| dbo:abstract |
SB-649868 is a dual orexin receptor antagonist that was being developed by GlaxoSmithKline as a treatment for insomnia. A phase I clinical trial evaluated doses up to 80 mg, resulting in significant improvement in sleep latency without adverse effects. In randomized, double-blind, placebo-controlled crossover trials, the 10 and 30 mg doses increased sleep time and reduced sleep latency. The subsequent phase II study added a 60 mg dose and observed dose-dependent sleep promotion. The compound no longer appears to be under active development, with the last study posted to ClinicalTrials.gov completed in 2010. (en) |
| dbo:casNumber |
380899-24-1 |
| dbo:chEMBL |
1272307 |
| dbo:fdaUniiCode |
1L1V1K2M4V |
| dbo:pubchem |
25195495 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/SB-649,868.svg?width=300 |
| dbo:wikiPageExternalLink |
http://www.mudin.net/more-gsk-neurosciences-seminar-13-dec-2007-emiliangelo-ratti--253710.html https://web.archive.org/web/20081205182150/http:/www.gsk.com/investors/presentations/2007/neurosciences-seminar-dec07/emiliangelo-ratti.pdf |
| dbo:wikiPageID |
3986292 (xsd:integer) |
| dbo:wikiPageLength |
4588 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1084242207 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbc:Fluoroarenes dbc:Hypnotics dbc:Sedatives dbr:GlaxoSmithKline dbr:ClinicalTrials.gov dbr:Clinical_trial dbr:Receptor_antagonist dbr:Almorexant dbr:Filorexant dbr:Lemborexant dbr:Orexin_receptor dbc:Orexin_antagonists dbr:Suvorexant dbc:Benzofurans dbr:Insomnia dbr:Phases_of_clinical_research |
| dbp:atcPrefix |
None (en) |
| dbp:c |
26 (xsd:integer) |
| dbp:casNumber |
380899 (xsd:integer) |
| dbp:chembl |
1272307 (xsd:integer) |
| dbp:chemspiderid |
25069706 (xsd:integer) |
| dbp:f |
1 (xsd:integer) |
| dbp:h |
24 (xsd:integer) |
| dbp:iupacName |
N--4-benzofurancarboxamide (en) |
| dbp:legalStatus |
Investigational (en) |
| dbp:n |
3 (xsd:integer) |
| dbp:o |
3 (xsd:integer) |
| dbp:pubchem |
25195495 (xsd:integer) |
| dbp:s |
1 (xsd:integer) |
| dbp:smiles |
CC1=NCCN3CCCC[C@H]3CNCC4=C5C=COC5=CC=C4 (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
ZJXIUGNEAIHSBI-IBGZPJMESA-N (en) |
| dbp:unii |
1 (xsd:integer) |
| dbp:wikiPageUsesTemplate |
dbt:Cite_journal dbt:Cite_web dbt:Drugbox dbt:Refbegin dbt:Refend dbt:Reflist dbt:Short_description dbt:Cascite dbt:Fdacite dbt:Sedative-stub dbt:Orexin_receptor_modulators |
| dct:subject |
dbc:Fluoroarenes dbc:Hypnotics dbc:Sedatives dbc:Orexin_antagonists dbc:Benzofurans |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 dbo:Drug |
| rdfs:comment |
SB-649868 is a dual orexin receptor antagonist that was being developed by GlaxoSmithKline as a treatment for insomnia. A phase I clinical trial evaluated doses up to 80 mg, resulting in significant improvement in sleep latency without adverse effects. In randomized, double-blind, placebo-controlled crossover trials, the 10 and 30 mg doses increased sleep time and reduced sleep latency. The subsequent phase II study added a 60 mg dose and observed dose-dependent sleep promotion. (en) |
| rdfs:label |
SB-649868 (en) |
| owl:sameAs |
yago-res:SB-649868 wikidata:SB-649868 dbpedia-sh:SB-649868 dbpedia-sr:SB-649868 dbpedia-vi:SB-649868 https://global.dbpedia.org/id/4uZNo |
| prov:wasDerivedFrom |
wikipedia-en:SB-649868?oldid=1084242207&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/SB-649,868.svg |
| foaf:isPrimaryTopicOf |
wikipedia-en:SB-649868 |
| is dbo:wikiPageRedirects of |
dbr:C26H24FN3O3S dbr:SB-649,868 dbr:SB649868 dbr:GSK-649,868 dbr:GSK-649868 dbr:GSK649868 dbr:GSK_649,868 dbr:GW649868 |
| is dbo:wikiPageWikiLink of |
dbr:C26H24FN3O3S dbr:List_of_signaling_peptide/protein_receptor_modulators dbr:SB-649,868 dbr:SB649868 dbr:GSK-649,868 dbr:GSK-649868 dbr:GSK649868 dbr:GSK_649,868 dbr:GW649868 |
| is foaf:primaryTopic of |
wikipedia-en:SB-649868 |
