125 - ����� ��� ����� �125 (original) (raw)

����� ���? - �� - ���?-1 - ���?- ��- ���? �����? ����������--�--W ����� ��� ����� ****�� = �� - � ������� �����**
���� **������� - �-��������� �������� ����� ���� ����� �� �����- 2015 ����� | ���������� ����������: 2015. 02. 08

��� ����� ����125 - � ��� ������ ��� ����� ��� ����� **�������, 2014 ������� (��������), ������ (���������). . ������������� �-���, ����������� ���., ������. ����� 20 ��. �������: �. ���������. "�����", 2014. 12. 06. ����: � �.�. ������
20 ������ 2015 �. ������� �.�. ������ � �� ������������� � ������ 27 ������. ������ �.�. ������ ����� ������� ������� � �����. ����� ��. �.�. �������� ��� (��������� ��., 18 ���.2. ���. 8 (495) 954-39-00 . ������ 19 ���. ���� ��������� ��������: �������� ��������� ������� �������� � ����� ���������� ������� (�������� �����)

�������� ��������� � ������ ����������

� 7 ������� 2014 �. ��������� ������ ���������������� ����������� - ���� ��������� ������ � ��������� ��� ����, ���� ���������� �������� � ��� �� �������. ������� ����� ��������� ����������� �� ��������� � ������� ���� �� �����. ����� ��. �.�. �������� ��������. ����� ����-����� . ������ 18.45. ���� ���������.

��������� � �������� � ������� �� ���.: 8 (495) 433-63-11 - �����. ����� ����-����� (���������� ������� �������) ; 8 (495) 954-18-59 - �����. ����� ��. �.�. �������� ��� (������ ��������� ���������) . ��������: �������� ��������� ������� �������� � ����� ���������� ������� (�������� ����� )

�������� � �� ������ �� druza: **** - - - - - - - - - - - - - - - - - - - - - - - �� - - - ** \\ ****���������� ������ ��������� (�� geo.web.ru/druza)**

��.�� www.mindat.org \ A-B-C-D-E-F-G-H-I-J-K-L-M-N-O-P-Q-R-S-T-U-V-W-X-Y-Z

���� � ������: �. ������.

�������� �� A �� Z - ������ IMA (������������� ���������������� ����������)- http://pubsites.uws.edu.au/ima-cnmnc/

�������� �� ����� ���������, ������������ � ������������� - http://pubsites.uws.edu.au/ima-cnmnc/ \\ The Commission on New Minerals, Nomenclature and Classification (CNMNC) of the International Mineralogical Association (IMA) was formed in July 2006 by a merger between the Commission on New Minerals and Mineral Names (CNMMN) and the Commission on Classification of Minerals, at the request of both commissions

���������� ������_ ��������: �� � �� � (�� ������� �����) - ����� 4000 ��������� ( 4633 �������� ��������� "��������") �� http://wiki.web.ru/wiki/ \\ http://webmineral.com/Alphabetical_Listing.shtml

��� �������� ���� (�� A �� Z) \ All Minerals of the World / Tous les mineraux de la terre http://euromin.w3sites.net/mineraux/accueil.html

���������� ������_ �������� �� A �� Z (�� ���������� �����) � ���� ��������� - http://www.mineralatlas.com/ \\ ���� ��������� - http://www.cs.cmu.edu/~adg/adg-home.html (�� ����� Alan Guisewite ) ������ ��������� - http://en.wikipedia.org/wiki/List_of_minerals

**** -**

��������� \\ �����

����

����. ���. �����, ������. �������: �.�. �������. 7 ��. 2014. 12. 11. ����: � �.�. ������

������ \\ ������ \\

��������� \\

����� �� ������ �.�. ����������� "������ �������". ���������������� ��-�. ���. ����� ��. �.�. �������� ���.. 2014.11. 18. ����: �. ������.

��������� \\

����� \\

--����. ������ - ������������ - http://uraloved.ru/geologiya/uralskie-almazi

������* ���� PbTe

������ \\ ���������

�������� \\ ��������� �. �., ��������� �. �., ������ �. �. � ��. ��������. �.: �����. 1989. � 192 �.

������� \\ ���������� \\ http://www.mindat.org/ \\ ������� \\ �������� \\ ������

��������

������-(CaF) \ Apatite-(CaF) - �������� ������� (����������������) ������� � ������ �������.

��������� \\

�������� \\

��������. ����� �-���, �. ���������. �������: �. ����������. ����� 40 ��. "�����", 2014. 12. 06 . ����: � �.�. ������

����������� \\

--Hidalgo del Parral, Mun. de Hidalgo del Parral, Chihuahua, Mexico-- 20 ���� --/www.mindat.org/

����������� \\\

������ \ ������������� ����� ��������� � ��������� ���������

����������� \\ ����������� \\ ����������

**** -**

�����������

���� ������: http://www.mindat.org/ (�� 2011.09.25)

����� \\

--����������� �������� ������ �� ����� ���� (�� ������� � ��������) �� ������� ��������� Bill & Diana Dameron�s barite suite. � ��.-- http://www.baritespecimenlocalities.org/BariteHome.htm

������ \\

��������_�������� \\ ������������ (���������� ������� � ������)- http://basik.ru/forum/index.php?showtopic=77

���������� = ���������������� \ oxyplumboromeite (������������ � 2010 �.)

������

������.

������. �-��� ����������. ����: � �. ���������

���_����������� � �������� \\ �����������

**** -**

��������

��������� \\

�������� \\

�������� \\ ��������

��������� \ Wikimapia (����� ���� � ������)

��������� \\ ������ \\ �������� \\

��������� � ��������� � ����. ������ \\

��������� \\ ����������.

������ ������� �������� � ����

**������� \ ���������������� �������

��������� \\

���������. ������, ���������. ����� 30 ��. �������: ���������������� ����� ����-�����. ����: � �.�. ������.

�������� ��������� � ���������� ������

--�������������� ����������ߔ � ����� ...���������(pdf)

**** -**

������� \\ ����� \\ ��������� \\ ������� \\

������� ���������

--����� �.�. ������������ ������������ �����������. - ������������: ��� ���, 2011.- 167 �.

�������. ��������� �-���, �������, �� ������, ������. ������� ������ ����� 8 ��. �������: �. ��������� . "�����", 2014. 12. 06. ����: � �.�. ������

������������ \ GeoWiki �� � �������� - http://wiki.web.ru/

ø��� \\

���������� � ������� ��������� (��������) \\ ������� �.�. ��������� - �������. "�������", �3-4, 1926 \\ Rickwood P. C. The largest crystals.

���������. ������������� �-���, �. ���������, �������� ����, ������. ~ 10 ��. �������: ���. ����� ��.�.�. �������� ��� (�94477. ���: ���������� �.�., 2014). ����: � �.�. ������

���� \\

������ ������������ - http://www.mining-enc.ru/ \\ http://dic.academic.ru/contents.nsf/enc_geolog/

������

������. ������������ �-�, ����. ����, ����. ������, ������. �������: �����. ���. ��. �.�. �������� ���. ����: � �.�. ������

������ �������� \\

���������

**** -**

�������� \\ ������� \\

�������� \\ http://folk.ntnu.no/krill/mineralogee/8.htm \\

�����. �������� �� ��������� ������. ����� �� ������ �.�. ����������� "����� � ���� �������� ���������". ���������������� ��-�. ���. ����� ��. �.�. �������� ���.. 2014.10. 21. ����: �. ������.

������������ ������

��������� \\ �������� \\

������� ��� ����� \\

��� �������� ������� ����� �� "������" - ����� ����, ���� �� ������ �������� � ��������. ����������� �-��� ���������� (�����, ������). 2013 �. ����: �. ��������

--���������������� ����� ����-����� - ���� � �������� �1306

--������������� ����� ��� -- � ������� ��������� � �����������

--�������� ��������� ����� - ����

--������� �. �. ����������� �� ������. �. 1960 (���-����������) :

--������� �.�. ������������� ����������� (���-����������)

�������

������� \\ ������ \\

����������� ����� (�.�.)����������� � ��� (�� ���������): http://www.geol.msu.ru/departments/mineral/Rus/Edu/deposit_liter_r.htm \\ ������ ������������� �� ��������� (����. �.�. �������) - http://www.geol.msu.ru/departments/mineral/Rus/Edu/deposits_r.htm

--������ ������������ - � �.�.

--������ �. �. ������������ �����, �� ��������, ��������������� � ������������ \\ http://www.vadim-blin.narod.ru/book/titl.htm \\ ��������� (������� ����� �� �������� ������) - http://www.vadim-blin.narod.ru/book/glossary.html

����������� ����� (���������)_��������� �������

�������� �����

�����������

����������� (�����) � �������������� ������ � ��. ����, ����������, ������. ����� 5 ��. �������: �. ��������� . "�����", 2014. 12. 06. ����: � �.�. ������

**** -** -

������

�������� � �����

������� ��� ����������� � �������������� \\ The Mineralogical Record, \\ Rocks & Minerals \\ Le Regne Mineral \\ Mineraux et Fossiles \\ Lapis \\ Mineralien Welt \\ Rivista Mineralogica Italiana \\ Revista de Minerales \\ MineralUp\\ Bocamina \\ UK Journal of Mines and Minerals

**** -**

������������ ���������

�������--��. ���� ����

������

�������� �� ����� �.�. ������� ������ �.�. ����� ���� ����������� ������ [�������]. ����� I. �., 2000. �����. ����� ����-�����.

**** -**

������� \\

����� �� ������ �.�. ����������� "������ �������". ���������������� ��-�. ���. ����� ��. �.�. �������� ���.. 2014.11. 18. ����: �. ������.

������� \\ �������� \\

�������� � �������� \\ ��������� �.�., �������� �.�. ����� ���������� ���������. �. 2003. \\

����������

������ \\ � ����������� �� ����� www.mindat.org/ \\ ���� (12), ��� (12--������� � ������), ����

������������� ��������� \ ��������

��������� ���� (

������� ����������� ( �������, �������� � ��..)

**** -**

��������� � ����������

�������

������ � ������

�������. �����-���������. 2014. 12.11. ����: � �.�. ������

������ � ����

����� "� ����������" ���. ���. ����-�����, 2014. 12. 26. ����: � �.�. ������.

��������� ����������

���������

����� ���� - http://maps-of-world.ru/inter.htm \\ http://geography_atlas.academic.ru/

������������, ����������������

����� \\ http://www.marshruty.ru/ \\ http://wikimapia.org/country/ \\ http://www.openstreetmap.org/ \\ http://ru.wikipedia.org/wiki/OpenStreetMap-- ����� ����, ����� � ������� - http://planetolog.ru/ \\ http://mapper.infomine.com/ \\ http://www.veslo.ru/maps.html

--http://wikimapia.org/

--����� ���� � �������� (����) - http://fotki.yandex.ru/users/ilm/map/view/recent

���������� \\

�������� ���������������� ���������

--������� ���������������� ��������� ������������ ���������� �������������� �����. ���������: �.�. ������� � �.�. ���������. - �����������, 1978. - 218 �.

--���������������� ��������� ������� ��������� ����������� ��������� II. [�������]. �������� �.�. �������. �.-���������, 1911. - 575 �.

����� \\ ���������� - http://www.quartzpage.de/info_lit.html -- ��������-����� -2011 (�����) (�� ����� �������� 2-3 ���. )

--����� �� ������� ���� - http://www.mindat.org/mesg-95-139699.html

����� ���������� (��������� ������). ����� �-���, �����. ���������. ����� 15 ��. �������: ���. ����� ��.�.�. �������� ��� (��������� �.�. ���������, ST 6751. ��������� �., 1968). ����: � �.�. ������

****����� � �����������**

�����_ "����������� �������" \\ ������� �. ����������� �������. - ������ "�", 1993, �0, �..50.

�����_�������� ��������_����������� mindat.org

������

--����������� �-���--http://www.granitoao.ru/

�������� \\

������������� \\ ��������� \\

����� ��� ����������� � ��������������

--http://www.crystalclassicsminerals.com/books.php

������� ����� ���������� � �������������

������������������ ���������

�������� �.�. ����� �������� �������� (����������� �� � 1970-�� ��.)

�������� \\

��������� \\ ������ �����, ����� ������-������ � ������ ����� - http://nnm.me/blogs/thread1/myachi-bogov/

������� \\ ��������� \\

������ \\ ����, ����������� ������� - http://www.corunduminium.com/index1.html

������� \\

��������� � �������

�����������

�����������. ����������� ����, ����� ������, ���, ���. �������: ���. ����� ��.�.�. �������� ��� (���: ����������� �.�.). ����: � �.�. ������

������ \\

������. �����-��-������, �������, �����-������, ��������. ����� �� ������ �.�. ����������� "��������� ��������� ����������". ���������������� ��-�. ���. ����� ��. �.�. �������� ���.. 2014.12. 09.

������

**** -**

�������� \\������� \\ ������� \\ ������������ \\ ��������� \\

��������� \\

1. ���������. ���������� ��., �� �����, ���������. 2. ���������� ��������� ������ (��������). ����� �� ������ �.�. ����������� "��������� ��������� ����������". ���������������� ��-�. ���. ����� ��. �.�. �������� ���.. 2014.12. 09.

˸� \\ http://www.mindat.org/min-2001.html \\ �����������

˸������� \\

������� \\ �������*, ������� (mindat.org )

--������� �.�. ��������� �������� � ����� � ����� // ���. �������. ���-��. 1884. �. 19. �. 15 (����������� �-��� - ������ ������� �� �����).

������� (����� ��������� �� 1,5 ��). ����-����, ���������. �������: ���������������� ����� ����-�����, �1068. ����: � �.�. ������.

���������� � ��������� � ����������� ������ \\ �� ���������� � ��������� ���������� ����� \\ �� ���������� � ��������� ������, � ����� ����

���������� �� �������� � ��������� ���� ��� ���. \\ http://wiki.fegi.ru/index.php/

�������� \\ ����������

�������� �����

��������������� (��������������� ��������) - ���� �������� �������� �����. ����� ��.�.�. �������� ���

**** -**

�������� \\

�������

�������. ������� �-� \ Kambove mine, �������, �� �����. �������: ���. ����� ��.�.�. �������� ��� (�93181. ���: ����������� �.�., 2010.). ����: � �.�. ������

��������

����� \\ �������� �� ������ - Minerals on Stamps

���� � �������� ����

�������������

������������

������������ �� ����. ����. �� ���� ��������� �. �������� (F. Hawthorne) ������������ ��������������� ��������� ��������. ��������� ������������ �����. ���. ��. �.�. �������� ���. ����� �� ������� �.�. ������� � ��. 2014.12. 18. \\ 33_14--�����

��������� \\ ����� �.�. � ����������, ������� ������ 1940, �7-8, �.39-42 \\

���������

���������

������.���\ www.mindat.org - - ���������� ���� ������ � ��������� � ����������������. Ÿ ���������� - ������� ����� \ Jolian Ralf . ���������������� �������� \ Mineralogical Almanac (������ \ Russia) \ http://www.minbook.com/mineralogical_almanac_ru.html�����������_��� ��������� (���� ��������� � ������� ����������)- http://geoserv.krc.karelia.ru/geo/rus/ht

���������������� �������� -

�����������

--�������� �.�. '���� �����������' - ������: ��������������� ������������ ������������� ����������, 1951 - �.543 --���-����������

�������� (����������) -------

--������������������� �������� ��������� - http://geo.web.ru/druza/m-miner_A-Ya_sil.htm

--��������. ����������. ��� 3. ������ 1. �������� � ���������� � ���������� ������������������ �����������. ����������

�������� - �������� �� ���������� \\ ������ �.�. �������� - �������� �� ���������� (2): ��������� ������ ������� �������������-�������������� ���������. - �12. - �.: ������������ "������ �����", 2009. - 35 �.

���������� \\

������� \\

��������

������ \\ ��������� �����

� � � � �

������

--��������, ���������� ���. - ������������ �������-���������������� ����� \\ � ������� 2014 �. ������� � ����� �������� ���� ���� - http://www.������������.��/. \\ ����� �����: 142200 �. ��������, ���������� ���., ��. ������, �.8/7, �/� 13. \\ ��������: 8 (4967) 72-48-45, +7 (903) 259-02-43. ��. ����� kamnirus@ya.ru, kamninet@mail.ru

�������

--���������������� ��������� ������� [�����] - http://d290351.u72.ukrhosting.com/subpage38.html

--"������ ������� ���������������� ����� � �����" (2004 �.). \\ �������. ��������, 2009, �.14, �.3, �.46-51. \\ � ��� ���������� ����� 2000 �������� (����� 500 ����������� �����) �� ����� ����. "...������ �� �������� �����-�������������� ������������ �������� ���� ���������� ���������� ����������� ������� � ������������ ������ 23 ���� 2004 ����...". "�������� ������������ ����������� �������� � ������� "��� ��������� �������", �� ������� ������������ ��������, �������� ������������ ���� � ��������� �������" (�.�. ��������).

**** -**

�������� � �������� ��������������� ���������

--�������������� �������� ������ (� ��� �����, ������������� �������� ����������) - http://russia.yaxy.ru/subdmn/russia/geo-nm.html

�������� ��������� ---����� ���������. ��� �� �������� ������� �.�. (������ � ������, 2012, �1) \\ ���-����������: \\ ����� ���������. ��� �� �������� �������1 \\ ��� ������, ��� ������������? - ��������2 \\ ���������, �������, ����������, �������������� - ����3 \\ ������, ��������� � ���� ��������� - ������ �4 \\ ��� ������� ������� � ���������� - �5 \\ ����������, �������������, ����� - �6

����� \ Afmite \\ ������ � ����� ����������� ���������� ���������������� \ Association Francaise de Micromineralogie (AFM)\\ http://www.mindat.org

��������

��������� � ������

����� - http://www.rosnedra.com/

������

����� �� ����� (�� ������� 2012)

����� ����� � ����������

������ �.�. ���������������� �������. ������� �����. III. ��������� ������ (���������� ���. ����). �.: 2014, 326 �.

� ���������� ������� ���������� ������� ������ ��������� ��������� ������ (��������� ���. ����) - ����� 1500 ��������, ������� �������������. ��� ������� ���� ������� �������� ���������� �������, ��������� �� ������� ������������ ������, ��� ��������� �������� ���������������� ����������� � ������������ ���� ����� ����������. ������� �������� ������� ��������� ���������� ���������, ������� ��������. ���� �������������� ������ �� ��������� ����� ������ ���������� � �����������, ����������, �������� ������, ���-�������� � ������������ ��������� � ��. (���� ������ - http://geo.web.ru/druza/ � ��.).
����� ��������� �� ����������� � ��������, �������������� ������������ � ��������� ������������, ���������, ����������� ������, �����������-��������� � ��������������.

������������ �.�., ����� �.�., ���������� �.�., �������� �.�. ��� ��������� ������ �����. �������� ����������� �������. ������������� ���������� �����. - ���������: ���-�� "�������"; 2014. - 624 �.: �1600 ��..

�������!

����� ��������--����� �� �������-��� 2012 �. - http://www.mindat.org/forum.php

����� ����������� � ���.���. ��. �.�. �������� ���

**** -**

������������ ����� \\ ��������

���������� ��������������� \ ����������� �������������� ��������

���������� ������ \\ ������ \\ ���� (������ � ����) \\ ����

����������� (�����������) ���������

��������

�������� � ������

**** -**

������ ������� �������� � ���. ���� � ������

���������

�������������� (�������������� ��������)

����� � �������� �������� \\ �������

�����!! \\

�����. [�������� ����, ����-������������ �����, ���������-��������], ���. ������, ������. �������: �. ��������. ����: � �.�. ������

���������� \\

**����� **\\ http://www.mindat.org/min-3321.html \\ ���� (27) - http://www.mindat.org/gallery.php?min=3321 \\

���������� �����

������� ����� \\ ��������

���������������� ��������

������ - http://www.mindat.org/min-3277.html \\ ���� (1002) - http://www.mindat.org/gallery.php?min=3277 - �� 2009.05.27

�������������

������������� \\ ����������� - http://www.mineralatlas.com/specials/pseudo.htm

����������

--The Mineral News, 2004-2007 \\ ��������� ���������� �� ������� \ ���������������� \ ���������

**** -**

������������ ��������� ��������� ���������

������������ ����������� (�������)

�-��������� \\ � ������� 2008 �. � ���������������� ����� ����� (������) ���� �������� ������ ������� � ����� ������������ ��������� "������������ � ��������� �����������" (���������� - �-���������).

��������

������ ������ \\

������� � �������� � ����� \\ http://www.minrec.org/artmuseum.asp

1. �������� � �����. ��������� ������ �.�. ���������. 2. ���� ������� �. �����-��� (��������, ���). . ���� � ������: �. ������.

������� \\

���������� \\

�������

����� \\

�����

����� �� ������ �.�. ����������� "������". ���������������� ��-�. ���. ����� ��. �.�. �������� ���.. 2014.12. 02.

�����

**** -**

������

������ - ������ �� �������� ���������. ����������, ������, ��������. ����� �� ������ �.�. ����������� "������". ���������������� ��-�. ���. ����� ��. �.�. �������� ���.. 2014.12. 02.

��������� ������ � ���������� ������ ������� ������. ���-����� � ����������. ����� �� ������ �.�. ����������� "������". ���������������� ��-�. ���. ����� ��. �.�. �������� ���.. 2014.12. 02. \\ ���-125

�������� \\"�������" ��������� �� ������� � �������� (10-15 ��������� �������) \\ 1-� -� 2007 � .

���������

������� (����. �����) \\ ���� \\ �������� \\ ������� \\ silver **- mindat --**���� (1189), ��������������� (3716) -- �� 2009.11.15

��������� \\

�������

�������� �� �-�_������� ��������� � ����������� "��������"(���.III-V)

���������� \\

��������� � ��������, ����������� � �� ������

������������� ���������

��������

�������������� ��������� (� ��� ����� �������� �������� �������� \ reverse sceptre �� ������� ( Esperanza Mine, near Bombori, Nor Potosi Province, Potosi Department))--�����������--http://www.mineralatlas.com/specials/sceptres.htm \\ http://www.mindat.org/ \\ http://www.mindat.org/photo-284819.html

��������

�������

--���������� �.�. ���������������� �������.- ���.: ���-�� �.-������. ��-��, 2008. - 556 �. --������� �����. ����� - ��� (�.�. ����������. ������� ����������� �����. ���, 2006)

--������������� ������� (�������� ������ "�����������")

������� \\

����������

���������.

������ ��������� - http://en.wikipedia.org/wiki/List_of_minerals

��������

���������� "��������"_������� ��������� � ����� IV-V

�����������

������: http://www.insminerals2005.narod.ru/

���������

���������� � ����������������

�������

���������. ��������������

������� (����� ��� ����������) � ��� ����� ����������� �����, ������� �� ������� ���� � ������������ �������� \\ ���������: http://a-stones.net/mMain.aspx?ChapterID=37 \\

��������

�������� \\

�������������� --��. http://geo.web.ru/db/msg.html?mid=1179562. \\ �������������������� ��������� - http://geo.web.ru/db/msg.html?mid=1175869

���������

����� (������� ��������� ����������). 6,5� 6 ��. ���� ����� �.��������, ����. �. ���. ��������, ��.������. (��������� �.�. ���������. ST6726). ����: � �.�. ������

**** -**

��������

��������. ����������� ��������. ����� �� ������ �.�. ����������� "���������, ������, �������� � ��.". ���������������� ��-�. 2014.12.16. ����: �. ������

��������

��������� � ������ �������� ������� \\

�����������

������� \\

������� (�������) �������������� �-���, ����. ����, ������. �������: �. �������. 2014. ����: � �.�. ������

��������� \\ �������� \\ ����� \\

���������� (���������� ��� ����������) \\ ������� �.�. ������� �������� �������������� ��������. �.: �����, 1984. - 654 �. - ����������� ������

��������� \\ �����_��������_ ��������� ������� \\

�������� \\ �������� (������) \\

**** -**

������� \\ ��������

**** -**

****������** \\ ������� \\ �������� \\

�������

1. ������� �� ������. �������� �-� \ Huanggang Mine (Huanggangliang Mine), �����. ��������, �����. ������ ����� 15 ��. "�����", 2014. 12. 06 ����: � �.�. ������ 2. �������. ������� (195 �����). ������, �������. �������: Don B. Veigel, 2010. ����: �. ���������.

����� ��������� ���������

�������� �������� (���������, ��������) � ����������� ������� (���������, ��������). ���� � ������: �. ������

���� ��� ��� �� geo.web.ru/druza/ - "������ ����� �� 30 ����"

���� ��� �� ������.���_������������� - http://www.mindat.org/gallery.php?potd=1

���� ���� �� ����� ���� - http://www.panoramio.com/map/

��������� ��������� -- http://tw.strahlen.org/fotoatlas.html (834 minerals, 1148 photos**)**

����������� ��������� - �������� �� A �� Z � ����� �� ���������� - ��������� ��� ������.��� - http://www.mindat.org/photoindex.php--http://www.mineralatlas.com/ \\ http://kristallov.net/index.html \

���������� ��������� \\ \\ http://klopotow.narod.ru/soveti/foto.html

����������

**** -**

�������� \\ http://www.mindat.org/min-960.html ; ���� (541) - http://www.mindat.org/gallery.php?min=960 \\

����������� \\

�������� \\ ������

����������

**** -**

����� ���������

������� ����� \\

--������� �.�. ������������ "������� �����" - ����������� ����

������� �����

��������

������� \\ ������

������

**** -**

������ \\ ������. ��������� ���� ������. ���������������� ������-���������� �������. - �������6 ���-�� "������������", 2011. - 192 �. (������ �������: ������ �.�., �������� �.�. � ��.)

****�� -**

������

����. \\ �������� \\

�������

�������� ������� \\ XXV ������������� ������� � �������� ����� ���. �������� ������������� �����. 23-26 ��� 2008 �. ����� �������� ��������� ����� \\ http://alkaline2008.narod.ru/ \\ ������ - http://alkaline2008.narod.ru/Abstract.htm

**** -**

�������� \\

������ \\ ��������������� (595) - http://www.mindat.org/min-31.html \\ ���� (169) - http://www.mindat.org/gallery.php?min=31 (�� 2009.03.22) \\

���������_ ���������������� ���������. \\ � ���. ����. ����� ��. ��. �����������

������� \\

������� (����������� ���������), ��������� (�������). ���������� �-� \ Pederneira mine, �����-������, ��������. �������: ������������� �����, �������, ���������. ����: �. ���������.

������ \\

**** -**

******

������ \\ ������� ��������� � ����������� ������ \\ ������ \\ ����

���� � ������ [�� �.�. ��������] - http://pictoris.ru/5/27/index.html

�������� ������� ��� [�� �.�. ��������] - http://pictoris.ru/5/29/index.html

���� � ������: �. ������.

��������������� ���������

**��������������� ��������� \ mineral localities �� ����� � �� ��������� ����������� ������ �.�. �������������� �������� � �����������. ������� ���������. �. I, �. , 2000. - 269 �.; �. II, �. , 2000. - 282 �.
����� I � II (���������):

�-�-��� :
���. 10- 26- 45- 54 - 63- 73- 75- 77- 81- 87- 88- 122- 132- 151- 160- 166- 180- 188- 213- 226- 234- 239- 247- 249- 255- 260 260- 265- 267-
Locality A B C D E F G H I J K L M N O P Q R S T U V W X Y Z
c��. 9- 24- 44- 63- 71- 78- 86- 97- 108- 113- 118- 135- 148- 173- 181- 188- 203 204- 214- 243- 257- 260- 268- 275- 276- 278-

��. ����� http://www.mining-enc.ru

����-����� (= ����-�����), ����. ���������� , ������

������ = ������ \ Eifel ���� (�����������), ��������-������, �������� \ Eifel, Rheinland-Pfalz, Deutschland

������� \ Akchatau, �. ��������� \\

�������, ��������, �������� �-��, ������. \\ 67�51?48.62? �. �. 34�30?16.25? �. �.

��������, �������

��������, �. ��������.

������������ �-���, �. ����, ������\\ http://www.mindat.org/loc-192610.html

�������� (�-�), ������

����������� ����, �. ����, ������

- ��������������� ���������

����������� �-��� , �. ������, 60 �� � ��� �� �������������, ��. ����, ��

������������� �-���, 70 �� � � �� �������, ���. ������, ������ \\ Levitskii V.V. Journey to the Belorechenskoye Deposit. Mineralogical Almanac, vol. 13c, 2008 , p. 62-71

����������� ������������ �������������, ������� ����, ������

--�������, �. �. ��������� ������� ������ ���� �� ������������ ������� �� ����� / �. �. �������. - ���., 1885. - 6 �.

�����, ����� ����, ����������, ���

������-���� (���.) = ����� (����) �-�**,** ����������� ����., ������ \ Kabwe Mine (Broken Hill Mine), Kabwe (Broken Hill), Central Province, Zambia; 14�29'S , 28�25'E - http://www.mindat.org/loc-4341.html \\

������ ���� (Broken Hill), �. �. �����, ���������, 31-57` �. �. , 141-26` �. �. \\ http://www.mindat.org/loc-72.html \\

������� \

--��������� \ Brumadoite - ����� ������� \\ D. Atencio, A. C. Roberts, P. A. Matioli, J. A. R. Stirling, K. E. Venance, W. Doherty, C. J. Stanley, R. Rowe, G. J. C. Carpenter and J. M. V. Coutinho (2008): Brumadoite, a new copper tellurate hydrate, from Brumado, Bahia, Brazil. Mineralogical Magazine 72, 1201-1205.

��-�����, ������� \\

������� , ����������� (�), ������

������, ��������, ��. ����, ������.

������������-�����, ������ \\

�������, ������

������������� �-���, �������� ����, ������

�������� ����, �. ����, ������ \\ ����������� � ��. - http://webmineral.ru/

��������� �-���, � ��� �� ������, ��. ��������, ������

--������� �.�. ����������� ���������� ������������� ���������� ���� ��������� ������� � ������� ��� �������. ������� �������. ������: �����. ���. ����. ��-�, 2011. - 189 �.

���������-��������� ����. ����, ���. ���������-���������, � � �� ��������, ������ , ������� \\ ������!!!--�; �����!!!; �����!!; �����!!; ���������!; ����!; �����!!!--xls>100 ��; �������!!

ø���. ���������-��������� ��������. ����, �������. "�����", 2014. 12. 06 . ����: � �.�. ������

������� ������, �������� �-��, ������

�������, ���������

����-������ ���� , ���. �-� (Au-Ag-As-Sb-Hg-Tl-Ba-Pb-Zn-Cu-Mn-Ni), ~10 �� � �� �� ������, ����� �����, ������, ��� \ Gold Quarry Mine, Maggie Creek Subdistrict, Carlin Trend, Eureka Co., Nevada, USA; 40�47'29"N;116�12'33"W \\ , ������, ��� \\ ���������; ���������; *�������������--�; �����������!; ��������-�����������; ������; ���������; �����������; ������������; *��������--�; ��������. ���.-112 (2006.07.12); ��������; �����; ��������; �������!; ��������!-�; ��������!!; ��������!!; ��������; haggite; hummerite; *...1996-meurigite;. \\ MR, 1995, 449-469 \\ � 1990-�� ��. �-��� ����������� ������� ���������� ��������� ��������� Zn, Cu, Bi, Pb, Fe (Kokinos M. et al., 1993); ��; 150 ���� (������ - �����).

--Jensen, M. C., Rota, J. C. and Foord, E. E. (1995): The Gold Quarry Mine, Carlin-trend, Eureka County , Nevada . - Mineralogical Record: 26: 449-469; --Cooper, M.A., Hawthorne, F.C., Roberts, A.C., Foord, E.E., Erd, R.C., Evans, H.T., Jr., and Jensen, M.C. (2004) Nevadaite, (Cu 2+,[],Al,V 3+)6[Al8(PO4)8F8](OH)2(H2O) 22, a new phosphate mineral species from the Gold Quarry mine, Carlin, Eureka County, Nevada: Description and crystal structure. - Canadian Mineralogist: 42(3): 741-752. \\ �������� � ���������: http://www.mindat.org/loc-29501.html

����-������ ���� \ Gold Quarry Mine � �������� ��������������� ��������� ������ ��� (� ��������� �������). ��������: �. ������, 2014.

������ (Gorikho), �-���, � ��. � ���. ���. �. ������ (������ �. ����, ����. �. �������), 45 �� � � �� ���� [����-������], �������� \\ ������!; ������ ��������!; �����!!; �������!; �, 491; �, 28, 197

�����-������� ( (����) = ������������ (���.) (Horni Slavkov (now) = Schlaggenwald (form.)), 12 �� � ��� �� ���. ������� ���� , �������, �����

����������� �-�, ��. ����, ������

����������� (� �����), ��������, ������ - ��������� ��������� �� ����� - http://giantcrystals.strahlen.org/asia/dalnegorsk.htm \\

-- �������������� �-��� \\ ������� �-� \\

-- ������������ �-�

.����-���� (= �����-���� = ����-�-���� = ��������) (Dara-Pioz) , 45 �� � �� �� ���. ���� � 35 �� � ��� �� �����������, �������� ��. , ����������� \\ http://www.mindat.org/loc.php?loc=3241

�����-������� ������, �������� ��., �����������. ����� �� ������� �.�. ������� � ��. 2014.12. 18.

--������ �. �., ��������� �.�. ��������� - ������� � ������������. - �������.�. , 1992, 14, �3, �.75-78.

��������, �����������

����������, ���������

"���������". 1. ����. 2. ������ � ��������� (������� �� 3-4 ��). ����������, ���������. "�����", 2014. 12. 06. ����: � �.�. ������

���� �-���, ����. ����, ������ - http://www.polarquartz.ru/dep-dodo.html

����������� (�������), �-���, ����. ���������� , ������ \\ ������!; ����������!; ����������!; ������!; �������!!; ��������!; ��������!!; ��������!!; ���, 351

���� \ Zagi Mountain, 30 km NW of Peshawar, 4 km S of Warsak (34�09`N, 71�24`E), ���� Kafoor Dheri, �-� ��������, ������-�������� ����������� ���������, ��������;

������������� �-� (Zmeinogorsk) = ������������� �-���, �����, ������ (��), �� \

���������� ����, ��. ����, ������

����������, �. ����������

�������. �. ����, ������ \\ ����� � ��. http://reserves-park.ru/index/0-204 \\ http://nashural.ru/Mesta/ilmeni.htm

����� (Inder) (= ��������� �-���), 15 �� � � �� ���. ������������, 150 �� � � �� ������ (= ������ (���.)), ���. ���������, ��������� \\ ������; * (1966) ����������; �����!!; ��������!!--xls<25 ��; [* 1834] ������������!!!; * (1940) ����������!!; * (1937) �������; ������!!; ���������!!; ���������!; ����������!; * (1940) ����������; * ����� ���.�5 ����� (Pk); �������!; * (1956) ��������������; �����������!; �������!!; ����� �. �. , 1993 (��, �1, 8-12); Pk (�)

���������, �. ������, ������.

�������, �������, ������

-

���-����� \ Cap Garonne, ���� Le Pradet, 12 �� � � �� ������, ���, ������� \\ ���������� ��������� ��������� ��������� ��������� ������, ��� ������� ������������� ����� \\ ������!; ������������������*; ��������\ deloryite* (Sarp H. et al., 1992); ��������*(1995) ; ������� \ iltisite*; ���������� \ camerolaite* (1991) ; �����������* (Mason S. et al., 1992); �������� \ mahnertite *(1996) ; ����� ���.*�12 �����; ��������!; ��������* \ perroudite; ����������� \ pushcharovskite *(1997) ; ����.--148 ���. (137 ���.); �������*; ����������� mindat--122 ���� ���.; �����������!!--�; geminite (Sarp H. et al., 1990); guarinoite* (Sarp H. et al., 1993); theresemagnanite* (Sarp H. et al., 1993) \\ http://www.mindat.org/loc-1747.html

���-����� (���, �������) � �������� ��������������� ��������� � ��������� �������. ��������: � �.�. ������
���������: ������ �.�. ����� ���� ��� ����������. �., 2004. - 284 �. ��������: �������� � �������� (��������� �� �����) ��������� ��������������� ������� ��������� (�������� �� ����� �������� � ����������� ��������)

����-��� = ������� \ Kara-Oba, �-��� (Mo-W), ���. ������� (47-11`N, 71-23`E), �. ���������

���������, ��������, �������� �-��

����� ��� (����) , 15 �� � �� �� �������������, ��. ����, ������ \\ ������!! (���������!!

���������� �-���, ����, ������ \\ �������!!!; �����!! ��������!!; * ����������; ����������, Ca-���!!--��-�� �� ��������� (�); �������!; ���, 352; Pk \\

��������� �-�, ��������� �-�, ������������, ������, �������� �-��, ������

������

����������� \ Knappenwand , �����������������, ���������, ������� \\ ���������!! (��������); ������!!; ������!!! --xls< 1� \\ BG, 395; ���, 80, 197; \\ Seemann, R. (1986): Famous mineral localities: Knappenwand, Untersulzbachtal (Austria). Mineralogical Record 17(3), 167-181.

����� �� ������ �.�. ����������� "���������, ������, �������� � ��.". ���������������� ��-�. 2014.12.16. ����: �. ������

������, ������, �������� �-��, �� \\ ����� �.�., �������� �.�. �������� �������� ���������� � ��������������� ������������� ������ (������, �������� ����������) // ���������������� ��������, 2013, �. 18, �. 2, 6-65

�������, �������, ������ \ Cobalt (�������), Coleman Township, Ontario, Canada

�������� = ����-���� (Kobokobo), ����. �-��� (Be) � � �� ���������, ����, �� ����� \\ * �������; ������!!; * ����� ���.�14 �����; *������; ���������!!; *���������; ��; �, 34, 123

������ \\

��������� (Kongsberg), �������� \\ * �����������; ������!; �������!!!; �������!��������; ���, 68, 174, 176, 178, 179 \\ O. Johnsen, Mineralogical Record, 1986, 17, 19-36

����� �. , �-� ��.-���. � ���. ����� (Kondoer = Konder), ��������� ���, 75 �� � � �� ���. ������ � 100 �� � ��� �� ���. �������, ���. ���. �. ��������, ����������� ����, �� \ ���� 3D - http://www.mindat.org/photo-619937.html

�����������-���� \ Conselheiro Pena District (������������ �����) 21 �� � � �� ������-��-�����������, (�-�), �����-������, ��������

������������ �-���, ��������� ���., ����. ������, �������

���������� = ���������� (Kremikovtsi), ~ 15 �� � �� �� �����, �������� \\ ������!; �����!; �������!!; �������!!; �����!!; �������!; ������������!; ��������!! (��); ����������!!; ���������!!

��������-���, ���������

������������, ������, �������� �-��, ������ \\ ������������� ����, ������� ���� (��������), ������������ ����, ������, �������� �-��, ���������� �������, ������

������� (Kukhilal) = ����-��� = �������� = ���-�-���, ����� (��), �����������

����-�����, ������������� ��. (�) \\ ���������!!-������. ������� xls �� 18 ��; ��������!; ������!!; ������! - �����. �� ����. ��; ������!!--1-� ���. � ����; ���������!; ������������!!; *�������������!; ���������������!; ��������!; ���������!; �����������! (��); ����������!!; ��������!; ��������

������� = �������, ������ \ Laurium (= Laurion = Lavrion (���.)), Greece \\ �����������--http://www.mineral-forum.com/

--����������* - ����� ������� \\ N. V. Chukanov, I. V. Pekov, S. Mockel, A. A. Mukhanova, D. I. Belakovsky, L. A. Levitskaya & G. K. Bekenova (2010): Kamarizaite, Fe33+(AsO4)2(OH)3�3H2O, a new mineral species, arsenate analogue of tinticite. Geology of Ore Deposits 52, 599-605.
--����������* - ����� ������� \\ W. Krause, H.-J. Bernhardt, R. S. W. Braithwaite, U. Kolitsch and R. Pritchard (2006): Kapellasite, Cu3Zn(OH)6Cl2, a new mineral from Lavrion, Greece. Mineral. Mag. 70, 329-340.

--�������������* -- ���. ��-���--���� ��.�. � ��., 1953, II-2, 86

������� ����, ��������������� ������������� ���������, ���������-��������, ���. ������, ������ \ Lakargi Mt., Verkhnechegemskaya caldera (Upper Chegem caldera) ; ��������� ������� � �����������; 43�17'N ; 43�6'E \

�������������� = ���������-����� (Langesund(s)fjord), �. �������� ���������, ��������� \\ http://en.wikipedia.org/wiki/Lengenbach_Quarry

��������� (� ����� � ������), ������, ��������. 2014 �. ����: � �. ���������.

��������, �������� �-��, ������

�������, ��������, ������ \\ 59�51'13"N , 14�15'34"E

���� �-�, ������ ����., ����������

��������� ������ �����, ( = ��������� ������ ���� (Pb-Zn)(Madan ore field), �-� ���. �����, 200 �� � �� �� �����, �������� \\ �������!!--xls< 20 ��; �������������* (= �������-Mn); ����������!; ��������!; ��������!; ���������������!; �����������!; ��������!! \\ http://www.mindat.org/loc-459.html

�������-���� ����. ����� �������, ������, ��� \\ * (1978) �������� \ goudeyite; ���������!; * (1978) �������; �����������!! \\ http://www.mindat.org/loc-3924.html

�����-�������, 120 �� � � �� ���������, ���������, ��������� \ Mount Cobalt ( Mt Cobalt Mine), Selwyn District , Mt Isa - Cloncurry area , Queensland , Australia -- http://www.mindat.org/loc-138.html \\ ����: �����������!-�; ���������!--�; ����������� (6); ���������������-�� �� �������� (��-�� �� 2 �� (3); ��������������!--�; �������!!!�(10 ����);

�������. [�����-������� ���� \ Mount Cobalt Mine, Cloncurry, ���������]. ���������, ���������. �������: �� (�86120). ����: � �.�. ������

����� ������� � �������� ��������������� ��������� ���������. ��������: � �.�. ������.

�����-������ \ Mt. Malosa, ���� �����, ������, ����. ������ \\ �������!; ���������!; �������!; �����������!!--����-- www.mindat.org/gallery1; ��������!; �������!!; ����. 48 ���. (44 ����������� ����); ������!!!�xls> 20 ��; ����������!!�xl 5, 4 ��; D; L, 1999, �4, 22-32; 48 entries listed. 44 valid minerals-- www.mindat.org (2008.02.24)

���������� �-��� , ����������, ������

�������������� �-�, ���. �����, ��. ����, ������

����� = ����� (����� ��������, �� �.�. ���������, 2001) (Mogok District), ������ (= ����� (���.)

��������, ��. ����, ������

������. �����-������, ����� ��������, ������. ~9 ��. �������: "������� ��������". "�����", 2014. 12. 06. 2. ����� (� 31290) . ��������, ��. ����, ������. ������ ~ 5 ��. ������� : �� (�� �������� �.�. �������). ���� 1-2: � �.�. ������

��������� ������ = ����� (Murun), ���� �. ����� (1452 �), ���������� ��. ���� � �����, ~50 �� � ��� �� ���. �����, ����� (��), ������ (��), �� \\\\ ��������� ������ ������������� ������� --http://petrographica.ru/

--�����������* - ����� ������� --����-- Bernard J. H. and Hyrsl J. Minerals and Their Localities. - Supplement, Praha, 2013. - 100 p (����--�. 63)

������� �-� \ Musonoi mine, ~25-30 �� � � (�� ������ ������ -10 �� � �� ) �� ������� (10�41`S, 25�39`E), ������� (���. ����, �� ����� (���. ����); 10�42`S, 25�23`E \\

�����, ������, �������

�������, ����, ��������

�����������, ������� � �������� ��������������� ��������� ��������. ��������: � �.�. ������

������� �., ����. ����, ������ \\ ���� �-��� \\ ������������ �. �. ����� ���� ������� //��. ���� ������-����������. 1937. �. 1�40.

���������� �-�, ��. ������, ������

��������� � ����������� �� ���������. ���������� ������ �-�, ����. ������, ������. ����: � �.�. ������.

�`������� (N`Chwaning), �-�� (��� ���������) , � �� �� �������, �������� (Mn)-������ ����, ��� \\ ��������!!!--xls< 1 ��; �������!!--xl 1, 6 �� (�); ���������!--xls; ����������!!; ������������!--xls< 3 ��; ����������!!!--xls< 3 ��; MR, 1992, v. 23, 436; MRI

���������, ������, �������� �-��, ������

�������� \ Odikhincha, �-�, �. �����, 110 �� � ��� �� �������, ��. ������, ������ \\ ��������� (=���������)!; ��������, Ti-���. (�������!!); ��������!; �������!!--xls; �������!; �������!; ��������!!; ��, 133 \\ ������ �.�. �������������� ������������� �������-����������� ��������� �� ������� �������� --����� ������ - http://alkaline2008.narod.ru/ \\ ������ �.�., ������� �.�. ������� �� �������-����������� ��������� ������� ��������. \\ http://alkaline2008.narod.ru/Abstract.htm

�������� �-� \\ ����������� �������� �������� � �� �������������. �.: �����, 1974.- 248 �. (�.133-134)

�����,, �-� (Otomezaka = Otome mine), Makioka-cho , Yamanashi City , Kinpuzan district, ����. ������� (Yamanashi Pref.), ������ \\ : http://www.mindat.org/loc-220223.html

������ �-� \ Ojuela mine, ������, �������, �������

������� ��������, ������������ �., ��������

���������� \ Panasqueira; ����������; 40�10`N , 7�46`W;

���������� �-���, �����, ������, ������.

����������, ���. ����������, �. �������, �� \\ ��. http://karelnedra.karelia.ru/mnia/sn_karelia.htm

������� �. , �����, �������� �-��, ������; ������������ ��������� � ������� ���������� Y � Yb

��������� �.., ����, �. ����, ������

��������, ������ ����, ����� \ \ Pribram ore field, Czech Republic

�����, ����. ����, ������.

����\ Poona = Pune (����� ����), ����� \\

���-�� �������������� ������ (�����), ��. �����-���, �.-�.. ��. ����, ����, ��������� ���., ���. ����, ������ \\

����������, ������, �������� �-��, ������

���������, ���-�����

���������� �-���, �����, ������ \\ ���������!--����

������ ����, ������� \ �����

����������� �-���, ��. ����, ������

���������� �-� (Sarbayskii mine) = ���������� �-���, ���. ������, 45 �� � �� �� ��������, ���������

���-�-���� = ����-���� = ����-���� \ Sar-e-Sang = Sar-Sang (Encarta-2001), ��������, ���������� \\ * (1968) �������!!; _�������!!!_--xls<5 �� ; ��������; �-83; BG, 281; D

����-���� ������, ������, ������ \\ http://www.mindat.org/loc-123123.html

�����������, ������, �����

�������� (� �����) ������� ��������� ����������� ������ - http://www.maxknow.ru/images/upload/articles7/468.htm

������� (= ������������) �-���, ����������, �������, ������

����-���� ����, ����, \ Sweet Home Mine, Alma, ��������, ��� \\

��������� \ Xuebaoding, ����, ����� ����� \ Pingwu, �������, �����

������ �-���, ��. ������ (�)

�������� �-���, ��������, ������

��������� �-���, �. �����, ��. ���-�������, ���. ������, ������

�������� (= ������������) (Tolbachinskii) ������, � �� �� ���������� �����, ��������, ������ --�����������������* - ����� ������� � ������� ��������

--������� ��������� ���������� (����), �������� ������, ���������� ����, ������-��������� ������, ������

����������� (Traversella), ���� �����, �������, ���. ������ \\ �������!!; �������!; ��������!!�xls< 3 ��; �����!; ������!!; ������!; ���, 160, 234

���������� �-��, ���. ����, ������ \\ Ը����� �. �., ������� �. �. ������������ ������ �����. �������� � ��������� ��� ����������, �����������, �������� � ������ �������������. - ���., 1901. - �. 92.

�������, ��������

��-�� ��������, ���� Delta, ������ �����, ������� � �����, ���, ��� \ Wah Wah Mts, Millard Co. \ Beaver Co. \ Iron Co., Utah, USA \\ ������!!!--xls, ��������-�������; ��������

-- ������ ����, ��-�� ��������, ����� �����, ���, ���\ Harris Mine, Wah Wah Mountains, Beaver County \\ ������!!!--xls, ��������-�������

������ ������� � �������. ��-�� ��������\ Wah Wah Mts, ���, ���. �������� ~3 ��. (��81692, 84849. Barlow F.J., 1982. �����, 1986). ������� : ���. ����� ��. �.�. �������� ���. ����: � �.�. ������.

����������� �-�, �. �������, ��������, �������� �-��, ��

�������-III, �-��� (Fe-Mn), ���� ���. ������, ���������� �-� (�), �. ��������� \\ ��������!; ��������!; �������!; ���������; ����������; ���������!; ���������!; ����������!!; ���������!!; ��������!!; �������

���������� \ Fengjiashan, � �� �� Daye, �����, ����� \\ �����: �������!; ����������!; �����������!!(����������); **������!!!**��; ����� (� �������)--����. ��-��!!; ������!; ��������!; �������!!; ������!!*)�Ottens B., 178 - 188

--Ottens B. (2007): The Fengjiashan mine, Daye District, Ezhou Prefecture, Hubei Province, China. The Mineralogical Record, 38, 33-42.

�������� (=��������), �����.

��������, ���-������ \ (Franklin), 80 �� � �� �� ���-�����, ����� �������, ���-������, ��� \\ ���������! (� 3-1); ��������!! (� 3-1)�xls<20 ��; �����! (� 2-3); ���������! (� 2-3); �����������! (� 3-1); ������������! (� 3-1); ��������! (� 3-1); ������������! (� 3-1); *������������� (��); ��������! (� 1-1); * ����� ���.�67 ����� (������ � �-���� ��������-����); ���������! (� 3-1); ���������! (� 2-3); �������!! (� 3-2); �������! (� 3-1); * ����������!! (� 2-3)�xls< 15 ��; ����������!; ������!!! (� 2-2); BG, 19, 21; MR, 1996, 226 (���.)

���������, �-���, ��������

�������. ���������, �. ��������. ����� 18 ��. �������: ���. ����� ��.�.�. �������� ��� (��������� �.�. ���������). ����: � �.�. ������

������, �������� �-��, ������ \\ ����� ��� �� \\ ������. �����

�������� �-� \ Huanggang Mine (Huanggangliang Mine), �����. ��������, �����

�������. Huanggang Mine (Huanggangliang Mine), �����. ��������, �����. �������: �����. ����� ��. �.�. �������� ��� (�93759. ���: �.�. �����������. �� ����������� 2012 �.). ����: � �. ������.

����� \ Tsumeb � �����, ������� \\ (���- III , 587-593); ����. ����� �-��; ����. ������); ���������� ��������� ��������� ���� � ��������� ����� ����� (�.589)

����������� �-��� (Ag) , ~75 �� �� �������; �������, ���� \\ ���� ����� ������ ������������� 16 ��� 1832 �., ����� ���� � ���� �������� "���������� ���������" \\ ����������� ����������� �� ����������� ������� ������������ - http://www.geovirtual2.cl/minas/Chanarcillo/chan00entrada.htm

������, �-��� (Hg), 65 �� � �� �� ���. ��, �. �������� \\ �������!--�; �����������; ����������; �������!!--��-�� �� 1-2 �� (����� �.�., 2005, �����); * (1981) ���������--�; ��������!!--xls; ��������!; �������� ; ��������������--� ��-�� �������� (�������� �.�.(����.), �� 1982); ��������!--������� �.�., 1932(�); ��������������!; �������!!; Pk (�) \\ �-��� ������� � 1914 �.

--��������� \\ ���������� �.�., ������� �.�., ������ �.�., �������� �.�., ������ �.�. ��������� Cu6Hg3Sb4S12 - ����� ������� �� ��������-�������� ������������� ������ (������� ����) // ������� �� ����, 1981. ��� 261, �. 971-976.

������ (��������) � ��� ������ ������� ���������� � ����. ��������: �. ������.

� �

�������� ���� (= ������� ���� = ������� ����) (Scherlovaya Gora), ����. ����������, ��

�������-(Y). �������� ����., ����������, ������. ����� 8�8 ��. �������: ���. ����� ��.�.�. �������� ��� (�93857. ���: �������� �.�., 2012). ����: � �.�. ������

�����, ������, �����

��������, ����. ������, ����������� �-�, �������, ��������, �������� �-��, �� \\

��������, ������ ����, ��������, ��������

���-�� = �����, �-���, 30-35 �� � ��� �� �������, ������� (�), ���������� \\ ��������!; ����!!!; ��������; ��-1, 278-279; ���, 356

����� �., ������

������, �������.

��������� ������ \ Jubilee( = Yubileinaya) pegmatite ), ���������, ��������, �������� �-��, ������

������, ������, �������� �-��, ������

�������� �-� (W) \ Yaogangxian = Yao Guang Xiang, 40 �� � �� �� ������, ������ (�), ����� \ Yaogangxian = Yao Guang Xiang, Yizhang Co., Chenzhou Prefecture, Hunan; 25�35'N , 113�15'E \\ : http://www.mindat.org/loc-4549.html

������ (Jachymov) (= ���. �����������\ Joachimsthal), �������-������� ����, �������, ����� \\ http://www.mindat.org/loc-158151.html \\

--��������* - ����� ������� �� ������� \\ Plasil, J., Hlousek, J., Skoda, R., Novak, M., Sejkora, J., Cejka, J., Veselovsky, F., Majzlan, J. (2013): Vysokyite, U4+[AsO2(OH)2]4.4H2O, a new mineral from Jachymov, Czech Republic. Mineralogical Magazine, 77, 3055-3066.

--����������* - (mindat)

��. �����--���������� ��������������� ��������� � ��� - http://mineral.nsu.ru/educat/article/7/

������ � �������

������� ��������� �� ����� ����. ���������: ������ �.�. ����� ���� ��� ����������. �., 2004. - 284 �. \\ ������ �.�. ����� ��� ����������. ������ � ������ ���� . �., 2011. � 248 �

���. ������� (�) ���������� ��������� - ����������� - �������� �-� ���� ��. ������ ������ �� ������
���. ������� (� - ���. ������� (����������) ���. ������� (�) ������. �-��, ����������� �-� - ���. ������ - ����. ������ ���������, ��. ���� �� ������ ����������, ���� . ������ �������� - ������� ������ (������, ������
������� ������, �� ���� ����������, �������� ����� ��������. ����� �� ���� - ����� �����
�. ������� (��) - ���������� �������� ������ - ���. � ���.���. � �������. ���������� ��������� ����� ����� - ���� ���

���������� �������� �� 9 ��������� ������� ���������� ���� ����� �� ������ �� 9 ��� ������ (�����, �����, ��, �����, ������, ��, ��, ��, ��)

�������

�������� ��������� ����� - �����

����� �����

--���������� �-��� (Pb-Zn)(����������� ������ ���� (����� ������ ���������� ����� �����, ������������� �������) - ���������

���������� \\ø���* \ hoelite --�������� ���� � ���. (���. �������� �-�), ����������. ����� ������� ��� ��������� � ������� �������� ������. ������ � ����� �. ø�� (1879�1964), ����������� ������� � ��������� �������������. �� ���������� ����������, �� ����� ������� ��� ������ �������.(/www.mindat.org)\\ Oftedahl, I (1929): Minerals from the burning coal seam at Mt.Pyramide, Spitsbergen. (part II of Werenskiold, W.and Oftedal, I: A burning coal seam at Mt.Pyramide, Spitsbergen.] in Hoel, A, Editor): Det norske Videnskaps-Akademi i Oslo, Resultater av de norske statsunderstottede Spitsbergenekspeditioner (Skrifter om Svalbard og Ishavet), Vol I, No 3, 9-14 + Plate 1

��������� ���������

�������

������ � ����

--������� �. �. �������� ������. ���������, 1922. ���. 1. 214 �.

--�������� ����, �.1 "���������� ��������"/ ��� ���. �.�.�������� (�������� ���� �.�.�����������), ���.�� ���� ������-���������. 1940 �. - 328 �., ���. 3000 ���.

--������������� ��������� ������� ������ "��������� �������� ������" . ������: �������� �.�. , ������� �.�. , ��������� �.�. , ������� �.�. ������� �������� - ����� �.�. \\ ���-����������

����� ������ �� ����� �.�. ���������

��������� ������ � ���������� ����������������� ����� ��. �.�. �������� ��� (��������� 5 �� � ����� �� �������� "���������")

10 ������������� ��������� ������ (��������-����� ������ �. ������, �� ����� �������� ��������� �����. 1 �������- 9 ������ 2010 \\ 44 ��������� �� 2010.11.09. \\ 111 ���. �� 2011.03. 23. ������ ����������� ���������� �� ����� ������� ��������� ����� � �������. ����� ���� ������� ����� 200 ��������� � ������� ������ (2011.03.23)

�������� ������ �� ����� ������ (20 � �����) � ������� ���� ��� ����������

����� �������� ( ���� � ������) \\ ������ ���� ����� ���������, �������� �� ���������� ���. ���� � 1766 �� ������ �������� 2006 �. �������� 714 ����������� ( valid ) ����������� ����� � ��. Pekov I.V. New Minerals from Former Soviet Union Countries, 1998-2006 // Mineralogical Almanac, Vol. 11. Moscow, Mineralogical Almanac, 2007, 112 pp. (������ - ���. 85-88)

�������� ���������� - ���������

������������ ��������� - 2889 ; �� ��� ����������� ���� - 1796; ����� ���� - 614; ��������������� - \ localities - ; ���� �����. - 5724; ���� ���� - 85 (�� 2011.05.03) \\ ��������: http://www.mindat.org/loc-14409.html

������������ ��������� - 2067 ; �� ��� ����������� ���� - 1652; ����� ���� - 576; ��������������� - \ localities - ; ���� �����. - 3322; ���� ���� - 67 (�� 2009.01.28) \\ ��������: http://www.mindat.org/loc-14409.html

�������� ����������-���������������� ��������� ������� ������ ������ - http://www.lavrovit.narod.ru/kamni/provincia.htm

����� "����� ������������� ������������� ��������� � �����" (��������). ��������: ������� �.�. ������������� �����������. �. -�.: "������� ����������", 1937. - 240 �. ���������� � ����� - ��. ���. 235-238. ��������� ������������� �������� �� ������ - http://www.kristallemineralsrussia.com/

�������� �-� � ������� \\

������ � �������� --����� (�������)

�������� �-�_���� ���������_Bernard - ����� ��������

-- �.�. ��������, �.�. �������. �������� ����������� ����� ��������� �����������. ���. 4-�, ����. � ���. / � �������: �&�, 2010. � 64 �

�������� ��������� �-�� �� A �� Z \\ 1168 ���������; 835 �����. �����; 255 ����� �����; ���� ��������� - 22181.(1-� - �������-(Y), 101- ��������������� � �.�.) \\ ��������: http://www.mindat.org/loc-2666.html (�� 2014.06.19)

�������� ��������� �-�� �� � �� � (�� ��������� �.�. � ��., 2002 � ���.)

�������� ���������� --������

--����� ��������---264 ���� \\ ������� �.�. , ����� �.�., �������� �.�. ��������, ������� �������� � �������� �������: ������������ ����� � �������������� ������. - �����. ��������. �. 18, ���.2, 2013, �.107-123

������� \\ http://mindat.ru/locathn/r_karel.htm \

- ����� �������� � ������� ������������� ������������� ����� ������� \\ ����������

����. ������

������ \\ 3086 ���������; 1959 �����. �����; 255 ����� �����; ���� ��������� - 8561.(1-� - ���������, 101- Allochalcoselite � �.�.) \\ ��������: http://www.mindat.org/loc-14409.html (�� 2014.06.19)

��������������� ��������� ������ �� ����� �.�. ���������

����������� ����� ������

1. ������� (����) � ��������� (������). ���� � ������: �. ������.

������������� ���.

--���������� �.�., ������ �.�., ������� �.�., ��������� �.�. ������ � ������� ������� ��������� // ��� ����. 1977. ��� 232. �2, ���. 446-448

��� \\ �����. ����� ������ (�����) \\

����� \\ ���. �����--����������� \\ �����������-2009 \\ �����

�������� \\

�����������, ������ � ������

����� �����. ����� ������

���� . ���. ������, ������

����

- ���� �� ������� (�� ������� ��� ����� �� 2014 �.) : ��������, ��������...:

�� ���������� �� ����������� ����� - http://w.ilmeny.ac.ru/biblio/ \\ �������� ����� - http://ural-ozersk.ucoz.ru/

--���������� ������������� �����. �.II �.�. ���������, �.�. ��������, �.�. �������, �.�. �������� � ��. ������������: "��������� �������", 2007 �., �. 240 \\ �� ������ ����� �� ����� "���������� ������������� �����" ��������� �������� �� ������� ��������, �������� � ����������� ��������������, �����������������, ����������������, �����������, ����-��������, �����������, �������������, ����������, ���-���, ��-������������� �������������

��������� ��������������������� ����� - http://nashural.ru/mesta.htm

������� (� �� ������) ����� - ����������� \ ����� "������� �������"

�������� ����, ������ \\ ������������� ��������� - http://www.perm-kray.ru/index.htm

--���������� �. �. ���������� �������� ���� �� ����������� �������� �������������� ������������� (������ ������� ��������������� ��������������)

�������� ����, ������ \\ ���� - http://polyarny.net/foto/

����������� ���� \\ �������� �. �. ������������ �����. ������������. ������������ ������������ � ����һ. ������ 1970 \ ���-����������

1. ����� (�������� �������). ���������� ����� �-���, ����. ����, ������. 6�4,5 ��. �������: �����. ����� ����-����� (�-:2750. ���: �.�. ������� (2014. 12. 11). 2. �����. "����������" ������� � ������ ���������. 1,20 ���. ����, ������. �������: ���. ����� ��.�.�. �������� ��� [�64752]. ����: � �.�. ������

--���������� (=����������), �-���, � � �� �. ��������, �. ����������, ����. �. ��������, ����. ���� \\ ������ ��������!!; �������!; �����!!�xls � ���. � ��.; ���������!; ������!; ��������!!--xls< 1, 5��!--� \\ WS, �7, 15 \\ \\ ������� �.�. � ��. (����������� ����: �������� �������������� ���. ���������������� ��������, ��� 17, ������ 2, 2012 )\\ � �-��� ����������-3 - ���. 22-26 \\ ��. ����� : http://webmineral.ru/deposits/

�������� ���� (64�00'�58�45' �. �.)

������� ����, ������

������� ���� (58�45' � 56�00' �.�.

----������������� �����-������������ ������������� ��������� �� ������� ������ ������� ������. ������ ���� �� ���� ������� ���� ������ ��� ���������� � 1721 ����. ������ �� ����� ���� ��������� ������� ������ �������������, ������ ���� � ������� ���� ����������� � 1990 ���� (������ � ��������� ����� ��������). ����� 1990 ���� ��������� ������������� ������ ��������� �������� (����� "������������"). ������ ���� �� ������������� ���� ������ ���������� ����� ����������� �������� �������� ��������. �������� ������������� ������� � ����� ��������� �.�., �������� �.�. "�������� ������������� ���������� ������" (�����, 1983 �.), ���. 98. \\ �������� � ���������: http://www.insminerals.ru/Vysokogor.htm

--����������� ������ ����� � ��� �������� �������� ����������, ����� ������ ������������� � ��� �� ����� ����� ��� �� ��� ���������� ����� ���������� ������ �������� ����� � ��������� ��� ����� , ��� � ���� . (���������)

���������� ������������� ������������ �������: ������������ �������-���������������� ���������.
�����������: �.�. ���������, �.�. �������, �.�. ����������� � ��. ������������: "��������� �������", 2011 �., �. 44 � ������������ ���������� ��������� �������� ������������� ������������� � ������������ ������� �������������, �������-���������� � ����������. ������� �������� � ��������, ���������� �����, �������� � ������ ������, ������������� �� ������ ��������������

����� ���� (56�00' � 51�00' �. �.)

����� ����, ������ \\ �� ��������� ����� ������������ �.�., ����� �.�., ���������� �.�., �������� �.�. ��� ��������� ������ �����. �������� ����������� �������. ������������� ���������� �����. - ���������: ���-�� "�������"; 2014. - 624 �.: �1600 ��..

����� �� ������ �.�. ����������� "���������, ������, �������� � ��.". ���������������� ��-�. 2014.12.16. ����: �. ������

������ \ ������ � "������ ���� ��� ����������". - ��������������� ��������� � ������� ������� http://geo.web.ru/druza/L-AtE_Sib.htm \\

���������� � ������ (������ �.�. ���������������� �������. ������� �����. I. ������. �., 2006. � 157 �. )

����� ��������*

���. ������ \\

��. ������ \\

�����-��������� ���� (����������). ���������� ������ �-�, ����. ������, ������. ����: � �.�. ������. \\ ���-125

������

������ �������� �.

������ 591 ���������; 459 �����. �����; 50 ����� �����; ���� ��������� - 403 \ .591 entries listed. 459 valid minerals. 50 type localities (valid minerals). \\ http://www.mindat.org/loc-2644.html (�� 2012.03.13)

--����� ������. ���������������� ������� ���������� ������ �� ����� \ ����. ����� ������ - http://yakutia-map.ru/

--���������� ���� ����. ����� - http://yakutia-map.ru/map1265916_0_0.htm

�������Ҡ������ Fe(OH)2
���������� �� ������� 300 � � �������� ������������� ������������� ������ �������-���������, �.������. �������� ������-������� �������������������� ��������� �� 2 �� � �����, ������� �������� ��������� �� 2 �� � ������ ��������� � ����������� � ���������� [������ �.�., ������ �.�. �������� - ����� ������� �� ������ �������-����������. // ����, 1962, 91, 1, 72-77.].
��������: � ����� ���������� ������������� ����������, ������������� � �������� ������� � ������. �_�����_�- ������� (������.).
TS: FM 69547 ? \\ ��������: Pekov I.V. Minerals First Discovered on the Territory of the Former Soviet Union. Moscow, Ocean Pictures, 1998.- 369 pp.

1. �������. ���-��� �-���, �� ������, ������. (�73900. ������� �.�.). 2. ������������ (��-� 4,5 ��) � ��������������������� (��-� 9 ��) � �������� � ��������� ��������� � �����������. ����� �-��� ����-�������� ������ (��������� � ����� �����), �����, ������, ������. (�4961. �� ����. �.�. ���������. ���: �������� �., 1983). ������� 1-2: ���. ����� ��.�.�. �������� ���. ���� 1-2: � �.�. ������

�����, ������ \ ����������� ����, ������

�� ������

����������� ���.

(������, ���)

������� ��������, ������ \\

�������, ������ (��)

�������� \

--��������* - ����� ������� �� ������� ���������� \\ Michael Zelenski, Anna Garavelli, Daniela Pinto, Filippo Vurro, Yves Moelo, Luca Bindi, Emil Makovicky, and Elena Bonaccorsi (2009) Tazieffite, Pb20Cd2(As,Bi)22S50Cl10, a new chloro-sulfosalt from Mutnovsky volcano, Kamchatka Peninsula, Russian Federation. American Mineralogist, 94, 1312�1324.

���������� �-��

������� ������ (������) ���������� �� �������� � ���. �����. (� �������� �������) - http://wiki.fegi.ru/index.php/���� �.

�������� ���., ������ \\

--��������� �.�. �������������� ������� �������� �������. - ������������, 2009. - 232 ���. \\ ���-���������� - http://www.chitalnya.ru/work/121676/

��������, ������

�������

����������� ����, ������ \\

"�������" ("����� ���� "). ��-��������� �-���, ���������, ����������� ����, ������. ���������������� ����� ����-�����, �802. ����: � �.�. ������.

�� ������

�����, ������ \ ���������

--������������� ��������� ������������� �������� � ������������� �������������. �������� � �� - http://shakhov.igm.nsc.ru/excursion--geological.html

�������� ���� �� ������ (��)

������� (��������), ������ (���������). ������������� �-���, ����������� ���., ������. ����� 20 ��. �������: �. ���������. "�����", 2014. 12. 06. ����: � �.�. ������

������ �����

��������� ������

������ �����, �������������� �������, ������ (��), ����������� ���., ������

���������� ����

����������, ������ \\ ���� - http://www.crystallika.com.postman.ru/

����������_���������������

--�������� ������������� ���������� [�.�. �������]

--������������ �-��� (Sb) ������������� ������������� ��������� �������� \\ ��������� - http://www.chita.ru/wikismi/p16663/

���������� �� ����������. ������������ �-��� (Sb), ������������ �-�, ����������, ������. ����� 8 ��. �������: �. ��������� . "�����", 2014. 12. 06. ����: � �.�. ������

��������� ���. \\

����������� ���. � ������ �����

������������ ���� \\ ����������� ������� - http://nature.krasn.ru/content.ph

����������� \\

����� � ��������� \\

����

��������

���������

������ \\

--���. ������_���������������� ����������� (� ����������� �������� �� � �� �) -- ������_������� ��������� \\ ������ _���������_5 �� \\ ������_��������� _10 �� \\

���������������_���������������� ������� ����� ���������

������ (��) \\

��������

����������� \\

�������� \\

��������� \\

--����, �-��� (Cr) ������������� �� ���. ������ ������������ ������ (���������). ���������. ������� � �������� ���������-���������������� �������, ���������� �� �������� ��������� � ������� � �������� �����.

������

--Ruoutevare, Kvikkjokk, ���������, ������--����������������e-2N2S (TL); �������

Ruoutevare (���������, ������) � �������� ��������������� ��������� (� ��������� �������) � �-�� ������������ ������. ��������: �. ������.

������. �-��, ����������� �-�

�������

����� (��-�� �� 6 ��). �������. ���� ����� 30 ��. �������: "������� ��������". "�����", 2014. 12. 06 . ����: � �.�. ������

--- Sierra Albarrana, Hornachuelos, Cordoba \ �������, ���������; 38�6'0"N;5�27'39"W \\ ���������!! -��-� 6�4�4 ��-,\\ http://www.mindat.org/loc-125864.html \\ Anthony, J. W. et al. (1997): Handbook of Mineralogy, Vol. 3, 76 \\ �������� ! - Calvo B., Gonzalez del Tanago Chanrai J., Gonzalez del Tanago y del Rio J., (1991), "Los minerales y la mineria de la Sierra Albarrana y su entorno", ENRESA. Madrid, 203 pp \\ www.mindat.org/

����� �� ������ �.�. ����������� "���������, ������, �������� � ��.". ���������������� ��-�. 2014.12.16. ����: �. ������

����������

� � �. � � � � � �

������� \\

����� \\

�������� ���� � �����������. �� ��������� ����� Gramaccioli C. M. Minerali Alpini e Prealpini. Vol.1-2. Bergamo, 1975. - 473 p. \\ �������: ���. (11) - 71-...

�����_����. ������� (Monti Aju, �����������) - ���������-�������� - ����������� -���������� (���������) - ��������? - ������� (������) - ����� (���������,�.141 [������?] ) - ���������� - �������� (2-�����������) - ���������� �� ��������� - ������� - ��������� - ������ (�������) - ������ (3, �����) - �������! - ������ (��-��)- �������� - ����������� - �������� - ��������� - ����������� - ��������

����� � ������ ��������������� ��������� ����. ���� � ����������� ���������� (� ��������� �������) . ��������: �. ������. 2014.12.22

���������. �������\ Oetzthal, ������, �������. �������: �� (�49799. �������� ������������, 1950). ����: � �.�. ������

-- ����, ����������, ��������, ������ \ Gorb, Lercheltini (Larcheltini), Binntal, Wallis (Valais), ��������� \\ ���������*

���� ���� (� ������ �����). ���� ���., ������, ���������. ����: �.���������, 2014.

������� , �������� \\ �����-����������, ��������

���������� �-��

������� \\

�������� \\ ��������� - 428; ���. ����� - 353; ���. ����� - 8; ���� ��������� - 556 (�� 2011.11.01) \\ ��������: http://www.mindat.org/loc-14255.html

�������

--�������������* - ����� ������� - Nagy-Lapafo hill, Paradsasvar (Uveghuta), Matra Mtns, Heves Co., Hungary \\ http://www.mindat.org/loc-69177.html \\

--���������, ������� \ Nagyborzsony, Hungary \\ �����������*(Paar W.H. et al., 2006); ���������* (1853); sztrokaite *(1983)

�������� \\ ���� ��������� \\ http://www.mindat.org/rloc.php?loc=Germany \\ http://www.mindat.org/loc-14244.html)

�������� �������� (�������) - ���� �� ��������� ����� Bode R. , Wittern A. Mineralien und Fundstellen Bundesrepublik Deutschland. 1989. - 303 p. \\ ���.7, 107, 157- 287 \\ ����; ��������; �������; ����������; ����; ������; ������; �����; ������; �������; �������; ���� (2); �������; ���������; ��������; �������; ���������� (4)(Herdorf � ��.) ; �����; �������; ��������; ������ (2); ������� (Niederofleiden); ��������;

--�����������* - ����� ������� \\ U. Kolitsch, H.-J. Bernhardt, W. Krause et al. (2008): Pattersonite, PbFe3(PO4)2(OH)4[(H2O)0.5(OH)0.5]2, a new supergene phosphate mineral: description and crystal structure. European J. Mineralogy 20, 281-288; Jahn, S. (2008): Pattersonit - ein neues Mineral von der Grube Vereinigung bei Eisenbach. Mineralien-Welt 19 (4), 26-29 (in German).

����������������. Kohnstein Quarry, Niedersachswerfen, Nordhausen, ����, ��������, ��������. 12�8 ��. �������: ���. ����� ��.�.�. �������� ���. ����: � �. ���������. \\ 33_5--��--��

������ \\ � ������ \\ \\ 2291 ��������� \ entries listed. 1340 ����������� ����� \valid minerals. 266 ����� ����� \ type localities (valid minerals). 5 type localities (others).(�� 2011.07.30)

--����� "�������" \ "fenster" \\ Porretta Terme, �������--����

����. ����������, ����. ����������, �������, ������. �������: �. �������. "�����", 2014. 12. 06 . ����: � �.�. ������

--���������* - ����� ������� �� �-�� �������� \ Trentini, ����. �������, ������ \\ Bindi, L., Nestola, F., Kolitsch, U., Guastoni, A. & Zorzi, F. (2011): Fassinaite, Pb2+2(S2O3)(CO3), the first mineral with coexisting thiosulphate and carbonate groups: description and crystal structure. Mineralogical Magazine, 75, 2721-2732. \\ Fassina, B., Rocchetti, I. & Boscardin, M. (2012): Fassinaite, una nuova specie minerale dal Vicentino. Rivista Mineralogica Italiana, 2/2012, 92-98.

--����� \\ ������� \\

�������, ���. ������ \\

���� �`��� � ������ ��������������� ��������� �������� � ����������� ���������� � ��������� �������. ��������: � �.�. ������
���������: ������ �.�. ����� ���� ��� ����������. �., 2004. - 284 �. ��������: �������� � �������� (��������� �� �����) ��������� ��������������� ������� ��������� (�������� �� ����� �������� � ����������� ��������). ����� ������������� ������ ��� ��������������� �����.

�������

�������

���������

������ \\

�������

�������

����� \\

��������� \\

--������������� �������� (����� �. ����������): ����� (���������� � "�������"); ������� (�������), ������; ��������; ������; ������; ��������; ��������

--������� �-�, ����������, ���������\ Fianel, Ausserferrera, Val Ferrera, Hinterrheintal, Graubunden \\ Brugger, J., Krivovichev, S., Meisser, N., Ansermet, S. & Armbruster, T. (2006): Scheuchzerite, Na(Mn,Mg)9[VSi9O28(OH)](OH)3 , a new single-chain silicate. American Mineralogist 91, 937-943.

���� �� ��������� [�� �����] � ����������� ������ �� ������ 2400 �. ����: � �.���������, 2014.

�� ������ - �� ����. ����, ���������. ������ ��������� � ����������������� ������. ����: � �. ���������, 2014..

�������� ����������� ������ � ������ ������ ����.����: � �. ���������, 2014..

����. ������ \\

���������� \\

������� \

-- ��������������� ��������� ������� �� � �� �

�������� ���������� (2011)-- http://uazakon.ru/ \\ http://uazakon.ru-2 � �.�.

���������� ��� - ������������� ��������� - Google Maps

������ � �� �������

�������

��������� \\ ����������� \\ ����������

��������

�������

����

��������� � ������� ���� ��������� � ������� ����_�-�_��������������� ��������� (�� �����)

���������

--������� �-��� "(��� �������� ����� ��� ��� ��������� �������) ����������� � ������������� ������ ������������ ������� ���������� �������� ������� ������ - http://www.insminerals.ru/Galer_Mayk.htm \\ ��������� "��������� ����������. ��� I. ������������� � ���������� ����������� � ��������������� ����������", �������, 1999 �., ���. 60**. �**

������. ����������� �-���, ���. ���������. ��������-������� "��� �����" �����-���������. 2014. 12. 11. ����: � �.�. ������.

_--_�������� \\ C��������., �������., �����������. ����������� �������� �� �������� �������� ������������ ��������� (����������� ����������// ��. �������. ����� �� ���� ��. �.�. ��������. � 1982. � ��30. � �.�147�154.

������� ���� \\

�������� \\

1. ���������. ������, ��������. �������: ���. ����� ��.�.�. �������� ��� (�80668. ���������� �.�.). 2. ��������� � ��������������, ��������� � ���������. ���������, �. ��������. ����� 15�10 ��. �������: ���������������� ����� ����-�����, �543. ����: � �.�. ������.

����������� \\

��������. ������� ������� �������������� ���������������� ������������ ����������. ������� �-���, 25 �� � � �� �. �����, �����������. ����� 15 ��. ���: �������� �.�,, 2014.05. ����: �. ������.

�����

��������� ������ �����, ���. �����������: �������� (Adrasman) --�����-������--������ --����������� �� -- �����-������--

��������� \\

���������� \\ �������� \\

������ ����������� �����. ���. ��. �.�. �������� ��� � ����. ���� � ������ 1998 - 2014 ��. ����� �� ������� �.�. ������� � ��. 2014.12. 18.

���������� - http://www.mindat.org/

��������

������, �� ��� \

����������� \\ ������� \\ ������ \\

������� \\ ���� \\

���� \\

--�����-����� (= ��������� = ��������) \ Zareh Shuran �-��� (As), ~35 �� � � �� �. �����, ����; 36�43`N, 47�8`E \\ �������; �����������!!--xls<3 ��; ���������*; ��������; �������; ���������!--Bariand P. et al., 1968�; �������� \\ �� "��������" 9�338-1973 \\ ��

. ����������� (�����������!). �����-����� (=��������) ����. �-�, ��. �. �����, ����. �����������, ����. ~5 ��. �������: �����. ����� �����(�-516. ������ �., 2009)

�����-����� (����) � ��������������� ��������� ���������� (�������).

��� \\ �����, ���������� �-��

������ \\ �������� � ��������������� --��. http://www.mineralienatlas.de/

�����, �����, ���-�����

����� � ������ �������. ������ (������), �����. ����� �� ������ �.�. ����������� "���������, ������, �������� � ��.". ���������������� ��-�. 2014.12.16. ����: �. ������

����� - http://www.mindat.org/loc-16773.html

������. ���-�����. �������: �. �������. "�����", 2014. 12. 06. ����: � �.�. ������

�����

����. ���� ( ����� � ��.)

����� \ China \\ www.mindat.org

--Ottens B**.** China: Mineralien, Fundstellen, Lagerstatten. Christian Weise Verlag. 2008, 552 pp.

�����. �������� \\

--������ ������ \ Suolun massif, Horqin Right Front Banner (Ke'erqin Youyi Qianqi), Hinggan League \\ ��������!*

������ ����. \\

������� \\

������-��������� ���������� �����

������� \\

��������-��������� ���������� �����; �����

���������. �������� \ Kuruktag, ��������-��������� ���������� �����; �����. ��������� �� 3 ��. �������: �. �������. "�����", 2014. 12. 06 ����: � �.�. ������

--��������������* - ��������

�������, ����� \\

����� \\ �������, ��������� \\ ������� , ����� \\ �����

������, ���������, ����� - http://www.mindat.org/loc-705.html

������ ����.

������ \\

������� \ Yunnan \\ www.mindat.org

--Dayakou ���������� �-�, Malipo Co., Wenshan, Yunnan \\ �������!-- ����--��-�� � ������ � �������� - Ottens B**.**, 2008, 51 \\ ���� www.mindat.org

�������_����� � ��������

��������

������� \\

��������� - ��. http://www.mineralienatlas.de/

�������� \\ ���� \\

������ (���. �����) \\

������� \\ ��������� \\

������. �������� ��������. ������ (�������, �. �����, ���������). ����� �� ������ �.�. ����������� "������". ���������������� ��-�. ���. ����� ��. �.�. �������� ���.. 2014.12. 02.

�� ����

������ \\ http://www.petrovrareminerals.com/articles02.html \\ http://www.mindat.org/loc-14488.htm

--������� ( = �������) \ Adachiite*--����� ������� �� ������ ��������� - ����� �-�, ���� �., ������ \\ Nishio-Hamane, D., Minakawa, T., Yamaura, J., Oyama, T., Ohnishi, M., Shimobayashi, N. (2014): Adachiite, a Si-poor member of the tourmaline supergroup from the Kiura mine, Oita Prefecture, Japan. Journal of Mineralogical and Petrological Sciences, 109, 74-78.\\ http://www.mindat.org/min-43780.html

��������� �-��

������

����� \\ ������ \\ ������ \\ ���� \\

�������

������. [������� (����)], ���� �-�, ���� \ [Bendoukou (Benduko)], Kayes Region. ����� 30 ��. �������: "������� ��������". "�����", 2014. 12. 07. ����: � �.�. ������

������� \\ �������

����������

--�����--����������� ��������� (��� ��������� 5 ��)--Tagant, Erg Aouker (Aoukar)--���� - http://www.baritespecimenlocalities.org/Africa.htm

���. � ���. ������

������ \\

-- South Cassinga, Lubango City Council, Huila Province, Angola \\ �������--����--mdt; ��������!!--����--mdt

�����

������ \ Zambia (����) = ���. ������� (���.), ������ \--�������!!!--����

�������. ����� �-�. \ Kagem mine, Kafubu, ������. ����� �� ������ �.�. ����������� "������ �������". ���������������� ��-�. ���. ����� ��. �.�. �������� ���.. 2014.11. 18. ����: �. ������.

�������� \\

������, ���������� � �������� ��������������� ��������� (�������� � ��.). ��������: �. ������. 2014.12.30

����� ��

����� �� (���. ����) \\ Buttgenbach H. Mineraux de Belgique et du Congo Belge. Liege, 1947, 590 p.

������� \\

� Namibia I � by Ludi von Bezing, Rainer Bode, Steffen Jahn�(2014)

���

--��������* - ����� ������� \\ Yang, H., Downs, R.T., Evans, S., Pinch, W. (2013): Scottyite, the natural analogue of synthetic BaCu2Si2O7, a new mineral from the Wessels mine, Kalahari Manganese Fields, South Africa. American Mineralogist, 98, 478�484.

--Cairncross, B. (2004) Field Guide To Rocks & Minerals Of Southern Africa:

�������� � �������� ��������������� ��������� ����� ������. ��������: �. ������. 2014.12.30

����. ������ \\ ������� \\ �����

���������� \\ 516 ��������� � ��������������, 323 ����������� �����, 12 ����� ����� \\ 516 entries listed. 323 valid minerals. 12 type localities (valid minerals) �� 2012.10.13 .\\ http://www.mindat.org/loc-2247.html \\ ��������!!; �������!!; ������������ \ schiavinatoite*

������� (= ������� = ������) � ������ � ������������� �������. ����������. ����� �� ������ �.�. ����������� "������". ���������������� ��-�. ���. ����� ��. �.�. �������� ���.. 2014.12. 02.

������ \\

������ \\ �������� - http://www.mindat.org/loc-21896.html \\ ��������������� - http://www.mindat.org/rloc.php?loc=Rwanda

������

�������� \\ http://www.mindat.org/loc-4384.html \\ �-�-��� - http://www.mindat.org/rloc

--������-����, ������, ������ ������, �������� \ Mautia Hill, Kongwa, Kongwa District, Dodoma Region, Tanzania \\ �������*!--�; ����������������*; ���������--�; \\ http://www.mindat.org/loc-3247.html

1. ���������. ��������-�����, ����� ������, ��������. �������: �. �������. "�����", 2014. 12. 06 . ����: � �.�. ������. 2. ����� � �����������. �-� �. ������������, ��������. ����� �� ������ �.�. ����������� "������". ���������������� ��-�. ���. ����� ��. �.�. �������� ���.. 2014.12. 02.

������

�������

��������� \ �������������� ��������

�������� \\ �������� ��������� \\

��������� \\

--Day, B. and Beyer, B., 1995, Some mines of the Mt Isa district, Queensland; the Mt Cobalt mine. Australian Journal of Mineralogy 1(2): 17-23

����� ����� ����� \\

�������� ���������� \\ ��������

����� ��������� \\

�����-����� (Burra Burra), ������� � �������� ��������������� ��������� �� �� ��������� � ��������� �������. ��������: �. ������ \\ ���

--����������* - ����� �������--Angaston, South Australia \\ Mills, S. J., Groat, L. A., Wilson, S. A., Birch, W. D., Whitfield, P. S. & Raudsepp, M. (2008): Angastonite, CaMgAl2(PO4)2(OH) 4�7H2O, a new phosphate mineral from Angaston, South Australia, Mineralogical Magazine. 72 (5): 1011�1020

����� ��������

� � � � � � � � � � � � � �

� � � � � � � � � � � � � � � � �

�������� �������

������ \\ Trail R. J. Catalogue of Canadian Minerals. Revised 1980. Geol. Surv. of Canada Paper 80-18, 1983, 483 p.

��� \\ http://www.mineralienatlas.de/lexikon/index.php/USA

American Mineral Treasures [��������� ��������� �������]. 2008. - 380 p. \\ ���������: http://www.lithographie.org/bookshop/hc_american_mineral_treasures.htm

��������������� ����������� ( ���������� � ���������������� �� ������) \\ http://www.minsocam.org/

���. ������� (�)

������ \\ �������

������-�������� ���������� \ North-West Territories, ������

����

���-���-����� � ����� ����, ����

���������� \\

��������������� ��������� �. ����� � ����������� ���������� (���������� � ��������� �����). ��������: �. ������, 2014.12.30

���. ������� (�)

���. ������� (�)_������� ������� ���������� (10 �� � �����)

�����

�����. ������, ����� �����, �����, ��� \ Linwood Mine, Buffalo, Scott Co., Iowa. �������: �. �������. "�����", 2014. 12. 06. ����: � �.�. ������ \\ ��--���-125

������� \\ �������� \\ ��������� \\ �������� \\ ��������

�������, ��� \\ http://www.mindat.org/loc-16287.html \\ ����� 100 ���� ��������� �� ��������� ����� (�������, ��������!!; ��������!; �������! � ��.) www.mindat.org/gallery

������ \\ ��������

����������� \\

���������. South street, Carlisle, Middlesex, �����������, ���. �������: ���. ����� ��.�.�. �������� ��� (�93571. ���: Wall Suzan, 2011). ����: � �.�. ������ \\ ���-125

��������� \\ ������� \\ ������� \\ ��� \\

�����-����� \ Mount Mica, ~2 �� � �� �� ����� \ Paris, ����� �������, ���, ��� \\ *��������\ kosnarite (1993)--xls<0,9 ��; *����������� \ mccrillisite (Foord E.E. et al., 1994); �������!!��������; BG, 10

����� (Newry), ����� �������, ���, ��� \\ ����� ����� �������, ���, ��� \\ ����������!!; ����������!!; �������!; �������!!

����� ���������, ������ \\ ���-�������, ��� \\

���-������, ��� - http://www.mindat.org \\

���-���� \\

�������\ Ontario, ������ \\

--������ ���� (�-�), �������, ������--�������; �������; �����������������; ��������*; ��������; \\ Petruk, W., Harris, D.C., and Stewart, J.M. (1969) Langisite, a new mineral, and the rare minerals cobalt pentlandite, siegenite, parkerite, and bravoite from the Langis mine, Cobalt-Gowganda area, Ontario, Canada. Canadian Mineralogist: 9: 597-605.

������������, ��� - http://www.mindat.org/loc-14026.html \\

���. �������� \\

�������� \\ �������

���. ������� (�)

������, ��� \\

��������, ������ \\

�������, ��� \\ ��������� �������

��������, ��� \\ ��������, ���

��������, \\ http://www.mindat.org/rloc

--Gypsum Valley District, San Miguel Co., �������� \\ ��������*; �������!(�); ��������*; ���������*! \\ ��������: http://www.mindat.org/

������� \\ ������ ��������--����� \\ Gobla, M.J. (2012) Montana mineral locality index. Rocks & Minerals, 87, #3, 208-240.

������ \\ ���-�������, ��� \\

Blanchard Mine, Bingham, Hansonburg District, Socorro Co., New Mexico, USA ; 33�48'42"N; 106�22'30"W \\ �������!!!

�����, ��� \\

����� ������, ��� \\

--������-����� ���� (Sn) - � ���������� \ Nickel Plate mine, Keystone, ����-�����, ����� ����������, �. ������; 43�53'1"N;103�24'45"W ; ~3-4 �� �� ���� ������, ��� � ������� ������� ���������� �������� - ������������ �������� ������� ����������� ��� \\ ��������-(KFe)* - ����� �������; ����������! --�� (�) \\ http://www.mindat.org/loc-4118.html

������-����� ���� (Sn) � �������� ��������������� ��������� � ����-����� (�. ������, ���). ��������: �. ������.

���, ��� \\

������ ����������, Repete Mine � �������� ��������������� ��������� ������ ��� (� ��������� �������) - . ��������: �. ������.

--�������� - ����� ������� �� ��� (���) \\ Chukanov, N.V., Pushcharovsky, D.Yu., Pasero, M., Merlino, S., Barinova, A.V., Mockel, S., Pekov, I.V., Zadov, A.E., Dubinchuk, V.T. (2004): Larisaite, Na(H3O)(UO2)3(SeO3)2O2.4H2O, a new uranyl selenite mineral from Repete mine, San Juan County, Utah, U.S.A. European Journal of Mineralogy, 16, 367-374.

--��������* - ����� ������� \\ Cooper, M.A., Hawthorne, F.C., Roberts, A.C., Foord, E.E., Erd, R.C., Evans, H.T., Jr., and Jensen, M.C. (2004) Nevadaite, (Cu 2+,?,Al,V 3+)6[Al8(PO4)8F8](OH)2(H2O)22, a new phosphate mineral species from the Gold Quarry mine, Carlin, Eureka County, Nevada: Description and crystal structure. Canadian Mineralogist: 42(3): 741-752.

--���������* - ����� ������� \\ Kasatkin, A.V., Plasil, J., Marty, J., Belakovskiy, D.I., Lykova, I.S. (2014): Nestolaite, CaSeO3�H2O, a new mineral from the Little Eva mine, Grand County, Utah, USA. Mineralogical Magazine, 78, 497-505.

-- Blue Cap mine \\ ���������������*; �������*; ������*

--Kampf, A.R. & I.M. Steele (2008): Martyite, a new mineral sppecies related to volborthite: description and crystal structure. Canadian Mineralogist 46, 687-692.

--Kampf, A. R., Mills, S. J., Merlino, S., Pasero, M., McDonald, A. M., Wray, W. B., & Hindman, J. R. (2012). Whelanite, Cu2Ca6 [Si6O17 (OH)](CO3)(OH) 3 (H2O)

--Kampf, A. R., Hughes, J. M., Marty, J. and Nash, B. (2012), Postite, IMA 2011-060, Canadian Mineralogist: 50(1): 45-53.

Bawana Mine (Old Hickory mine), Rocky Distr., ���, ��� \\ ���������--�; Stringhamite (TL); Whelanite (TL)

������ ���� � �������� ��������������� ��������� ������ ��� (� ��������� �������). ��������: �. ������.

���. ������� (����������)

���������� ��������, ������ - http://www.mindat.org/loc-14311.html

���������, ��� \\

������

���� "�����". ������, ��� . ��������-������� "��� �����" �����-���������. 2014. 12. 07. ����: � �.�. ������

����������, ��� \\ http://www.mindat.org/loc-3424.html \\ ���� \\ ����������_�������� �� ������� \\

--�������--xl 25�3 ��--����� ����, ����������--Gui-72, 110

--���� ������� \ Otto Mountain--13 ���. ��������� (agaite*; bairdite*; ottoite; thorneite*; timroseite* � ��)

���� ������� � �������� ��������������� ��������� ���������� (���). ��������: �. ������.

��������� �-�� \ Hawaii, ����� �����; ��� \\

�������

������� - 9 ��������� \\ �������_������� ��������� \\ �������_������� ���������_5 �

--�������� �������� - ��. ���-����-������--�������, 2008, 285

--��������!! -1) La Paz, Sierra del Fraile, San Luis Potosi, Mexico--���� - www.mindat.org/ 2) Luz Mine, La Paz, Mun. de Villa de La Paz, San Luis Potosi, Mexico--������ ������� (�� 10 ��) ���������� - ���� - www.mindat.org/

�������. ������ �-�, �������, �������. "�����", 2014. 12. 06. ����: � �.�. ������

����������� �������

����

����� �������

�. ������� (��)

��������� \\ ������ \ Guyana \\ �������� \\

���������. \\

������� \\

���� \\

�������� (�������� �������� "�������"). ������� \ Arequipa, ����. ����� 8 ��.. ��������-������� "��� �����" �����-���������. 2014. 12. 07. ����: � �.�. ������. \\ 33_29

������������� � ���������� �� ������������. ������ �-�, ��������������, �����������, ����. ~10 ��. �������: �� (�93546. �������� �.�., ������ �.�., ��������� �.�., ����������� �.�., 2011). ����: � �.�. ������.

--�����--�������� �������� - -Flor de Peru I claim (Tentadora Mine), Mt Ullpac (Mt Ollupac), Pampa Blanca, Castrovirreyna District, Castrovirreyna Province, Huancavelica Department, Peru

--������ �-�, �������������� ����., ����������� ���., ����--�������������*; ���������!!; �����������!!; �����������!--�; ��������!!--xls<3,5 ��-� \\ http://www.mindat.org/loc

���� \\

--Bojar, H.-P., Walter, F. (2013): Joanneumite, Cu(C3N3O3H2)2(NH3)2, a new mineral species with ammine and isocyanurate group. Poster, MinPet 2013, September 19-23; abstract in Mitt. Osterr. Mineral. Ges. 159 (in press) [http://erdwissenschaften.uni-graz.at/aktuelles/veranstaltungen/minpet2013/downloads/ThirdCircular2013_Final.pdf]

�������� \\ �������� -787 ; ����������� ���� - 601 \ 620; ����� ���� - 51 \ 53; ��������������� \ localities - 843 \ 1008 ; ���� �����. � 5430 \ 6613; ���� ���� � 74 \ 115 (�� 2009.08.05 \ 2010.05.06) \\ ��������: http://www.mindat.org/loc-366.html \\ http://www.mindat.org/rloc.php?loc=Brazi

�������� �������� � ������������ (�� ��������� ����� Cornejo C., Bartorelli. A. Minerals & Precious Stones of Brazil. - Sao Paulo, 2010. - 704 p.\\ �������--�. 15-25-35. \\ (2) -���-�� ����������..

--���� (3); ��������� (2); ����� (727 ���.), ������� (2); ������; ������; �����������*; ������; ����; ������������; ������ ��������; ������;

--������. �����; ������ (5) - xls; ������� ; ���������; ���������; ����� --"�������"; ������; �������; ������; ������������ (="��������� = ""heitorite") ; ��������� (2)

--����; ���������(2); ���������; �������������-(Y)*; �������; ��������; ������ (�������); ��������; ���� ����������� (Piaui); ����������; �������; �������� (2); �����; �������!!--xls<3 ��; ���������� (�����.);

--��������(Mn\ Fe); �������; ����� (3); �������; ����������� ; �������; ������; ������; ������� (5)--�� �.�. ����������� �� ���.

����� �� ������ �.�. ����������� "������ �������". ���������������� ��-�. ���. ����� ��. �.�. �������� ���.. 2014.11. 18. ����: �. ������.

����, ��������

����������\ Almeidaite--����� �������---��-�� �� 3 ��--�-��� �� �������, Novo Horizonte \\ Luiz A.D. Menezes Filho, L.A.D., Chukanov, N.V., Rastsvetaeva, R.K., Aksenov, S.M., Pekov, I.V., Chaves, M.L.S.C., Scholz, R., Atencio, D., Branda?o, P.R.G., Romano, A.W., de Oliveira, L.C.A., Ardisson, J.D., Krambrock, K., Moreira, R.L., Guimara?es, F.S., Persiano, A.C. and Richards, R.P. (2013) Almeidaite, IMA 2013-020. CNMNC Newsletter No. 16, 2013, page 2705; Mineralogical Magazine, 77, 2695-2709.

--�������� �-��� , ����, �������� \\ �� \\ Sinkankas, 384-385 \\ (1989�)

�����-������

--Morteani, G., Preinfalk, C., and Horn, A.H. (2000): Classification and mineralization potential of the pegmatites of the Eastern Brazilian Pegmatite Province. Mineralium Deposita 35, 638-655.

--�������������� \ Correianevesite\ Chukanov, N.V., Scholz, R., Zubkova, N.V., Pekov, I.V., Belakovskiy, D.I., Van, K.V., Lagoeiro, L., Graca, L.M., Krambrock, K., de Oliveira, L.C.A., Menezes Filho, L.A.D., Sa Carneiro Chaves, M.L., Pushcharovsky, D.Y. (2014): Correianevesite, Fe2+Mn2+2(PO4)2�3H2O, a new reddingite-group mineral from the Cigana mine, Conselheiro Pena, Minas Gerais, Brazil. American Mineralogist, 99, 811-816

--����������� - ����� ������� \\ D. Atencio, et al (2007): Ruifrancoite, a new Fe3+-dominant monoclinic member of the roscherite group from Galileia, Minas Gerais, Brazil. Canadian Mineralogist, 45, 1263-1273.

--����������* - ����� ������� \\ Atencio, D., Coutinho, J. M.V., Graeser, S., Matioli, P. A., Menezes Filho, L. A. D. (2004): Lindbergite, a new manganese oxalate dihydrate from Boca Rica mine, Galileia, Minas Gerais, Brazil, and Parsettens, Oberhalbstein, Switzerland. Am. Mineral., 89, 1087-1091.

--THE PEDERNEIRA TOURMALINE MINE IN BRASIL JUNE 2010 - ����������

���������. �������� �-� \ Cruzeiro Mine, �����-������, ��������. ����� �� ������ �.�. ����������� "��������� ��������� ����������". ���������������� ��-�. ���. ����� ��. �.�. �������� ���.. 2014.12. 09.

--������ �-� \ Cigana mine-�������������� = �������������� \ Correianevesite* - ����� �������--������� �., 2014

������ �-� \ Cigana mine, ��������� � �������� ��������������� ��������� (�����-������, ��������). ��������: �. ������

������� \\ ����� (Piaui), ��., �������� (��) \\ ����������� ���� (D)

���-������-��-�����, �������� \\

���-������-��-���, �������� \\

����������� ����� � ������������� - ��������������� ���������� �� ��������. ���-������-��-���, ��������. ����� �� ������ �.�. ����������� "����� � ���� �������� ���������". ���������������� ��-�. ���. ����� ��. �.�. �������� ���. 2014.10. 21. ����: �. ������.

-- ����

���-�����

�������� \\ �������

���������� \\

����� ��������. ���������� � ��.\\ ������ ������������ (������)

������ ���������� (����������� ����������)_���������������� �������

����� ����� \\

����� ������ �., �������, ����� �����; ��������� \ ����� - ����� ������ \\ ������ �� �������� ������ ����� (����� ����������)

����� ��������� -- �������� � ���. ����������

��������� �-�� \ Hawaii, ����� �����; ��� \\

�����, ����� �����

����� ���������

���� ���

���������������� ������� ������ ����� - "���� ��� \ �� ����� ������ �����". 2014.11.25 - 2014.12.31. ����� ������� ������������ ���� �� ������� ������ �� ����� ���� (��.): 1-��� ����� ������� ������ - � ����� �1 ("��������"), 2-��� - � ����� �2 � ��� �� 31-��� ����� - � ����� �31 ("����������") \\ �. ������

���������������� ������� ������ ����� ("���� ���". ������-������� 2014 �.) . ��������: �. ������.

������� ��������� �� ������ ����� ����: 1234567 891011121314151617181920212223242526272829303132 - 33

��������� �����������-32 - �� ������ �������� �� �������

�.�. ������. ���������������� ������� ������ ����� ����� 40-�� ���������. - ���������������� ��������, �.13, 2008, �. 76-85.
\\ ������� ������� ������ \\ ������ ����� ������ \\ ����������� \\

--��������� ���� �����������_���������� � ���������������� ����� ��. �.�. �������� ��� \\ �����

--��������- �������� �� ���������� (��������-������������)

--������ "������ �����" - http://www.vokrugsveta.ru/

--�������� ��������� ��� _�������������� ������

�������� \

5 ������������� ������� \ ������ - ���� - ������ - ��������� - ���. ������� - ���. ������� (�������: �� ������ ������� �� ��������, �����, ��������, ��������� � ����������� ����� ������� �������). ��������� �������

������ ������� �������� � ����, ������� �������

"�������" ��������� �� ������� � �������� (10-15 ��������� �������) \\ 1-� -� 2007 �.

�� 2 �������� �� ���������� �� 2 ������ (��������-�����)

������ ������� ��������� (�������� ������� ���� ���������, ���������� �� ����� ����)

��������� ���� �����������_�������� � ���������������� ����� ��. �.�. �������� ���

--������ �.�. �������������� �������� �������������� ��������������� ���������. \\ ����� ������ � ���������. �.: �����, 2003. ���. 38, �. 113-124.

--�.�. ������. ���������������� ������� ������ ����� ����� 40-�� ��������� �. �.

������

������� (�� ���������� �� �����������) \ ���������������� �������

���� \\ ����������� - http://luna-mineralogiya.ru/index.html

����� \ \ � � � | � - � | A - Z ****�����������| | �.�. **�������� || �.�. ������� || �.�. ���������� || �.�. ������� || �.�. �������� | ������ �. \ Guillemin C.| | �.�. ��������� || �.�. ������ | �.�. �������� ****|| �.�. ������� || �.�. ������� | ������������ �.�. || �.�. �������� | �.�. �����** || �.�. ������� || �.�.������ || ****�.�. ����� || �.�. ��������� || �.�. ����������� | | �.�. ����� | �.�. ���������� | |** ****�.�. �������� | �.�. ������� | �.�. �������** ****|| �.�. �������� || �.�. ������� || �.�. �����** � ������

�� ����������: - - - - - Ũ - - - - - - - - - - - - - - - - - - �� - �� - - AZ \\ A - B - C - D - E - F - G - H - I - J - K - L - M - N - O - P - Q - R - S - T - U - V - W - X - Y - Z

�������� �.�. �����������. � �.: ��������������� ������������ ������������� ����������, 1950. � 956 c. \\ ���-����������

������� �.�. �������� �������� ���������� � M.: ������, 1982. � 669 c. \\ ���-����������

������� �.�. . ����������� �� ������ \\ http://lib.rus.ec/b/284737/read#r10 (���-����������)

���� � ������: �. ������.

��� ����� � �����

������������� ���������� ������ - http://lavrovit.ru/?page_id=271

��������� �.�. �������������� ������� �������� ������ ������ ��������������� ������ --������� ������ - http://russmin.narod.ru/dictionary.htm

l��������� ����������� � �������������� -��. The Mineralogical Record Biographical Archive - http://www.minrec.org/labelarchive.asp

��������� ������ �������

1. �.�. ���������. �������. �������� �-�� (2012). 2. ����� ������. �������, ���. ���� (2013). ���� 1-2: �. ������

1. �.�. ��������. 2. �.�. ��������� � �.�. �������. ����� �� ������� �.�. ������� � ��. 2014.12. 18.

������� �������� �������� (1907.12.23 (29?) - 1991), ������������� ��������� � �������, ���������� � ������� ������� �����������, ���. ���. ����������� ���, �������� ����������������� ����� ��. �.�. �������� �� ����. � ��� ����� ������ ������� ��������������� (������� ��� ������ ������������).

�.�. �������� - ��������� ��� (1930), � 1931 - ��������� �����. �1937-1941 ���������� � ���������� ��������� ������� �������� � ������ (������). �������� ������� ������������� �����, ����� �������� ������� �������������, � 1943 ������� ������������ ����������� �� ����������� ���������� ���. ������ ���� (1947), � 1952-1976 - �������� ����������������� ����� �� ����, � 1953-1986 - ���. �������� ����������� ���, � 1960-1964 - ����-��������� ������������� ���������������� ����������. ����� �� ����������� ������ ���������. ��������: http://srcc.msu.su/uni-persona/vernadsky/1936.htm

����� �� ������� �.�. ������� � ��. 2014.12. 18. (����: �. ������)

���������� ������� ����� �����. ���. ��. �.�. �������� ��� � ��������� �������� �� �� �� ������ ������� �����-���. ����� �� ������� �.�. ������� � ��. 2014.12. 18.

������� ��������� � ������ �-��� �������. ���������, 2014.\\ ��--�� --��

����������-�������� � ������ ��� (�����), ������ �������� ������� ���������. ������, ��������.. ����: �. ���������, 2014.

������� \ � ��� ����

�. �. ��������� - ��������� ���������� ����������������� ����� (������������). ���. ����� ����-�����. 2014.12. 05. ����: �. ������. ���. ����� ����-�����. 2014.12. 05. ����: �. ������.

���������� ������������ �� ������ �� ����� "����� � ����" (�����)

�� ������ ������. 2014. 12. 31. ����: � �.�. ������.

� ��� ���...

1914 �. - ������� �-��� ������, (�. ��������)

1977 �.

1. �.�. �������� � �.�. ��������� ������������� �������. 2. �.�. �������� � ������� ��������. �������� ���, ������, �� ������. 1977. ���� 1-2: �. ������

�.�. �������� - ���� 1980-� � 1944 �. �������. �������� ���, ������, �� ������. �������: ���. ����� ��.�.�. �������� ��� (���� �.�. ��������� 1977 �.. ST6726). �������� � 90- ����� �� ��� �������� �.�. ���������. ����: � �.�. ������.

2013 � . - ������� �� ����� ����� ������������� ���������� ���������.

�������� � ��������� �� ������. ����������� �-��� (Au), � �� �� �. �����, �. ����, ������. �������� ����� 6 ��. �������: ���. ����� ��.�.�. �������� ��� (�94327. ���: �.�. ������������, 2014). ����: � �.�. ������

"�����" - 2014.12.06-07

���������� (�����), �������� (�����), ���� (������) � ��. �������: �. �������. "�����", 2014. 12. 06. ����: � �.�. ������

�. ���������� � ������� ��������� (����� �-���, �. ���������). "�����", 2014. 12. 06. ����: � �.�. ������

������������ � ���������� �����. �������: �. ��������. "�����", 2014. 12. 06 ����: � �.�. ������

���������� ������ � ������������� �������. "�����", 2014. 12. 06 ����: � �.�. ������

���������-������� ����� ������� (�����), ���� ������� � �������� ���������. "�����", 2014. 12. 07. ����: � �.�. ������

������������ ��������. "�����", 2014. 12. 07. ����: � �.�. ������

������ ������, ������� ����� � ������ �����. "�����", 2014. 12. 07. ����: � �.�. ������

������ �������, ������� ������� � ������ �������. "�����", 2014. 12. 07. ����: � �.�. ������

2014.12. 09.

����� �.�. ������ ������ "���������� ������� ���������� ���� (������ ��������� ���������)" �����. ���. ��. �.�. �������� ���. 2014.12. 09. ����: �. ������ . \\ ���-125

2014. 12. 11-14.

��������-������� "��� �����" 11-14 ������� 2014 �. , �������� (�������� �8), �����-���������. ����: � �.�. ������

�.�. ������� (������) ���������� ���� ����� ������������ "������� ����� � ������������� ��������", � ����� ������� "����-���" �� ���������� �� ������� � ���������������� ����� ����-�����. ��������-������� "��� �����" �����-���������. 2014. 12. 07. ����: � �.�. ������.

������ ������� ���������� � ����� ������������� �.�. �������� "������� ����� � ������������� ��������. ��������-������� "��� �����" �����-���������. 2014. 12. 07. ����: � �.�. ������.

�. ������� (�����), �. ������� � �. ��������. � ����� �� ��������-������� "��� �����" �����-���������. 2014. 12. 07. ����: � �.�. ������

2014.12.18 -

18 ������� � ���������������� ����� ��. �.�.�������� ��� ��������� ���� ������������ - ��������, ����������� ��������� �������� ���������� - �����. ����� ��.�.�. �������� ���_2014.12.18_���� ������������

� ���������

1. �.�. ������ ������������ � ������ ����� � ������� ����. 2. ��������. �����-������-�����. 2-� ������� � ����. ��������� ������������ �����. ���. ��. �.�. �������� ���. ����� �� ������� �.�. ������� � ��. 2014.12. 18.

����� �� ������� �. �. ������������. 2014.12. 18

����������� � ��������� �����. ���. ��. �.�. �������� ��� �� 2014 �. ����� �� ������� �. �. ������������. 2014.12. 18

�����. ���. ��. �.�. �������� ���. 2014.12. 18. ����: �. ������

�.�. ��������, �. ����������� � �. ������� (�� ������). �����. ���. ��. �.�. �������� ���. 2014.12. 18. ����: �. �������

�. ������� (�����) � �. ������. �����. ���. ��. �.�. �������� ���. 2014.12. 18. ����: �. �������

�. �������� (������) � �.�. �������. �����. ���. ��. �.�. �������� ���. 2014.12. 18. ����: �. ������ .

��� �������� �������� ������ �� ������� ������ � ������ (���� ����). �����. ���. ��. �.�. �������� ���. 2014.12. 18. ����: �. �������

������ ������. �����. ���. ��. �.�. �������� ���. 2014.12. 18. ����: �. �������

�. �������� (�����). �����. ���. ��. �.�. �������� ���. 2014.12. 18. ����: �. �������

���� �� ������� �������. �����. ���. ��. �.�. �������� ���. 2014.12. 18. ����: �. �������

�. ���������� (�����) � �. �����. �����. ���. ��. �.�. �������� ���. 2014.12. 18. ����: �. �������

���������������� �����������

2 ������� . �.�. ����������. ������ (�����, ������ � ��.) \\ 2014.12.02. ���������������� ����������� \\ ������� ���-����������

�� ������ �.�. ����������� "������". ���������������� ��-�. ���. ����� ��. �.�. �������� ���.. 2014.12. 02. ����: �. ������.

�.�. ����������� ����� ������ "������". ���������������� ��-�. ���. ����� ��. �.�. �������� ���.. 2014.12. 02. ����: �. ������.

23 ������� 2014 �. - ������� �.�. ��� ����� ��������?

���� ������ �����������

4 �������, �������, 17 �. �������� ������ (�������) ���������� ����� "��� ��� �� �����" (�� ������� �������� �����) . ������� � ���. ����� ��. �.�. �������� ��� (��������� ��., 18 ���.2. ���. 8 (495) 954-39-00

4 ������� 2014 �. � ����� ������ ����������� ��������� �������� ���������� ������ ��������������� ������ "��� ��� �� �����" (�� ������� �������� �����). ���� ������: �������� ������ � ������� ����������.

�������� ������ ������������ ����� "��� ��� �� �����". ���� ������ �����������. ���. ���. ��. �.�. �������� ���. 2014.12. 04.

�������� ������ ������������ ����� "��� ��� �� �����". ���� ������ �����������. ���. ���. ��. �.�. �������� ���. 2014.12. 04.

1. ������ ���������� � �������. 1920-�� ��. 2. �.�. �������� ������������ � ����� � ������� � 1930-� ��. ����� �� ������ "��� ��� �� �����". \\ XX-�.

����� �� ������ "��� ��� �� �����"

1. ����������� ������� ����������. 2. � ����������� ������� �������������� ������� (2014 �.). ����� �� ������ "��� ��� �� �����"

�������� ������ (� ������) � ��. �����. ���. ��. �.�. �������� ���. 2014.12. 04. ����: �.�. �����.

�� ������� ����ߔ

\\ �. ��������� \\\ �. �������� \\ �.�. ����� \\ �.�. ������ \\ �.�. ������� \\ �.�. �������� \\ �.�. ��������� \\ �.-�. ø�� \\ �.�. �������� \\ \\ �.C. ������ \\ �. ��������� \\ �. ������� \\ �.�. ����� \\ ���� \\ ����� \\ ������ \\ ������ \\ ������ \\ ���� \\ ����� \\

������ �� ����-��������

� ��������� �������, ��� �������: �� ������� ������ �� ����� �������, ����������� ���� ��������. �������� ������� �� ��������, �� �������� ��������� ���� ����. ���-�� ������: "� ������� ��� ��� ���� ���. ������� ����� ���. �����, ���� �������� ������". � � ������ ���: ������� �� ����������� � �� �������. �� ������� � ������. �� ����� ����, �� ����� ����������� ����� ��������� ���������� ������. ��������� ���� �������. �������� ��������, � ��� ��������� �������.

���

-- ���� �� � ����-�� ��������, -- ������� ����. -- ���� � ������, ������� �������� �������, �� ��������� ��������. ������ ���� �� ������������ � ����� ���� � �� ������ � �����������, �������� ���������� ���� ����. ���� ������������. ��������� ������ �� ������������. ���� ������ ������ �� ����� �� �����, ����� ���. �� ����� ��� ����� �� ����� � ������ �����, ������� ������ ������ � �������. � � ���� ����� ���������� � ������?

���
�� ��� � ����� �������� ����� ����� �������? ��� �� ��������� ���� ����� ����� ������ ����� ������� ����� ������� � ��������� ����� ����������� � ���? ����������� � ��������? ���, �� �����, � ��������, �������. ������� �� ����� ��������� ���������, �� �������� ������ ����� ������ ������.

���

� ������ �� ����� ���� ������ "����", ���� �� ������������� ������ � ���������, ���� �� ������� ���� � ���� �� ������, ���� ��-��� ��� � ���� �� �������� �����, ���� ����� �� ������� �� ��� ���� � ����.

�������� \\ http://www.lib.ru/EKZUPERY/citadel.txt

����

������� ����� ����������� �������������� ������������� 1975 �. ( ���� �� ���������� �����, ���������� ����� ��������). �������� ������ ������ ������������ (������, ������� �����), ������ ����� (����, ������� �. ��������), ��� ��� ������ ���� ����� (������, ������� �. �����).. �� ������� ���� �. �����, �. ��������, �. ����� � ������������� �������. \\ XX � -��

28 ������� - ������������� ���� ����. � ���� ���� � 1895 �. � ������ ��������� ������ ��������� ���������.

"����� �������������� ����� �� ������ �������� � ������ �����?" . ����-����� ����� ��������, ����������� � ��. ��������: �.�. �������, �.�. ��������, �.�. �����������, �.�. �������, �.�. ���������, �.�. ��������, �.�. ��������, �.�. �������, �.�. ���������, �.�. ���������, �.�. ���������, �.�. ����������, �.�. ������, �. �������, �. ����������, �.�. ��������, �.�. ���������, �.�. �������, �.�. ��������, �.�. ���������, �.�. �������, �.�. �������, �.�. �����, �. ���������, �.�. ����������, �. ��������, �.�. ����������, �.�. ����������, �.�. ��������, �. ������, �.�. ��������, �.�. ��������, �. ������ � ��.

���������� ������

���. ������� (�) ���������� ��������� - ����������� - �������� �-� ���� ��. ������ ������ �� ������
���. ������� (� - ���. ������� (����������) ���. ������� (�) ������. �-��, ����������� �-� - ���. ������ - ����. ������ ���������, ��. ���� �� ������ ����������, ���� . ������ �������� - ������� ������ (������, ������
������� ������, �� ���� ����������, �������� ����� ��������. ����� �� ���� - ����� �����
�. ������� (��) - ���������� �������� ������ - ���. � ���.���. � �������. ���������� ��������� ����� ����� - ���� ���
����� ���? - �� - ���?-1 - ���?- ��- ���? �����? ����������--�--W ����� ��� ����� ****�� = �� - � ������� �����**
���� **������� - �-��������� �������� ����� ���� ����� �� �����- 2015 ����� | ���������� ����������: 2015. 02. 08

� ��������� ������, 2003 - 2015. � ����: ����������� �������, 2015