp:f |
1 (xsd:integer) |
| dbp:h |
35 (xsd:integer) |
| dbp:iupacName |
4 (xsd:integer) |
| dbp:legalStatus |
Research compound (en) |
| dbp:n |
4 (xsd:integer) |
| dbp:o |
2 (xsd:integer) |
| dbp:pregnancyCategory |
N/A (en) |
| dbp:pubchem |
11963740 (xsd:integer) |
| dbp:smiles |
COC1=CC=CC=C1N2CCNCCNCC4CCCC[18F] (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
BQGLPDFQLBNUGU-FMLNDMEQSA-N (en) |
| dbp:unii |
0 (xsd:integer) |
| dbp:wikiPageUsesTemplate |
dbt:Drugbox dbt:Piperazines dbt:Reflist dbt:Serotonergics dbt:Short_description dbt:Fdacite |
| dcterms:subject |
dbc:PET_radiotracers dbc:Phenol_ethers dbc:Phenylpiperazines dbc:Radiopharmaceuticals dbc:Carboxamides dbc:2-Pyridyl_compounds |
| gold:hypernym |
dbr:HT |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 yago:WikicatAmides yago:Abstraction100002137 yago:Amide114724264 yago:Base114618253 yago:Chemical114806838 yago:Compound114818238 yago:Element114840755 yago:Material114580897 yago:Matter100020827 yago:OrganicCompound114727670 yago:Part113809207 yago:PhysicalEntity100001930 yago:Pyridine114692510 yago:Quintessence114847103 yago:Relation100031921 dbo:Drug yago:Substance100019613 yago:WikicatPhenolEthers yago:WikicatPyridines |
| rdfs:comment |
Mefway is a serotonin 5-HT1A receptor antagonist used in medical research, usually in the form of mefway (18F) as a positron emission tomography (PET) radiotracer. (en) Мефвэй — это антагонист серотониновых рецепторов подтипа 5-HT1A, используемый в медицинских исследованиях, обычно в форме меченого радиоактивным фтором 18F радиолиганда для ПЭТ. (ru) |
| rdfs:label |
Mefway (18F) (en) Мефвэй (ru) |
| owl:sameAs |
freebase:Mefway (18F) yago-res:Mefway (18F) wikidata:Mefway (18F) dbpedia-ru:Mefway (18F) dbpedia-sh:Mefway (18F) dbpedia-sr:Mefway (18F) https://global.dbpedia.org/id/4rX7m |
| prov:wasDerivedFrom |
wikipedia-en:Mefway_(18F)?oldid=1120553909&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/Mefway_18F_skeletal.svg wiki-commons:Special:FilePath/Mefway_cis-trans_comparison.svg |
| foaf:isPrimaryTopicOf |
wikipedia-en:Mefway_(18F) |
| foaf:name |
Mefway (18F) (en) |
| is dbo:wikiPageRedirects of |
dbr:Mefway |
| is dbo:wikiPageWikiLink of |
dbr:Mefway |
| is foaf:primaryTopic of |
wikipedia-en:Mefway_(18F) |
