| dbo:abstract |
Florbetaben, a fluorine-18 (18F)-labeled stilbene derivative (formerly known as BAY-949172), trade name NeuraCeq, is a diagnostic radiotracer developed for routine clinical application to visualize β-amyloid plaques in the brain. It is indicated for Positron Emission Tomography (PET) imaging of β-amyloid neuritic plaque density in the brains of adult patients with cognitive impairment who are being evaluated for Alzheimer's disease (AD) and other causes of cognitive impairment. β-amyloid is a key neuropathological hallmark of AD, so markers of β-amyloid plaque accumulation in the brain are useful in distinguishing AD from other causes of dementia. The tracer successfully completed a global multicenter phase 0–III development program and obtained approval in Europe, US and South Korea in 2014. (en) Флорбетабен (18F) — радиофармацевтический препарат для диагностики болезни Альцгеймера. Одобрен для применения: США (2014). (ru) |
| dbo:alternativeName |
Neuraceq (en) |
| dbo:casNumber |
902143-01-5 |
| dbo:chEBI |
79033 |
| dbo:fdaUniiCode |
TLA7312TOI |
| dbo:pubchem |
11501341 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/Florbetaben_F18.svg?width=300 |
| dbo:wikiPageExternalLink |
http://neuraceq.com/ http://www.piramal.com/imaging/ https://link.springer.com/article/10.1007%2Fs40263-015-0258-7 https://link.springer.com/article/10.1007%2Fs40336-015-0102-6 |
| dbo:wikiPageID |
42295022 (xsd:integer) |
| dbo:wikiPageLength |
16505 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1084077686 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbc:Fluoroethyl_ethers dbc:Stilbenoids dbc:Radiopharmaceuticals dbc:Orphan_drugs dbr:Alzheimer's_disease dbr:Flutemetamol dbc:Anilines dbc:Alzheimer's_disease dbr:Pittsburgh_compound_B dbr:Positron_Emission_Tomography dbr:Intravenous dbr:Stilbene dbr:Cognitive_impairment dbr:Florbetapir dbr:Radiotracer dbr:Β-amyloid |
| dbp:atcPrefix |
V09 (en) |
| dbp:atcSuffix |
AX06 (en) |
| dbp:c |
21 (xsd:integer) |
| dbp:casNumber |
902143 (xsd:integer) |
| dbp:chebi |
79033 (xsd:integer) |
| dbp:chemspiderid |
9676143 (xsd:integer) |
| dbp:dailymedid |
Florbetaben (en) |
| dbp:drugName |
Florbetaben (en) |
| dbp:f |
1 (xsd:integer) |
| dbp:h |
26 (xsd:integer) |
| dbp:iupacName |
4 (xsd:integer) |
| dbp:legalUs |
Rx-only (en) |
| dbp:licenceEu |
yes (en) |
| dbp:licenceUs |
Florbetaben (en) |
| dbp:n |
1 (xsd:integer) |
| dbp:o |
3 (xsd:integer) |
| dbp:pregnancyUs |
C (en) |
| dbp:pubchem |
11501341 (xsd:integer) |
| dbp:routesOfAdministration |
dbr:Intravenous |
| dbp:smiles |
CNC1=CC=C/C=C/C2=CC=COCCOCCOCC[18F] (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
NCWZOASIUQVOFA-FWZJPQCDSA-N (en) |
| dbp:synonyms |
BAY-949172 (en) |
| dbp:tradename |
Neuraceq (en) |
| dbp:unii |
TLA7312TOI (en) |
| dbp:wikiPageUsesTemplate |
dbt:COI dbt:Infobox_drug dbt:Reflist dbt:Short_description dbt:Fdacite dbt:Drugs.com |
| dct:subject |
dbc:Fluoroethyl_ethers dbc:Stilbenoids dbc:Radiopharmaceuticals dbc:Orphan_drugs dbc:Anilines dbc:Alzheimer's_disease |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 yago:WikicatMolecularFormulas yago:Abstraction100002137 yago:Agent114778436 yago:CausalAgent100007347 yago:Communication100033020 yago:Drug103247620 yago:Formula106816935 yago:Matter100020827 yago:Medicine103740161 yago:Message106598915 yago:MolecularFormula106817173 yago:Pharmaceutical103920989 yago:PhysicalEntity100001930 yago:Radiopharmaceutical104043268 dbo:Drug yago:Statement106722453 yago:Substance100020090 yago:WikicatRadiopharmaceuticals |
| rdfs:comment |
Флорбетабен (18F) — радиофармацевтический препарат для диагностики болезни Альцгеймера. Одобрен для применения: США (2014). (ru) Florbetaben, a fluorine-18 (18F)-labeled stilbene derivative (formerly known as BAY-949172), trade name NeuraCeq, is a diagnostic radiotracer developed for routine clinical application to visualize β-amyloid plaques in the brain. It is indicated for Positron Emission Tomography (PET) imaging of β-amyloid neuritic plaque density in the brains of adult patients with cognitive impairment who are being evaluated for Alzheimer's disease (AD) and other causes of cognitive impairment. β-amyloid is a key neuropathological hallmark of AD, so markers of β-amyloid plaque accumulation in the brain are useful in distinguishing AD from other causes of dementia. The tracer successfully completed a global multicenter phase 0–III development program and obtained approval in Europe, US and South Korea in 20 (en) |
| rdfs:label |
Florbetaben (18F) (en) Флорбетабен (ru) |
| owl:sameAs |
freebase:Florbetaben (18F) yago-res:Florbetaben (18F) wikidata:Florbetaben (18F) dbpedia-ru:Florbetaben (18F) https://global.dbpedia.org/id/feMU |
| prov:wasDerivedFrom |
wikipedia-en:Florbetaben_(18F)?oldid=1084077686&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/Florbetaben_F18.svg |
| foaf:isPrimaryTopicOf |
wikipedia-en:Florbetaben_(18F) |
| foaf:name |
Florbetaben (18F) (en) |
| is dbo:wikiPageRedirects of |
dbr:C21H26FNO3 dbr:Florbetaben_F18 dbr:Neuraceq dbr:Florbetaben dbr:Florbetaben_(18_F) |
| is dbo:wikiPageWikiLink of |
dbr:Brain_positron_emission_tomography dbr:C21H26FNO3 dbr:Florbetaben_F18 dbr:ATC_code_V09 dbr:Positron_emission_tomography dbr:List_of_drugs:_Fl dbr:Neuraceq dbr:Florbetaben dbr:Florbetaben_(18_F) |
| is foaf:primaryTopic of |
wikipedia-en:Florbetaben_(18F) |
