| dbo:abstract |
Tametraline (CP-24,441) is the parent of a series of chemical compounds investigated at Pfizer that eventually led to the development of sertraline (CP-51,974-1). Sertraline has been called "3,4-dichloro-tametraline". This is correct but it is an oversimplification in the sense that sertraline is the S,S-isomer whereas tametraline is the 1R,4S-stereoisomer. 1R-Methylamino-4S-phenyl-tetralin is a potent inhibitor of norepinephrine uptake in rat brain synaptosomes, reverses reserpine induced hypothermia in mice, and blocks uptake of 3H-Norepinephrine into rat heart. Tametraline is a norepinephrine-dopamine reuptake inhibitor. Indatraline is an indanamine homolog of tetralin-based tametraline, although in the case of indatraline the product is pm-dichlorinated. (en) Tametralina (CP-24,441) é um composto químico precursor de uma série de compostos investigados pela Pfizer que, eventualmente, conduziram ao desenvolvimento de sertralina (CP-51,974-1). (pt) |
| dbo:casNumber |
52760-47-1 52795-02-5 |
| dbo:fdaUniiCode |
2FY1A2A305 440C8K5Y5K |
| dbo:pubchem |
104180 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/Tametraline.svg?width=300 |
| dbo:wikiPageID |
22753844 (xsd:integer) |
| dbo:wikiPageLength |
4583 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1107927891 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbr:Norepinephrine-dopamine_reuptake_inhibitor dbr:Desmethylsertraline dbr:Pfizer dbr:Reserpine dbc:1-Aminotetralins dbc:Pfizer_brands dbc:Stimulants dbr:Tritium dbr:Lometraline dbc:Norepinephrine–dopamine_reuptake_inhibitors dbr:Cyproheptadine dbr:Dasotraline dbr:EXP-561 dbr:Norepinephrine dbr:JNJ-7925476 dbr:Tetralin dbr:Indatraline dbr:Nefopam dbr:Sertraline |
| dbp:atcPrefix |
none (en) |
| dbp:c |
17 (xsd:integer) |
| dbp:casNumber |
52760 (xsd:integer) 52795 (xsd:integer) |
| dbp:chemspiderid |
143316 (xsd:integer) |
| dbp:h |
19 (xsd:integer) |
| dbp:index2Label |
HCl (en) |
| dbp:iupacName |
-N-methyl-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-amine (en) |
| dbp:n |
1 (xsd:integer) |
| dbp:pubchem |
104180 (xsd:integer) |
| dbp:smiles |
CN[C@H]C=C2[C@H]1C3=CC=CC=C3 (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
NVXPZMLRGBVYQV-WMLDXEAASA-N (en) |
| dbp:unii |
2 (xsd:integer) 440 (xsd:integer) |
| dbp:verifiedfields |
changed (en) |
| dbp:verifiedrevid |
448234115 (xsd:integer) |
| dbp:watchedfields |
changed (en) |
| dbp:width |
175 (xsd:integer) |
| dbp:wikiPageUsesTemplate |
dbt:Drugbox dbt:Reflist dbt:Short_description dbt:Stimulants dbt:Cascite dbt:Chemspidercite dbt:Drugbankcite dbt:Fdacite dbt:Stdinchicite dbt:Monoamine_reuptake_inhibitors |
| dct:subject |
dbc:1-Aminotetralins dbc:Pfizer_brands dbc:Stimulants dbc:Norepinephrine–dopamine_reuptake_inhibitors |
| gold:hypernym |
dbr:Parent |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 yago:WikicatAmines yago:WikicatStimulants yago:Abstraction100002137 yago:AliphaticCompound114601294 yago:Amine114739004 yago:Chemical114806838 yago:Cognition100023271 yago:Compound114818238 yago:Information105816287 yago:Material114580897 yago:Matter100020827 yago:MethaneSeries114951377 yago:OrganicCompound114727670 yago:Part113809207 yago:PhysicalEntity100001930 yago:PsychologicalFeature100023100 yago:Relation100031921 dbo:Drug dbo:Organisation yago:Stimulation105827684 yago:Substance100019613 |
| rdfs:comment |
Tametralina (CP-24,441) é um composto químico precursor de uma série de compostos investigados pela Pfizer que, eventualmente, conduziram ao desenvolvimento de sertralina (CP-51,974-1). (pt) Tametraline (CP-24,441) is the parent of a series of chemical compounds investigated at Pfizer that eventually led to the development of sertraline (CP-51,974-1). Sertraline has been called "3,4-dichloro-tametraline". This is correct but it is an oversimplification in the sense that sertraline is the S,S-isomer whereas tametraline is the 1R,4S-stereoisomer. 1R-Methylamino-4S-phenyl-tetralin is a potent inhibitor of norepinephrine uptake in rat brain synaptosomes, reverses reserpine induced hypothermia in mice, and blocks uptake of 3H-Norepinephrine into rat heart. (en) |
| rdfs:label |
Tametralina (pt) Tametraline (en) |
| owl:sameAs |
freebase:Tametraline yago-res:Tametraline wikidata:Tametraline dbpedia-pt:Tametraline dbpedia-sh:Tametraline dbpedia-sr:Tametraline https://global.dbpedia.org/id/2kK6x |
| prov:wasDerivedFrom |
wikipedia-en:Tametraline?oldid=1107927891&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/Tametraline.svg |
| foaf:isPrimaryTopicOf |
wikipedia-en:Tametraline |
| is dbo:wikiPageRedirects of |
dbr:CP-24,441 dbr:CP-24441 dbr:CP_24,441 dbr:CP_24441 |
| is dbo:wikiPageWikiLink of |
dbr:List_of_dopaminergic_drugs dbr:Desmethylsertraline dbr:Development_and_discovery_of_SSRI_drugs dbr:Claisen_condensation dbr:Benzhydryl_compounds dbr:2-Aminotetralin dbr:CP-39,332 dbr:Lometraline dbr:Dasotraline dbr:Nomifensine dbr:Norepinephrine–dopamine_reuptake_inhibitor dbr:Kenneth_Koe dbr:Chlorprothixene dbr:C17H19N dbr:Indatraline dbr:Sertraline dbr:Serotonin–dopamine_reuptake_inhibitor dbr:List_of_drugs:_T–Td dbr:CP-24,441 dbr:CP-24441 dbr:CP_24,441 dbr:CP_24441 |
| is foaf:primaryTopic of |
wikipedia-en:Tametraline |
