Mineral Species sorted by the element Pb Lead (original) (raw)
Lead (Pb) Element Properties
Atomic Mass | 207.2 |
---|---|
Atomic Number | 82 |
Name Origins | Anglo-Saxon, lead; Latin plumbum. |
Year Discovered | Prehistoric. |
Discovery Credits | Known to ancient civilizations. |
Remarks | Soft, weak, ductile, dull gray metal. Tarnishes in moist air but stable to oxygen and water, dissolves in nitric acid. Used in batteries, cables, paints, glass, solder, petrol, radiation shielding, etc.Diagnostic tests: With soda (Na2CO3) on charcoal a malleable globule of metallic lead is obtained from lead compounds, the coating has a yellow color near the assay, the sulfide gives also a white coating (PbSO3) further away. Mixed with potassium iodide and heated on a plaster tablet, lead iodide forms a chrome-yellow sublimate. In solution, lead, along with mercury (Hg1+) and silver form white, insoluble chlorides from aqueous solutions. The pale green flame test for Lead is not very decisive. |
References | Emsley, J., 1991; THE ELEMENTS : Sec. Ed., Clarendon Press, Oxford, 251 p. |
See Also | WebElements,ChemiCool |
Naturally Occurring Isotopes
Symbol | Isotope Mass | Isotope Nuclide Number | Isotope Number | Natural Abundance | Half-life | Half-life Units | Decay Mode | Decay Mode MeV | Decay Mode % |
---|---|---|---|---|---|---|---|---|---|
Pb | 203.97302 | 204 | 82 | 1.4000% | Stable | ||||
Pb | 205.97444 | 206 | 82 | 24.1000% | Stable | ||||
Pb | 206.975872 | 207 | 82 | 22.1000% | Stable | ||||
Pb | 207.976627 | 208 | 82 | 52.4000% | Stable | ||||
Pb | 209.984163 | 210 | 82 | Trace | 22.3 | Years | beta - gamma | 0.063 0.061 | 81.0% 19.0% |
Pb | 213.999798 | 214 | 82 | Trace | 26.8 | Hours | beta - gamma | 1.032 0.73 | 48.0% 42.0% |
Mineral Species containing the element Pb (Lead )
Click Here for Mineral Species Sorted By %Pb
Mineral Name | Chemical Formula | Pb | MW |
---|---|---|---|
Abramovite ! | Pb2SnInBiS7 | 37.30% Pb | 1,066.44 |
Agardite-(Nd) ! | (Pb,Nd,Y,La,Ca)Cu6(AsO4)3(OH)6•3(H2O) | 5.85% Pb | 1,063.17 |
Aikinite | PbCuBiS3 | 35.98% Pb | 575.92 |
Alamosite | PbSiO3 | 73.14% Pb | 283.28 |
Aleksite | PbBi2Te2S2(?) | 21.94% Pb | 944.49 |
Allochalcoselite ! | Cu+Cu++5PbO2(SeO3)2Cl5 | 20.91% Pb | 1,060.48 |
Altaite | PbTe | 61.89% Pb | 334.80 |
Andorite | PbAgSb3S6 | 23.74% Pb | 872.71 |
Angelaite ! | Cu2AgPbBiS4 | 26.58% Pb | 779.40 |
Anglesite | PbSO4 | 68.32% Pb | 303.26 |
Anyuiite | Au(Pb,Sb)2 | 54.66% Pb | 568.64 |
Arapovite ! | (U,Th)(Ca,Na)2(K1-x[ ]x)Si8O20•H2O, x=0.5 | 0.69% Pb | 897.66 |
Aravaipaite | Pb3AlF9•(H2O) | 74.21% Pb | 837.58 |
Arcubisite | Ag6CuBiS4 | 1.96% Pb | 1,058.03 |
Ardaite | Pb19Sb13S35Cl7 | 57.14% Pb | 6,890.03 |
Arrojadite-(BaFe) ! | (Ba,K,Pb)Na3(Ca,Sr)(Fe++,Mg,Mn)14Al(PO4)11(PO3OH)(OH,F)2 | 9.24% Pb | 2,242.07 |
Arrojadite-(PbFe) ! | PbFe++Na2Ca(Fe++,Mn,Mg)13Al(PO4)11(PO3OH)(OH,F)2 | 9.24% Pb | 2,242.59 |
Arrojadite-(SrFe) ! | SrFe++Na2Ca(Fe++,Mn,Mg)13Al(PO4)11(PO3OH)(OH,F)2 | 0.30% Pb | 2,063.97 |
Arsenbrackebuschite | Pb2(Fe++,Zn)(AsO4)2•(H2O) | 53.92% Pb | 768.49 |
Arsendescloizite | PbZn(AsO4)(OH) | 48.35% Pb | 428.52 |
Arseniopleite | (Ca,Na)(Na,Pb)Mn++(Mn++,Mg,Fe++)2(AsO4)3 | 2.81% Pb | 737.72 |
Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) | 56.77% Pb | 729.94 |
Artroeite | PbAlF3(OH)2 | 63.72% Pb | 325.19 |
Arzrunite | Cu4Pb2SO4(OH)4Cl6•2(H2O) | 38.32% Pb | 1,081.42 |
Aschamalmite | Pb6Bi2S9 | 63.76% Pb | 1,949.75 |
Ashburtonite | HPb4Cu++4Si4O12(HCO3)4(OH)4Cl | 47.75% Pb | 1,735.88 |
Asisite | Pb12(SiO4)O8Cl4 | 87.78% Pb | 1,652.35 |
Asselbornite | (Pb,Ba)(UO2)6(BiO)4(AsO4)2(OH)12•3(H2O) | 4.93% Pb | 3,237.04 |
Babkinite ! | Pb2Bi2(S,Se)3 | 42.48% Pb | 975.45 |
Barstowite | Pb4(CO3)Cl6•(H2O) | 74.03% Pb | 1,119.54 |
Bartelkeite | PbFe++Ge3O8 | 34.03% Pb | 608.87 |
Barysilite | Pb8Mn(Si2O7)3 | 74.77% Pb | 2,217.04 |
Baumhauerite | Pb3As4S9 | 51.38% Pb | 1,209.88 |
Baumhauerite-2a ! | Pb3As4S9 | 51.38% Pb | 1,209.88 |
Bayldonite | (Cu,Zn)3Pb(AsO3OH)2(OH)2 | 28.37% Pb | 730.28 |
Beaverite | PbCu++(Fe+++,Al)2(SO4)2(OH)6 | 31.29% Pb | 662.18 |
Benauite ! | HSrFe+++3(PO4)2(OH)6 | 3.44% Pb | 603.13 |
Benavidesite | Pb4(Mn,Fe)Sb6S14 | 40.17% Pb | 2,063.39 |
Benjaminite | (Ag,Cu)3(Bi,Pb)7S12 | 19.41% Pb | 2,134.46 |
Bernalite | Fe(OH)3 | 3.83% Pb | 108.14 |
Berryite | Cu3Ag2Pb3Bi7S16 | 20.89% Pb | 3,015.01 |
Betekhtinite | Cu10(Fe,Pb)S6 | 6.73% Pb | 923.52 |
Beudantite | PbFe+++3(AsO4)(SO4)(OH)6 | 29.11% Pb | 711.77 |
Beyerite | (Ca,Pb)Bi2(CO3)2O2 | 7.95% Pb | 651.84 |
Bezsmertnovite | Au4Cu(Te,Pb) | 6.20% Pb | 1,002.89 |
Bideauxite | Pb2AgCl3(F,OH)2 | 62.26% Pb | 665.63 |
Bilibinskite | Au3Cu2PbTe2 | 17.55% Pb | 1,180.39 |
Bindheimite | Pb2Sb2O6(O,OH) | 53.81% Pb | 770.15 |
Bismutoplagionite * | 5PbS.4Bi2S3 | 36.54% Pb | 2,835.00 |
Bismutopyrochlore ! | (Bi,U,Ca,Pb)1+x(Nb,Ta)2O6(OH)•n(H2O) | 3.68% Pb | 562.81 |
Blixite | Pb8O5(OH)2Cl4 | 86.28% Pb | 1,873.18 |
Bogdanovite | (Au,Te,Pb)3(Cu,Fe) | 34.96% Pb | 592.69 |
Boleite | KPb26Ag9Cu24Cl62(OH)48 | 49.26% Pb | 10,936.64 |
Borishanskiite | Pd1+x(As,Pb)2,x=0-0.2 | 31.11% Pb | 333.04 |
Boulangerite | Pb5Sb4S11 | 54.88% Pb | 1,887.90 |
Bournonite | PbCuSbS3 | 42.40% Pb | 488.69 |
Brackebuschite | Pb2(Mn,Fe++)(VO4)2(OH) | 55.24% Pb | 712.70 |
Brendelite ! | (Bi,Pb)2Fe(PO4)(O,OH)3 | 24.54% Pb | 616.49 |
Britvinite ! | Pb7+xMg4.5[(Si,Al)5O14](BO3)(BO3,AsO4)(CO3)(OH,O)7(x<0.5) | 66.62% Pb | 4,587.29 |
Brumadoite ! | Cu3(TeO4)(OH)4•5H2O | 1.55% Pb | 535.15 |
Buckhornite | AuPb2BiTe2S3 | 35.37% Pb | 1,171.74 |
Burckhardtite | Pb2(Fe+++,Mn+++)Te++++(AlSi3O10)O2(OH)2•(H2O) | 44.33% Pb | 934.87 |
Bursaite ? | Pb5Bi4S11 | 44.72% Pb | 2,177.65 |
Bushmakinite ! | Pb2Al(PO4)(VO4)(OH) | 62.67% Pb | 667.89 |
Calcioaravaipaite ! | PbCa2Al(F,OH)9 | 42.87% Pb | 483.33 |
Calciouranoite | (Ca,Ba,Pb)U2O7•5(H2O) | 3.10% Pb | 667.92 |
Calderonite ! | Pb2Fe+++(VO4)2(OH) | 58.22% Pb | 711.73 |
Caledonite | Pb5Cu2(CO3)(SO4)3(OH)6 | 64.21% Pb | 1,613.34 |
Cannizzarite | Pb4Bi6S13 | 33.16% Pb | 2,499.54 |
Caracolite | Na3Pb2(SO4)3Cl | 51.35% Pb | 807.01 |
Carminite | PbFe+++2(AsO4)2(OH)2 | 34.32% Pb | 639.87 |
Caryinite | (Na,Pb)(Ca,Na)(Ca,Mn++)(Mn++,Mg)2(AsO4)3 | 12.16% Pb | 681.37 |
Cassedanneite | Pb5(VO4)2(CrO4)2•(H2O) | 68.34% Pb | 1,515.88 |
Cechite | Pb(Fe++,Mn)(VO4)(OH) | 52.52% Pb | 394.54 |
Cerussite | PbCO3 | 77.54% Pb | 267.21 |
Cesarolite | PbH2Mn++++3O8 | 41.27% Pb | 502.03 |
Cesplumtantite | (Cs,Na,Ca)2(Pb,Sb+++,Sn)3Ta8O24 | 18.38% Pb | 2,479.94 |
Chabourneite | (Tl,Pb)21(Sb,As)91S147 | 7.98% Pb | 18,184.75 |
Challacolloite ! | KPb2Cl5 | 65.69% Pb | 630.83 |
Changbaiite | PbNb2O6 | 42.37% Pb | 489.01 |
Chekhovichite | (Bi,Pb,Fe)2Te4O11 | 11.53% Pb | 1,078.24 |
Chenite | Pb4Cu(SO4)2(OH)6 | 69.85% Pb | 1,186.52 |
Cheremnykhite | Zn3Pb3Te++++O6(VO4)2 | 48.90% Pb | 1,271.24 |
Chervetite | Pb2V2O7 | 65.96% Pb | 628.28 |
Chloroxiphite | Pb3CuCl2(OH)2O2 | 75.61% Pb | 822.06 |
Choloalite | CuPb(Te++++O3)2 | 32.38% Pb | 639.96 |
Chubutite * | Pb7O6Cl2 | 89.68% Pb | 1,617.30 |
Clarkeite | (Na,Ca,Pb)(UO2)O(OH)•0-1(H2O) | 6.50% Pb | 318.75 |
Clausthalite | PbSe | 72.41% Pb | 286.16 |
Cleusonite ! | Pb(U++++,U++++++)(Ti,Fe++,Fe+++)20(O,OH)38 | 8.86% Pb | 2,080.74 |
Clinomimetite | Pb5(AsO4)3Cl | 69.61% Pb | 1,488.21 |
Cobalttsumcorite ! | Pb(Co,Fe)2(AsO4)2(OH,H2O)2 | 30.69% Pb | 607.66 |
Coiraite ! | (Pb,Sn)12.5As3Sn5FeS28 | 54.57% Pb | 4,256.03 |
Corkite | PbFe+++3(PO4)(SO4)(OH)6 | 31.03% Pb | 667.82 |
Coronadite | Pb(Mn++++,Mn++)8O16 | 24.41% Pb | 933.55 |
Cosalite | Pb2Bi2S5 | 41.75% Pb | 992.69 |
Cotunnite | PbCl2 | 74.50% Pb | 278.11 |
Creaseyite | Pb2Cu2(Fe+++,Al)2Si5O17•6(H2O) | 35.53% Pb | 1,166.48 |
Crerarite | (Pt,Pb)Bi3(S,Se)4-x(x~0.7) | 5.40% Pb | 959.01 |
Crichtonite | (Sr,La,Ce,Y)(Ti,Fe+++,Mn)21O38 | 1.17% Pb | 1,772.61 |
Crocoite | PbCrO4 | 64.11% Pb | 323.19 |
Cumengite | Cu20Pb21Cl42(OH)40•6H2O | 55.08% Pb | 7,899.52 |
Cupromakovickyite ! | Cu4AgPb2Bi9S18 | 9.48% Pb | 6,445.41 |
Cupropavonite | AgPbCu2Bi5S10 | 11.46% Pb | 1,807.72 |
Curienite | Pb(UO2)2V2O8•5(H2O) | 19.42% Pb | 1,067.21 |
Curite | Pb3+x(H2O)2[(UO2)4+x(OH)3-x]2,x~0.5 | 24.12% Pb | 3,006.49 |
Cylindrite | Pb3Sn4FeSb2S14 | 33.70% Pb | 1,844.71 |
Dadsonite | Pb21Sb23S55Cl | 48.61% Pb | 8,950.53 |
Damaraite | Pb3O2(OH)Cl | 88.04% Pb | 706.06 |
Demesmaekerite | Pb2Cu5(UO2)2(SeO3)6(OH)6•2(H2O) | 19.08% Pb | 2,172.01 |
Descloizite | PbZn(VO4)(OH) | 51.22% Pb | 404.54 |
Dessauite ! | (Sr,Pb)(Y,U)(Ti,Fe+++)20O38 | 2.79% Pb | 1,856.57 |
Dewindtite | Pb3[H(UO2)3O2(PO4)2]2•12(H2O) | 21.41% Pb | 2,903.85 |
Diaboleite | Pb2CuCl2(OH)4 | 67.18% Pb | 616.88 |
Diaphorite | Pb2Ag3Sb3S8 | 30.48% Pb | 1,359.78 |
Dickinsonite-(KMnNa) ! | KNaMnNa3Ca(Mn,Fe,Mg)13Al(PO4)11(PO4)(OH,F)2 | 0.10% Pb | 2,117.87 |
Drugmanite | Pb2(Fe+++,Al)H(PO4)2(OH)2 | 60.23% Pb | 688.00 |
Dufrenoysite | Pb2As2S5 | 57.19% Pb | 724.57 |
Duftite-alpha | PbCu(AsO4)(OH) | 48.56% Pb | 426.67 |
Duftite-beta ? | PbCu(AsO4)(OH) | 48.56% Pb | 426.67 |
Dugganite | Pb3Zn3Te(As,V,Si)2(O,OH)14 | 47.73% Pb | 1,302.29 |
Duhamelite ? | Pb2Cu4Bi(VO4)4(OH)3•8(H2O) | 27.04% Pb | 1,532.47 |
Dumontite | Pb2(UO2)3O2(PO4)2•5(H2O) | 26.97% Pb | 1,536.50 |
Dundasite | PbAl2(CO3)2(OH)4•(H2O) | 44.35% Pb | 467.23 |
Dzhezkazganite * | (Pb,Cu,Rh)S2(?) | 57.08% Pb | 217.81 |
Ecdemite | Pb6As+++2O7Cl4 | 75.49% Pb | 1,646.85 |
Eclarite | Pb9(Cu,Fe)Bi12S28 | 34.99% Pb | 5,330.11 |
Edenharterite | TlPbAs3S6 | 23.21% Pb | 892.88 |
Elyite | Pb4Cu(SO4)O2(OH)4•(H2O) | 74.91% Pb | 1,106.45 |
Embreyite | Pb5(CrO4)2(PO4)2•(H2O) | 70.19% Pb | 1,475.95 |
Emilite ! | Cu2.68Pb2.68Bi5.32S12 | 25.08% Pb | 2,230.52 |
Epidote-(Pb) ! | (Ca,Pb,Sr)2(Al,Fe+++)3(SiO4)(Si2O7)O(OH) | 17.76% Pb | 583.18 |
Eskimoite | Ag7Pb10Bi15S36 | 29.12% Pb | 7,116.16 |
Esperite | PbCa3Zn4(SiO4)4 | 21.64% Pb | 957.33 |
Eylettersite | (Th,Pb)1-xAl3(PO4,SiO4)2(OH)6(?) | 4.31% Pb | 481.10 |
Eztlite | Pb2Fe+++6(Te++++O3)3(Te++++++O6)(OH)10•8(H2O) | 22.84% Pb | 1,814.07 |
Fairbankite | PbTe++++O3 | 54.13% Pb | 382.80 |
Falkmanite | Pb5Sb4S11 | 55.09% Pb | 1,842.83 |
Feinglosite ! | Pb2(Zn,Fe)[(As,S)O4]2•(H2O) | 55.12% Pb | 751.83 |
Felbertalite ! | Cu2Pb6Bi8S19 | 29.93% Pb | 3,599.51 |
Ferrazite ? | (Pb,Ba)3(PO4)2•8(H2O)(?) | 51.61% Pb | 903.26 |
Ferrilotharmeyerite | Ca(Zn,Cu++)(Fe+++,Zn)(AsO4)2(OH,H2O)2 | 4.22% Pb | 490.79 |
Ferrisurite | (Pb,Cu)2-3(CO3)1.5-2(OH,F)0.5-1[(Fe,Al)2Si4O10(OH)2]•n(H2O) | 38.50% Pb | 914.93 |
Fettelite ! | [Ag6As2S7][Ag10HgAs2S8] | 0.15% Pb | 2,720.84 |
Fiedlerite | Pb3Cl4F(OH)2 | 76.14% Pb | 816.42 |
Finnemanite | Pb5(As+++O3)3Cl | 71.93% Pb | 1,440.21 |
Fizelyite | Pb14Ag5Sb21S48(?) | 38.49% Pb | 7,536.06 |
Fleischerite | Pb3Ge(SO4)2(OH)6•3(H2O) | 61.76% Pb | 1,006.40 |
Fornacite | Pb2Cu(CrO4)(AsO4)(OH) | 55.26% Pb | 749.87 |
Fourmarierite | Pb(UO2)4O3(OH)4•4(H2O) | 14.04% Pb | 1,475.40 |
Francevillite | (Ba,Pb)(UO2)2V2O8•5(H2O) | 5.29% Pb | 978.77 |
Franckeite | (Pb,Sn)6Fe++Sn2Sb2S14 | 48.81% Pb | 1,995.14 |
Freedite | Pb8Cu+(As+++O3)2O3Cl5 | 75.61% Pb | 2,192.25 |
Freieslebenite | AgPbSbS3 | 38.87% Pb | 533.02 |
Friedrichite | Pb5Cu5Bi7S18 | 30.53% Pb | 3,393.78 |
Fuloppite | Pb3Sb8S15 | 29.93% Pb | 2,076.59 |
Furutobeite | (Cu,Ag)6PbS4 | 27.23% Pb | 761.06 |
Gabrielsonite | PbFe++(AsO4)(OH) | 49.45% Pb | 418.97 |
Galena | PbS | 86.60% Pb | 239.27 |
Galenobismutite | PbBi2S4 | 27.50% Pb | 753.42 |
Gallobeudantite ! | PbGa3[(AsO4),(SO4)]2(OH)6 | 28.83% Pb | 718.80 |
Ganomalite | Pb9Ca5Mn++Si9O33 | 64.28% Pb | 2,900.88 |
Gartrellite | Pb(Cu,Fe++)2(AsO4,SO4)2(CO3,H2O)0.7 | 33.39% Pb | 620.46 |
Gebhardite | Pb8(As+++2O5)2OCl6 | 70.66% Pb | 2,346.00 |
Geocronite | Pb14(Sb,As)6S23 | 67.12% Pb | 4,321.99 |
Georgiadesite | Pb4(AsO3)Cl4(OH) | 75.38% Pb | 1,099.47 |
Giessenite | Pb13(Cu,Ag)(Bi,Sb)9S28(?) | 49.34% Pb | 5,459.67 |
Girdite | Pb3H2(Te++++O3)(Te++++++O6) | 60.77% Pb | 1,022.81 |
Gladite | PbCuBi5S9 | 12.92% Pb | 1,604.24 |
Gramaccioliite-(Y) ! | (Pb,Sr)(Y,Mn)Fe2(Ti,Fe)18O38 | 6.94% Pb | 1,822.46 |
Grandreefite | Pb2SO4F2 | 75.56% Pb | 548.46 |
Gratonite | Pb9As4S15 | 70.49% Pb | 2,645.48 |
Grayite | (Th,Pb,Ca)PO4•(H2O) | 19.52% Pb | 318.38 |
Guettardite | Pb(Sb,As)2S4 | 38.60% Pb | 536.82 |
Gustavite | PbAgBi3S6(?) | 18.27% Pb | 1,134.41 |
Gysinite-(Nd) | Pb(Nd,La)(CO3)2(OH)•(H2O) | 41.02% Pb | 505.15 |
Hallimondite | Pb2(UO2)(AsO4)2 | 43.07% Pb | 962.27 |
Hammarite | Pb2Cu2Bi4S9(?) | 24.87% Pb | 1,666.01 |
Hatchite | (Pb,Tl)2AgAs2S5 | 37.40% Pb | 831.03 |
Hedyphane | Ca2Pb3(AsO4)3Cl | 53.87% Pb | 1,153.97 |
Heliophyllite | Pb6As2O7Cl4 | 75.49% Pb | 1,646.85 |
Helmutwinklerite | PbZn2(AsO4)2•2(H2O) | 31.79% Pb | 651.85 |
Hematophanite | Pb4Fe+++3O8(OH,Cl) | 72.32% Pb | 1,145.95 |
Hemihedrite | Pb10Zn(CrO4)6(SiO4)2F2 | 67.81% Pb | 3,055.52 |
Hephaistosite ! | TlPb2Cl5 | 52.51% Pb | 793.05 |
Heteromorphite | Pb7Sb8S19 | 47.81% Pb | 3,033.65 |
Heyite | Pb5Fe++2(VO4)2O4 | 71.87% Pb | 1,441.57 |
Heyrovskyite | Pb10AgBi5S18 | 54.50% Pb | 3,801.96 |
Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 | 33.14% Pb | 625.17 |
Hinsdalite | (Pb,Sr)Al3(PO4)(SO4)(OH)6 | 28.19% Pb | 551.33 |
Hollandite | Ba(Mn++++,Mn++)8O16 | 4.86% Pb | 852.99 |
Hugelite | Pb2(UO2)3(AsO4)2(OH)4•3(H2O) | 25.51% Pb | 1,624.40 |
Hunchunite ! | (Au,Ag)2Pb | 37.23% Pb | 556.58 |
Hutchinsonite | (Pb,Tl)2As5S9 | 19.28% Pb | 1,074.79 |
Hyalotekite | (Ba,Pb,Ca,K)6(B,Si,Al)2(Si,Be)10O28(F,Cl) | 23.46% Pb | 1,474.06 |
Hydrocerussite | Pb3(CO3)2(OH)2 | 80.14% Pb | 775.63 |
Hydroxylpyromorphite ! | Pb5(PO4)3OH | 77.43% Pb | 1,337.92 |
Hyttsjoite ! | Pb18Ba2Ca5Mn++2Fe+++2Si30O90Cl•6(H2O) | 54.43% Pb | 6,852.27 |
IMA2005-036 ! | Cu8Pb4Ag3Bi19S38 | 17.41% Pb | 4,760.10 |
IMA2007-010 ! | PbHgAs2S6 | 27.63% Pb | 750.03 |
IMA2007-047 ! | Pb2[B5O9]Cl•0.5H2O | 63.08% Pb | 656.90 |
IMA2008-039 | (NH4)3PbCl5 | 47.24% Pb | 438.58 |
IMA2008-053 ! | Cu7Pb27Bi25S68 | 5.01% Pb | 8,264.22 |
IMA2008-063 | Pb[Zn0.25,[]0.75]Fe3H(AsO4)2(OH)6 | 26.84% Pb | 771.98 |
IMA2008-068 ! | Ca2Pb3(PO4)3F | 61.81% Pb | 1,005.67 |
Inaglyite | PbCu3(Ir,Pt)8S16 | 8.44% Pb | 2,454.37 |
Incaite | Pb4Sn4FeSb2S15 | 39.77% Pb | 2,083.98 |
Iranite | Pb10Cu(CrO4)6(SiO4)2(F,OH)2 | 67.87% Pb | 3,052.68 |
Itoite | Pb3[GeO2(OH)2](SO4)2 | 65.27% Pb | 952.35 |
Izoklakeite | Pb27(Cu,Fe)2(Sb,Bi)19S57 | 52.99% Pb | 10,557.27 |
Jagoite | (Pb,Na,Ca)3(Fe+++,Mg)Si3O10(Cl,OH) | 59.61% Pb | 834.25 |
Jamesite | Pb2Zn2Fe+++5(AsO4)5O4 | 26.18% Pb | 1,583.01 |
Jamesonite | Pb4FeSb6S14 | 40.15% Pb | 2,064.07 |
Jaskolskiite | Pb2+xCux(Sb,Bi)2-xS5,x=0.2 | 50.63% Pb | 900.37 |
Jentschite ! | TlPbAs2SbS6 | 23.66% Pb | 875.57 |
Jixianite | Pb(W,Fe+++)2(O,OH)7 | 33.16% Pb | 624.91 |
Joelbruggerite ! | Pb3Zn3Sb+++++As2O13(OH) | 47.29% Pb | 1,314.36 |
Joesmithite | PbCa2(Mg,Fe++,Fe+++)5Si6Be2O22(OH)2 | 19.86% Pb | 1,043.42 |
Jonassonite ! | Au(Bi,Pb)5S4 | 6.01% Pb | 1,344.86 |
Jordanite | Pb14(As,Sb)6S23 | 69.37% Pb | 4,181.50 |
Junoite | Pb3Cu2Bi8(S,Se)16 | 19.92% Pb | 3,121.17 |
Kamitugaite | PbAl(UO2)5(PO4)2(OH)9•9.5(H2O) | 9.87% Pb | 2,098.47 |
Kapitsaite-(Y) ! | (Ba,K,Pb,Na)4(Y,Ca,REE)2[Si8B2(B,Si)2O28F] | 2.92% Pb | 1,419.80 |
Kasolite | Pb(UO2)SiO4•(H2O) | 35.28% Pb | 587.33 |
Kegelite | Pb8Al4Si8O20(SO4)2(CO3)4(OH)8 | 57.59% Pb | 2,878.42 |
Kentrolite | Pb2Mn+++2Si2O9 | 57.09% Pb | 718.61 |
Kerstenite ? | PbSeO4(?) | 59.17% Pb | 350.16 |
Kharaelakhite | (Pt,Cu,Pb,Fe,Ni)9S8 | 35.31% Pb | 880.29 |
Khinite | PbCu++3Te++++++O6(OH)2 | 31.61% Pb | 655.45 |
Kintoreite | PbFe+++3(PO4)2(OH,H2O)6 | 31.01% Pb | 668.24 |
Kirkiite | Pb10Bi3As3S19 | 58.65% Pb | 3,532.96 |
Kitaibelite ? | Ag10PbBi30S51 | 2.25% Pb | 9,190.66 |
Kivuite ? | (Th,Ca,Pb)H2(UO2)4(PO4)2(OH)8•7(H2O) | 1.21% Pb | 1,706.20 |
Kobellite | Pb22Cu4(Bi,Sb)30S69 | 35.45% Pb | 12,858.40 |
Kochkarite | PbBi4Te7 | 10.70% Pb | 1,936.32 |
Kolarite | PbTeCl2 | 51.07% Pb | 405.71 |
Kombatite | Pb14(VO4)2O9Cl4 | 84.91% Pb | 3,416.48 |
Konderite | PbCu3(Rh,Pt,Ir)8S16 | 10.32% Pb | 2,007.80 |
Krettnichite ! | PbMn+++2(VO4)2(OH)2 | 29.95% Pb | 553.38 |
Krivovichevite ! | Pb3[Al(OH)6](SO4)(OH) | 72.20% Pb | 872.37 |
Krupkaite | PbCuBi3S6 | 19.01% Pb | 1,090.08 |
Kudriavite ! | (Cd,Pb)Bi2S4 | 13.21% Pb | 690.39 |
Kuksite | Pb3Zn3Te++++++O6(PO4)2 | 50.48% Pb | 1,231.31 |
Kupcikite ! | Cu3.4Fe0.6Bi5S10 | 0.13% Pb | 1,615.03 |
Kuranakhite | PbMn++++Te++++++O6 | 42.66% Pb | 485.73 |
Laflammeite ! | Pd3Pb2S2 | 51.94% Pb | 797.79 |
Lanarkite | Pb2(SO4)O | 78.71% Pb | 526.46 |
Landauite | NaMnZn2(Ti,Fe+++)6Ti12O38 | 2.39% Pb | 1,730.91 |
Larosite | (Cu,Ag)21(Pb,Bi)2S13 | 9.18% Pb | 2,256.15 |
Larsenite | PbZnSiO4 | 56.82% Pb | 364.67 |
Launayite | Pb22Sb26S61 | 47.09% Pb | 9,679.93 |
Laurelite | Pb7F12Cl2 | 82.91% Pb | 1,749.29 |
Laurionite | PbCl(OH) | 79.80% Pb | 259.66 |
Lautenthalite | PbCu++4(OH)6(SO4)2•3(H2O) | 25.59% Pb | 809.60 |
Lead | Pb | 100.00% Pb | 207.20 |
Leadamalgam | HgPb2 | 67.38% Pb | 614.99 |
Leadhillite | Pb4(SO4)(CO3)2(OH)2 | 76.82% Pb | 1,078.90 |
Lengenbachite | Pb6(Ag,Cu)2As4S13 | 58.09% Pb | 2,140.02 |
Leningradite | PbCu++3(VO4)2Cl2 | 29.66% Pb | 698.62 |
Levyclaudite | Pb8Sn7Cu3(Bi,Sb)3S28 | 40.55% Pb | 500.30 |
Lillianite | Pb3Bi2S6 | 50.46% Pb | 1,231.96 |
Linarite | PbCu(SO4)(OH)2 | 51.69% Pb | 400.82 |
Lindqvistite | Pb2(Mn++,Mg)Fe+++16027 | 23.49% Pb | 1,764.16 |
Lindstromite | Pb3Cu3Bi7S15 | 22.55% Pb | 2,756.09 |
Litharge | PbO | 92.83% Pb | 223.20 |
Liveingite | Pb9As13S28 | 49.91% Pb | 3,736.63 |
Lorettoite ? | Pb7O6Cl2 | 89.68% Pb | 1,617.30 |
Luddenite | Pb2Cu2Si5O14•14(H2O) | 35.78% Pb | 1,158.13 |
Ludlockite | (Fe++,Pb)As+++++2O6 | 3.35% Pb | 309.25 |
Ludlockite-(Pb) * | PbFe+++4As+++10O22 | 13.53% Pb | 1,531.79 |
Lusungite ? | (Sr,Pb)Fe+++3(PO4)2(OH)5•(H2O) | 8.96% Pb | 578.05 |
Macedonite | PbTiO3 | 68.37% Pb | 303.08 |
Macphersonite | Pb4(SO4)(CO3)2(OH)2 | 76.82% Pb | 1,078.90 |
Macquartite | Pb3Cu(CrO4)(SiO3)(OH)4•2(H2O) | 63.35% Pb | 981.28 |
Madocite | Pb17(Sb,As)16S41 | 51.49% Pb | 6,841.29 |
Magnetoplumbite | Pb(Fe+++,Mn+++)12O19 | 19.29% Pb | 1,181.26 |
Mallestigite ! | Pb3Sb+++++(SO4)(AsO4)(OH)6•3(H2O) | 55.83% Pb | 1,135.63 |
Mammothite | Pb6Cu4AlSb+++++O2(SO4)2Cl4(OH)16 | 54.43% Pb | 2,284.17 |
Manganoshadlunite | (Mn,Pb)(Cu,Fe)8S8 | 6.15% Pb | 842.50 |
Margarosanite | Pb(Ca,Mn++)2Si3O9 | 40.14% Pb | 516.23 |
Maricopaite | Pb7Ca2(Si,Al)48O100•32(H2O) | 29.32% Pb | 5,088.14 |
Marrite | PbAgAsS3 | 42.62% Pb | 486.19 |
Marrucciite ! | Hg3Pb16Sb18S46 | 42.51% Pb | 7,534.96 |
Marumoite ! | Pb32As40S92 | 52.72% Pb | 12,577.34 |
Massicot | PbO | 92.83% Pb | 223.20 |
Masuyite | Pb[(UO2)3O3(OH)2]•3(H2O) | 17.97% Pb | 1,153.34 |
Mathewrogersite | Pb7(Fe,Cu)Al3GeSi12O36•(OH,H2O)6 | 54.14% Pb | 2,678.79 |
Matlockite | PbFCl | 79.19% Pb | 261.65 |
Mattheddleite | Pb20(SiO4)7(SO4)4Cl4 | 77.97% Pb | 5,314.65 |
Mawbyite | Pb(Fe+++Zn)2(AsO4)2(OH,H2O)2 | 35.12% Pb | 649.02 |
Mazzettiite ! | Ag3HgPbSbTe5 | 14.15% Pb | 1,493.72 |
Melanotekite | Pb2Fe+++2Si2O9 | 57.06% Pb | 726.26 |
Mendipite | Pb3Cl2O2 | 85.80% Pb | 724.50 |
Meneghinite | Pb13CuSb7S24 | 61.51% Pb | 4,378.98 |
Mereheadite ! | Pb2O(OH)Cl | 85.82% Pb | 482.86 |
Metacalciouranoite | (Ca,Na,Ba)U2O7•2(H2O) | 2.88% Pb | 718.40 |
Metavandendriesscheite | PbU7O22•n(H2O)(n<12) | 8.61% Pb | 2,405.54 |
Miharaite | Cu4FePbBiS6 | 22.56% Pb | 918.61 |
Mimetite | Pb5(AsO4)3Cl | 69.61% Pb | 1,488.21 |
Minium | Pb++2Pb++++O4 | 90.67% Pb | 685.60 |
Moctezumite | Pb(UO2)(TeO3)2 | 25.01% Pb | 828.42 |
Moeloite ! | Pb6Sb6S14(S3) | 49.36% Pb | 2,518.82 |
Molybdofornacite | Pb2Cu[(As,P)O4][(Mo,Cr)O4](OH) | 52.45% Pb | 790.12 |
Molybdomenite | PbSeO3 | 62.01% Pb | 334.16 |
Molybdophyllite | Pb9Mg9Si9O24(OH)24 | 59.61% Pb | 3,128.48 |
Monimolite | (Pb,Ca)2Sb2O7 | 40.18% Pb | 644.55 |
Morelandite | (Ba,Ca,Pb)5(AsO4,PO4)3Cl | 10.30% Pb | 1,005.93 |
Morozeviczite | (Pb,Fe)3Ge1-xS4 | 66.10% Pb | 705.33 |
Mottramite | PbCu(VO4)(OH) | 51.45% Pb | 402.69 |
Mounanaite | PbFe+++2(VO4)2(OH)2 | 35.55% Pb | 582.79 |
Mozgovaite ! | PbBi4(S,Se)7 | 16.20% Pb | 1,279.31 |
Mummeite | Cu0.58Ag3.11Pb1.10Bi6.65S13 | 9.47% Pb | 2,406.82 |
Munakataite ! | Pb2Cu2(Se++++O3)(SO4)(OH)4 | 50.32% Pb | 835.91 |
Murdochite | PbCu6O8-x(Cl,Br)2x | 24.52% Pb | 760.62 |
Museumite ! | Pb2(Pb,Sb)2S8[Te,Au]2 | 51.99% Pb | 1,992.56 |
Mutnovskite ! | Pb2AsS3(I,Cl,Br) | 61.52% Pb | 670.21 |
Nadorite | PbSbO2Cl | 52.27% Pb | 396.40 |
Nagyagite | AuPb(Sb,Bi)Te2-3S6 | 19.56% Pb | 1,059.12 |
Nalivkinite ! | Li2NaFe++7Ti2Si8O24(OH)4F | 0.32% Pb | 1,309.53 |
Nasledovite | PbMn3Al4(CO3)4(SO4)O5•5(H2O) | 21.01% Pb | 986.11 |
Nasonite | Pb6Ca4Si6O21Cl2 | 62.67% Pb | 1,983.71 |
Nealite | Pb4Fe++(As+++++O4)2Cl4 | 63.54% Pb | 1,304.30 |
Nealite-(H2O) * | Pb4Fe++(As+++O3)2Cl4•2(H2O) | 63.35% Pb | 1,308.33 |
Neyite | AgCu3Pb12.5Bi13S34 | 37.88% Pb | 6,619.03 |
Nezilovite ! | PbZn2(Mn++++,Ti++++)2Fe+++8O19 | 17.34% Pb | 1,195.09 |
Nordstromite | Pb3CuBi7(S10Se4) | 22.32% Pb | 2,784.51 |
Novodneprite ! | AuPb3 | 75.94% Pb | 818.57 |
Nuffieldite | Pb2Cu(Pb,Bi)Bi2S7 | 38.99% Pb | 1,328.46 |
Oboyerite | Pb6H6(Te++++O3)3(Te++++++O6)2•2(H2O) | 55.03% Pb | 2,259.27 |
Olsacherite | Pb2(SeO4)(SO4) | 63.42% Pb | 653.42 |
Orlandiite ! | Pb3(Cl,OH)4(SeO3)•(H2O) | 69.13% Pb | 899.16 |
Orpheite | PbAl3(PO4,SO4)2(OH)6(?) | 35.68% Pb | 580.68 |
Osarizawaite | PbCuAl2(SO4)2(OH)6 | 33.48% Pb | 618.88 |
Otjisumeite | PbGe4O9 | 32.29% Pb | 641.63 |
Ourayite | Pb4Ag3Bi5S13 | 29.86% Pb | 20,815.77 |
Owensite | (Ba,Pb)6(Cu,Fe,Ni)25S27 | 12.38% Pb | 3,348.26 |
Owyheeite | Pb7Ag2(Sb,Bi)8S20 | 41.97% Pb | 3,455.92 |
Paarite ! | Cu1.7Pb1.7Bi6.3S12 | 16.45% Pb | 2,166.36 |
Paderaite | Cu7((Cu,Ag)0.33Pb1.33Bi11.33)13S22 | 7.42% Pb | 3,824.86 |
Palmierite | (K,Na)2Pb(SO4)2 | 44.13% Pb | 469.47 |
Parajamesonite ? | Pb4FeSb6S14 | 40.15% Pb | 2,064.07 |
Parakhinite | Cu++3PbTe++++++O4(OH)6 | 29.96% Pb | 691.48 |
Paralaurionite | PbCl(OH) | 79.80% Pb | 259.66 |
Parkerite | Ni3(Bi,Pb)2S2 | 15.76% Pb | 657.27 |
Parkinsonite | (Pb,Mo,[])8O8Cl2 | 85.45% Pb | 1,697.27 |
Parsonsite | Pb2(UO2)(PO4)2•2(H2O) | 45.52% Pb | 910.40 |
Pasavaite ! | Pd3Pb2Te2 | 42.10% Pb | 989.23 |
Pattersonite ! | PbFe3(PO4)2(OH)4(H2O,OH)2 | 31.02% Pb | 667.91 |
Paulmooreite | Pb2As+++2O5 | 64.32% Pb | 644.24 |
Pavonite | (Ag,Cu)(Bi,Pb)3S5 | 17.60% Pb | 882.72 |
Pekoite | PbCuBi11(S,Se)18 | 6.39% Pb | 3,240.51 |
Pellouxite ! | (Cu,Ag)Pb10Sb12S27(Cl,S)0.6O | 47.36% Pb | 4,532.07 |
Penfieldite | Pb2Cl3(OH) | 77.06% Pb | 537.77 |
Perite | PbBiO2Cl | 42.84% Pb | 483.63 |
Petrovicite | PbHgCu3BiSe5 | 17.23% Pb | 1,202.21 |
Petterdite ! | PbCr+++2(CO3)2(OH)4•H2O | 40.63% Pb | 510.01 |
Philipsbornite | PbAl3(AsO4)2(OH)5•(H2O) | 30.97% Pb | 669.04 |
Philolithite ! | Pb12O6Mn(Mg,Mn)2(Mn,Mg)4(SO4)(CO3)4Cl4(OH)12 | 69.30% Pb | 3,587.70 |
Phoenicochroite | Pb2(CrO4)O | 75.84% Pb | 546.39 |
Phosgenite | Pb2(CO3)Cl2 | 75.99% Pb | 545.31 |
Phosphogartrellite ! | PbCuFe+++(PO4)2(OH,H2O)2 | 37.57% Pb | 551.56 |
Phosphohedyphane ! | Ca2Pb3(PO4)3Cl | 62.46% Pb | 1,068.23 |
Phosphowalpurgite ! | (UO2)Bi4(PO4)O4•2(H2O) | 0.15% Pb | 1,391.69 |
Pillaite ! | Pb9Sb10S23ClO0.5 | 49.29% Pb | 3,909.56 |
Pinalite | Pb3(WO4)OCl2 | 65.00% Pb | 956.35 |
Pizgrischite ! | (Cu,Fe)Cu14PbBi17S35 | 2.12% Pb | 5,853.00 |
Plagionite | Pb5Sb8S17 | 40.55% Pb | 2,555.12 |
Plattnerite | PbO2 | 86.62% Pb | 239.20 |
Platynite ? | (Bi,Pb)3(Se,S)4 | 23.17% Pb | 894.11 |
Playfairite | Pb16Sb18S43 | 48.15% Pb | 6,885.54 |
Plumalsite * | Pb4Al2(SiO3)7(?) | 58.56% Pb | 1,415.35 |
Plumboagardite ! | (Pb,REE,Ca)Cu6(AsO4)3(OH)6•3(H2O) | 8.31% Pb | 1,097.39 |
Plumbobetafite | (Pb,U,Ca)(Ti,Nb)2O6(OH,F) | 24.33% Pb | 425.90 |
Plumboferrite | Pb2Fe+++(11-x)Mn++xO19-2x(x=1/3) | 31.53% Pb | 1,314.19 |
Plumbogummite | PbAl3(PO4)2(OH)5•(H2O) | 35.65% Pb | 581.14 |
Plumbojarosite | PbFe+++6(SO4)4(OH)12 | 18.33% Pb | 1,130.62 |
Plumbomicrolite | (Pb,Ca,U)2Ta2O6(OH) | 31.27% Pb | 795.19 |
Plumbonacrite | Pb10(CO3)6O(OH)6 | 81.25% Pb | 2,550.10 |
Plumbopalladinite | Pd3Pb2 | 56.48% Pb | 733.66 |
Plumbophyllite | Pb2Si4O10•H2O | 58.80% Pb | 704.75 |
Plumbopyrochlore | (Pb,Y,U,Ca)2-xNb2O6(OH) | 34.25% Pb | 484.00 |
Plumbotellurite | PbTe++++O3 | 54.13% Pb | 382.80 |
Plumbotsumite | Pb5Si4O8(OH)10 | 71.63% Pb | 1,446.41 |
Plumosite * | Pb2Sb2S5 | 50.65% Pb | 818.23 |
Polarite | Pd(Bi,Pb) | 16.45% Pb | 314.96 |
Polkovicite | (Fe,Pb)3(Ge,Fe)1-xS4 | 33.03% Pb | 470.48 |
Potosiite | Pb6Sn2FeSb2S14 | 55.78% Pb | 2,228.89 |
Pottsite | PbBiH(VO4)2•2(H2O) | 30.33% Pb | 683.10 |
Poubaite | PbBi2Se2(Te,S)2 | 20.92% Pb | 990.51 |
Prewittite ! | KPb1.5ZnCu6O2(SeO3)2Cl10 | 21.63% Pb | 1,437.01 |
Proshchenkoite-(Y) ! | (Y,REE,Ca,Na,Mn)15Fe++Ca(P,Si)Si6B3(O,F)48 | 0.08% Pb | 2,711.51 |
Proudite | Cu1.9Ag0.1Pb15.6Bi20.4Sb0.1S32.4Se14.5 | 32.91% Pb | 9,823.08 |
Przhevalskite | Pb(UO2)2(PO4)2•4(H2O) | 20.53% Pb | 1,009.26 |
Pseudoboleite | Pb5Cu4Cl10(OH)8•2(H2O) | 58.59% Pb | 10,962.72 |
Pseudocotunnite | K2PbCl4(?) | 48.50% Pb | 427.21 |
Pseudograndreefite | Pb6SO4F1O | 81.29% Pb | 1,529.25 |
Pyrobelonite | PbMn(VO4)(OH) | 52.58% Pb | 394.08 |
Pyromorphite | Pb5(PO4)3Cl | 76.38% Pb | 1,356.37 |
Quadratite ! | Ag(Cd,Pb)AsS3 | 10.10% Pb | 410.36 |
Queitite | Pb4Zn2(SiO4)(Si2O7)(SO4) | 62.98% Pb | 1,315.89 |
Quenselite | PbMn+++O2(OH) | 66.59% Pb | 311.14 |
Radhakrishnaite | PbTe3(Cl,S)2 | 31.51% Pb | 657.52 |
Ramdohrite | Ag3Pb6Sb11S24 | 33.82% Pb | 3,675.64 |
Rankamaite | (Na,K,Pb,Li)3(Ta,Nb,Al)11(O,OH)30 | 2.85% Pb | 2,177.26 |
Rappoldite ! | Pb(Co,Ni,Zn,)2(AsO4)2•2(H2O) | 32.31% Pb | 641.37 |
Raspite | PbWO4 | 45.53% Pb | 455.05 |
Rathite | Pb8Pb4-x(Tl2As2)x(Ag2As2)As16S40 | 44.38% Pb | 5,369.42 |
Rayite | (Ag,Tl)2Pb8Sb8S21 | 46.44% Pb | 3,568.98 |
Renardite | Pb(UO2)4(PO4)2(OH)4•7(H2O) | 12.40% Pb | 1,671.39 |
Rhodplumsite | Pb2Rh3S2 | 52.64% Pb | 787.25 |
Richetite | PbU++++++4O13•4(H2O) | 14.40% Pb | 1,439.37 |
Robinsonite | Pb4Sb6S13 | 41.94% Pb | 1,976.16 |
Roeblingite | Pb2Ca6(Si6O18)(SO4)2(OH)2•4(H2O) | 29.40% Pb | 1,409.57 |
Romanite * | (Fe++,U,Pb)2(Ti,Fe+++)O4 | 11.35% Pb | 365.14 |
Roshchinite | Ag19Pb10Sb51S96orPb(Ag,Cu)2(Sb,As)5S10 | 12.86% Pb | 12,887.63 |
Rosiaite ! | PbSb+++++2O6 | 37.90% Pb | 546.70 |
Rosieresite | (Pb,Cu,Al)(PO4)x•n(H2O) | 35.61% Pb | 349.14 |
Rouseite | Pb2Mn++(As+++O3)2•2(H2O) | 47.41% Pb | 874.13 |
Rouxelite ! | Cu2HgPb22Sb28S64(O,S)2 | 45.01% Pb | 10,485.87 |
Rucklidgeite | (Bi,Pb)3Te4 | 13.68% Pb | 1,136.01 |
Saddlebackite ! | Pb2Bi2Te2S3 | 35.01% Pb | 1,183.76 |
Sahlinite | Pb14(AsO4)2O9Cl4 | 83.73% Pb | 3,464.44 |
Sakharovaite ? | (Pb,Fe)(Bi,Sb)2S4 | 28.41% Pb | 656.33 |
Salzburgite ! | Cu1.6Pb1.6Bi6.4S12 | 15.81% Pb | 2,162.05 |
Samarskite-(Yb) ! | (Yb,Y,REE,U,Th,Ca,Fe++) (Nb,Ta,Ti)O4 | 0.27% Pb | 312.29 |
Sanromanite ! | Na2CaPb3(CO3)5 | 61.68% Pb | 1,007.70 |
Santanaite | Pb++9Pb++++2CrO16 | 88.10% Pb | 2,587.19 |
Santarosaite ! | CuB2O4 | 4.17% Pb | 149.03 |
Sartorite | PbAs2S4 | 37.93% Pb | 4,479.49 |
Sayrite | Pb2(UO2)5O6(OH)2•4(H2O) | 21.07% Pb | 1,966.61 |
Scainiite ! | Pb14Sb30S54O5 | 36.98% Pb | 8,571.79 |
Schapbachite ! | AgBiS2 | 18.49% Pb | 392.22 |
Schieffelinite | Pb(Te++++++,S)O4•(H2O) | 52.73% Pb | 392.93 |
Schirmerite | Ag3Pb3Bi9S18toAg3Pb6Bi7S18 | 20.82% Pb | 2,985.26 |
Schlegelite ! | Bi7O4(MoO4)2(AsO4)3 | 0.47% Pb | 2,227.18 |
Schlemaite ! | (Cu,[])6(Pb,Bi)Se4 | 4.02% Pb | 824.04 |
Schmiederite | Pb2Cu++2(Se++++O3)(Se++++++O4)(OH)4 | 47.12% Pb | 879.44 |
Schuilingite-(Nd) | PbCu(Nd,Gd,Sm,Y)(CO3)3(OH)•1.5(H2O) | 29.76% Pb | 696.16 |
Schultenite | PbHAsO4 | 59.69% Pb | 347.13 |
Schwartzembergite | Pb++6(IO3)2O3Cl4 | 69.73% Pb | 1,782.81 |
Scotlandite | PbSO3 | 72.13% Pb | 287.26 |
Scrutinyite | PbO2 | 86.62% Pb | 239.20 |
Seeligerite | Pb3Cl3(IO3)O | 67.65% Pb | 918.86 |
Segnitite | PbFe+++3H(AsO4)2(OH)6 | 27.42% Pb | 755.63 |
Selenopolybasite ! | [(Ag,Cu)6(Sb,As)2(S,Se)7][Ag9Cu(S,Se)2Se2] | 0.09% Pb | 2,378.81 |
Seligmannite | PbCuAsS3 | 46.89% Pb | 441.87 |
Semenovite | (Na,Ca)9(Ce,La)2(Fe++,Mn)(Si,Be)20(O,OH,F)48 | 0.44% Pb | 1,875.54 |
Semseyite | Pb9Sb8S21 | 53.10% Pb | 3,512.19 |
Senaite | Pb(Ti,Fe,Mn)21O38 | 10.88% Pb | 1,904.66 |
Shadlunite | (Pb,Cd)(Fe,Cu)8S8 | 17.22% Pb | 902.20 |
Shandite | Pb2Ni3S2 | 63.31% Pb | 654.60 |
Shannonite ! | Pb2OCO3 | 84.50% Pb | 490.41 |
Sidpietersite ! | Pb++4(S++++++O3S--)O2(OH)2 | 82.31% Pb | 1,006.94 |
Skaergaardite ! | CuPd | 0.36% Pb | 173.19 |
Sorbyite | Pb19(Sb,As)20S49 | 68.62% Pb | 5,737.49 |
Soucekite | PbCuBi(S,Se)3 | 32.77% Pb | 632.20 |
Spriggite ! | Pb3[(UO2)6O8(OH)2](H2O)x;x~3 | 23.76% Pb | 2,424.63 |
Sreinite ! | Pb2(UO2)11(BiO)8(PO4)5(OH)19•6(H2O) | 6.80% Pb | 6,090.63 |
Sterryite | Ag2Pb10(Sb,As)12S29 | 45.66% Pb | 4,538.17 |
Steverustite | Pb++5(OH)5[Cu+(SO3S--)3](H2O)1.67 | 66.79% Pb | 1,551.06 |
Stolzite | PbWO4 | 45.53% Pb | 455.05 |
Sundiusite | Pb10(SO4)Cl2O8 | 87.54% Pb | 2,366.96 |
Suredaite ! | PbSnS3 | 42.46% Pb | 390.35 |
Surite | (Pb,Cu)2-3(CO3)1.5-2(OH,F)0.5-1[(Al,Fe+++)2(Si,Al)4O10(OH)2]•n(H2O) | 39.80% Pb | 937.16 |
Susannite | Pb4(SO4)(CO3)2(OH)2 | 76.82% Pb | 1,078.90 |
Symesite ! | Pb10(SO4)O7Cl4•(H2O) | 84.92% Pb | 2,439.89 |
Synadelphite | (Mn,Mg,Ca,Pb)9(As+++O3)(As+++++O4)2(OH)9•2(H2O)(?) | 1.90% Pb | 1,089.48 |
Taramellite | Ba4(Fe+++,Ti,Fe++,Mg)4(B2Si8O27)O2Clx (x=0 to 1) | 8.15% Pb | 1,525.66 |
Tazieffite ! | Pb20Cd2(As,Bi)22S50Cl10 | 49.47% Pb | 8,377.10 |
Teallite | PbSnS2 | 53.12% Pb | 390.04 |
Telluronevskite ! | Bi3TeSe2 | 0.47% Pb | 890.10 |
Thometzekite | Pb(Cu,Zn)2(AsO4)2•2(H2O) | 31.92% Pb | 649.08 |
Thorikosite | Pb3(Sb+++,As+++)O3(OH)Cl2 | 71.65% Pb | 867.55 |
Tintinaite | Pb22Cu+4(Sb,Bi)30S69 | 40.70% Pb | 5,345.18 |
Tischendorfite ! | Pd8Hg3Se9 | 1.93% Pb | 2,150.81 |
Tlapallite | H6(Ca,Pb)2Cu3(SO4)(Te++++O3)4(Te++++++O6) | 7.49% Pb | 1,382.46 |
Treasurite | Ag7Pb6Bi15S32 | 20.18% Pb | 6,159.10 |
Trigonite | Pb3Mn(As+++O3)2(As+++O2OH) | 59.41% Pb | 1,046.31 |
Tsugaruite ! | Pb4As2S7 | 68.89% Pb | 1,203.11 |
Tsumcorite | PbZnFe++(AsO4)2•(H2O) | 33.19% Pb | 624.29 |
Tsumebite | Pb2Cu(PO4)(SO4)(OH) | 60.41% Pb | 685.99 |
Twinnite | Pb(Sb,As)2S4 | 36.08% Pb | 574.28 |
Uchucchacuaite | AgPb3MnSb5S12 | 34.96% Pb | 1,777.95 |
Uranotungstite | (Fe++,Ba,Pb)(UO2)2WO4(OH)4•12(H2O) | 1.77% Pb | 1,167.54 |
Urvantsevite | Pd(Bi,Pb)2 | 19.79% Pb | 523.49 |
Ustarasite | Pb(Bi,Sb)6S10 | 11.92% Pb | 1,738.13 |
Vanadinite | Pb5(VO4)3Cl | 73.15% Pb | 1,416.27 |
Vandendriesscheite | Pb(UO2)10O6(OH)11•11(H2O) | 9.44% Pb | 3,513.04 |
Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) | 58.70% Pb | 705.92 |
Veenite | Pb2(Sb,As)2S5 | 53.40% Pb | 776.08 |
Viaeneite ! | (Fe,Pb)4S8O | 7.88% Pb | 526.19 |
Vikingite | Ag5Pb8Bi13S30 | 28.21% Pb | 5,875.67 |
Vurroite ! | Pb20Sn2(Bi,As)22S54Cl6 | 41.00% Pb | 9,577.60 |
Wakefieldite-(Ce) | (Ce+++,Pb++,Pb++++)VO4 | 29.40% Pb | 281.89 |
Wallisite | PbTl(Cu,Ag)As2S5 | 26.02% Pb | 796.38 |
Watkinsonite | PbCu2Bi4(Se,S)8 | 11.97% Pb | 1,731.55 |
Weibullite | Pb6Bi8(S,Se)18 | 33.78% Pb | 3,679.81 |
Wherryite | Pb7Cu2(SO4)4(SiO4)2(OH)2 | 64.65% Pb | 2,243.47 |
Wickenburgite | Pb3CaAl2Si10O27•4(H2O) | 41.43% Pb | 1,500.54 |
Widenmannite | Pb2(UO2)(CO3)3 | 47.94% Pb | 864.46 |
Wittite | Pb3Bi4(S,Se)9 | 32.94% Pb | 1,886.80 |
Wolsendorfite | (Pb,Ba,Ca)U2O7•2(H2O) | 15.67% Pb | 793.61 |
Wulfenite | PbMoO4 | 56.44% Pb | 367.14 |
Xilingolite | Pb3Bi2S6 | 50.46% Pb | 1,231.96 |
Xingzhongite | (Pb,Cu,Fe)(Ir,Pt,Rh)2S4 | 19.26% Pb | 645.53 |
Yedlinite | Pb6CrCl6(O,OH)8 | 75.90% Pb | 1,637.92 |
Yttrobetafite-(Y) | (Y,U,Ce)2(Ti,Nb,Ta)2O6(OH) | 9.48% Pb | 437.15 |
Zdenekite | NaPbCu++5(AsO4)4Cl•5(H2O) | 16.86% Pb | 1,229.13 |
Zenzenite | Pb3(Fe+++,Mn+++)4Mn++++3O15 | 49.17% Pb | 1,222.03 |
Zimbabweite | Na(Pb,Na,K)2(Ta,Nb,Ti)4As+++4O18 | 13.83% Pb | 1,498.05 |
Zincgartrellite ! | Pb(Zn,Fe,Cu)2(AsO4)2(OH,H2O)2 | 32.15% Pb | 644.39 |
Zinkenite | Pb9Sb22S42 | 31.66% Pb | 5,890.07 |
Zoubekite | AgPb4Sb4S10 | 47.51% Pb | 1,744.33 |
Zvyagintsevite | Pd3Pb | 34.69% Pb | 537.50 |
(* - Mineral Name Is Not IMA Approved)
(! - New Dana classification added or changed from Danas New Mineralogy)
(? - IMA Discredited Mineral Species Name)
There are 514 minerals with Pb in the Mineralogy Database.
- Actinium
- Aluminum
- Americium
- Antimony
- Argon
- Arsenic
- Astatine
- Barium
- Berkelium
- Beryllium
- Bismuth
- Boron
- Bromine
- Cadmium
- Calcium
- Calfornium
- Carbon
- Cerium
- Cesium
- Chlorine
- Chromium
- Cobalt
- Copper
- Curium
- Dysprosium
- Einsteinium
- Erbium
- Europium
- Fermium
- Fluorine
- Francium
- Gadolinium
- Gallium
- Germanium
- Gold
- Hafnium
- Hahnium
- Helium
- Holmium
- Hydrogen
- Indium
- Iodine
- Iridium
- Iron
- Krypton
- Lanthanum
- Lead
- Lithium
- Lutetium
- Magnesium
- Manganese
- Mendelevium
- Mercury
- Molybdenum
- Neodymium
- Neon
- Neptunium
- Nickel
- Niobium
- Nitrogen
- Nobelium
- Osmium
- Oxygen
- Palladium
- Phosphorus
- Platinum
- Plutonium
- Polonium
- Potassium
- Praeseodymium
- Promethium
- Protactinium
- Radium
- Radon
- Rhenium
- Rhodium
- Rubidium
- Ruthenium
- Samarium
- Scandium
- Selenium
- Silicon
- Silver
- Sodium
- Strontium
- Sulfur
- Tantalum
- Technetium
- Tellurium
- Terbium
- Thallium
- Thorium
- Thulium
- Tin
- Titanium
- Tungsten
- Uranium
- Vanadium
- Xenon
- Ytterbium
- Yttrium
- Zinc
- Zirconium